+ */
+class HtmlFormatter extends NormalizerFormatter
+{
+ /**
+ * Translates Monolog log levels to html color priorities.
+ */
+ protected $logLevels = array(
+ Logger::DEBUG => '#cccccc',
+ Logger::INFO => '#468847',
+ Logger::NOTICE => '#3a87ad',
+ Logger::WARNING => '#c09853',
+ Logger::ERROR => '#f0ad4e',
+ Logger::CRITICAL => '#FF7708',
+ Logger::ALERT => '#C12A19',
+ Logger::EMERGENCY => '#000000',
+ );
+
+ /**
+ * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+ */
+ public function __construct($dateFormat = null)
+ {
+ parent::__construct($dateFormat);
+ }
+
+ /**
+ * Creates an HTML table row
+ *
+ * @param string $th Row header content
+ * @param string $td Row standard cell content
+ * @param bool $escapeTd false if td content must not be html escaped
+ * @return string
+ */
+ private function addRow($th, $td = ' ', $escapeTd = true)
+ {
+ $th = htmlspecialchars($th, ENT_NOQUOTES, 'UTF-8');
+ if ($escapeTd) {
+ $td = ''.htmlspecialchars($td, ENT_NOQUOTES, 'UTF-8').'
';
+ }
+
+ return "\n| $th: | \n".$td." | \n
";
+ }
+
+ /**
+ * Create a HTML h1 tag
+ *
+ * @param string $title Text to be in the h1
+ * @param int $level Error level
+ * @return string
+ */
+ private function addTitle($title, $level)
+ {
+ $title = htmlspecialchars($title, ENT_NOQUOTES, 'UTF-8');
+
+ return ''.$title.'
';
+ }
+
+ /**
+ * Formats a log record.
+ *
+ * @param array $record A record to format
+ * @return mixed The formatted record
+ */
+ public function format(array $record)
+ {
+ $output = $this->addTitle($record['level_name'], $record['level']);
+ $output .= '';
+
+ $output .= $this->addRow('Message', (string) $record['message']);
+ $output .= $this->addRow('Time', $record['datetime']->format($this->dateFormat));
+ $output .= $this->addRow('Channel', $record['channel']);
+ if ($record['context']) {
+ $embeddedTable = '';
+ foreach ($record['context'] as $key => $value) {
+ $embeddedTable .= $this->addRow($key, $this->convertToString($value));
+ }
+ $embeddedTable .= '
';
+ $output .= $this->addRow('Context', $embeddedTable, false);
+ }
+ if ($record['extra']) {
+ $embeddedTable = '';
+ foreach ($record['extra'] as $key => $value) {
+ $embeddedTable .= $this->addRow($key, $this->convertToString($value));
+ }
+ $embeddedTable .= '
';
+ $output .= $this->addRow('Extra', $embeddedTable, false);
+ }
+
+ return $output.'
';
+ }
+
+ /**
+ * Formats a set of log records.
+ *
+ * @param array $records A set of records to format
+ * @return mixed The formatted set of records
+ */
+ public function formatBatch(array $records)
+ {
+ $message = '';
+ foreach ($records as $record) {
+ $message .= $this->format($record);
+ }
+
+ return $message;
+ }
+
+ protected function convertToString($data)
+ {
+ if (null === $data || is_scalar($data)) {
+ return (string) $data;
+ }
+
+ $data = $this->normalize($data);
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return json_encode($data, JSON_PRETTY_PRINT | JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return str_replace('\\/', '/', json_encode($data));
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php
new file mode 100644
index 0000000..06e9d13
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php
@@ -0,0 +1,202 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Exception;
+
+/**
+ * Encodes whatever record data is passed to it as json
+ *
+ * This can be useful to log to databases or remote APIs
+ *
+ * @author Jordi Boggiano
+ */
+class JsonFormatter extends NormalizerFormatter
+{
+ const BATCH_MODE_JSON = 1;
+ const BATCH_MODE_NEWLINES = 2;
+
+ protected $batchMode;
+ protected $appendNewline;
+ /**
+ * @var bool
+ */
+ protected $includeStacktraces = false;
+
+ /**
+ * @param int $batchMode
+ */
+ public function __construct($batchMode = self::BATCH_MODE_JSON, $appendNewline = true)
+ {
+ $this->batchMode = $batchMode;
+ $this->appendNewline = $appendNewline;
+ }
+
+ /**
+ * The batch mode option configures the formatting style for
+ * multiple records. By default, multiple records will be
+ * formatted as a JSON-encoded array. However, for
+ * compatibility with some API endpoints, alternative styles
+ * are available.
+ *
+ * @return int
+ */
+ public function getBatchMode()
+ {
+ return $this->batchMode;
+ }
+
+ /**
+ * True if newlines are appended to every formatted record
+ *
+ * @return bool
+ */
+ public function isAppendingNewlines()
+ {
+ return $this->appendNewline;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ return $this->toJson($this->normalize($record), true) . ($this->appendNewline ? "\n" : '');
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function formatBatch(array $records)
+ {
+ switch ($this->batchMode) {
+ case static::BATCH_MODE_NEWLINES:
+ return $this->formatBatchNewlines($records);
+
+ case static::BATCH_MODE_JSON:
+ default:
+ return $this->formatBatchJson($records);
+ }
+ }
+
+ /**
+ * @param bool $include
+ */
+ public function includeStacktraces($include = true)
+ {
+ $this->includeStacktraces = $include;
+ }
+
+ /**
+ * Return a JSON-encoded array of records.
+ *
+ * @param array $records
+ * @return string
+ */
+ protected function formatBatchJson(array $records)
+ {
+ return $this->toJson($this->normalize($records), true);
+ }
+
+ /**
+ * Use new lines to separate records instead of a
+ * JSON-encoded array.
+ *
+ * @param array $records
+ * @return string
+ */
+ protected function formatBatchNewlines(array $records)
+ {
+ $instance = $this;
+
+ $oldNewline = $this->appendNewline;
+ $this->appendNewline = false;
+ array_walk($records, function (&$value, $key) use ($instance) {
+ $value = $instance->format($value);
+ });
+ $this->appendNewline = $oldNewline;
+
+ return implode("\n", $records);
+ }
+
+ /**
+ * Normalizes given $data.
+ *
+ * @param mixed $data
+ *
+ * @return mixed
+ */
+ protected function normalize($data)
+ {
+ if (is_array($data) || $data instanceof \Traversable) {
+ $normalized = array();
+
+ $count = 1;
+ foreach ($data as $key => $value) {
+ if ($count++ >= 1000) {
+ $normalized['...'] = 'Over 1000 items, aborting normalization';
+ break;
+ }
+ $normalized[$key] = $this->normalize($value);
+ }
+
+ return $normalized;
+ }
+
+ if ($data instanceof Exception) {
+ return $this->normalizeException($data);
+ }
+
+ return $data;
+ }
+
+ /**
+ * Normalizes given exception with or without its own stack trace based on
+ * `includeStacktraces` property.
+ *
+ * @param Exception|Throwable $e
+ *
+ * @return array
+ */
+ protected function normalizeException($e)
+ {
+ // TODO 2.0 only check for Throwable
+ if (!$e instanceof Exception && !$e instanceof \Throwable) {
+ throw new \InvalidArgumentException('Exception/Throwable expected, got '.gettype($e).' / '.get_class($e));
+ }
+
+ $data = array(
+ 'class' => get_class($e),
+ 'message' => $e->getMessage(),
+ 'code' => $e->getCode(),
+ 'file' => $e->getFile().':'.$e->getLine(),
+ );
+
+ if ($this->includeStacktraces) {
+ $trace = $e->getTrace();
+ foreach ($trace as $frame) {
+ if (isset($frame['file'])) {
+ $data['trace'][] = $frame['file'].':'.$frame['line'];
+ } else {
+ // We should again normalize the frames, because it might contain invalid items
+ $data['trace'][] = $this->normalize($frame);
+ }
+ }
+ }
+
+ if ($previous = $e->getPrevious()) {
+ $data['previous'] = $this->normalizeException($previous);
+ }
+
+ return $data;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php
new file mode 100644
index 0000000..0e62aa3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php
@@ -0,0 +1,169 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats incoming records into a one-line string
+ *
+ * This is especially useful for logging to files
+ *
+ * @author Jordi Boggiano
+ * @author Christophe Coevoet
+ */
+class LineFormatter extends NormalizerFormatter
+{
+ const SIMPLE_FORMAT = "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n";
+
+ protected $format;
+ protected $allowInlineLineBreaks;
+ protected $ignoreEmptyContextAndExtra;
+ protected $includeStacktraces;
+
+ /**
+ * @param string $format The format of the message
+ * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+ * @param bool $allowInlineLineBreaks Whether to allow inline line breaks in log entries
+ * @param bool $ignoreEmptyContextAndExtra
+ */
+ public function __construct($format = null, $dateFormat = null, $allowInlineLineBreaks = false, $ignoreEmptyContextAndExtra = false)
+ {
+ $this->format = $format ?: static::SIMPLE_FORMAT;
+ $this->allowInlineLineBreaks = $allowInlineLineBreaks;
+ $this->ignoreEmptyContextAndExtra = $ignoreEmptyContextAndExtra;
+ parent::__construct($dateFormat);
+ }
+
+ public function includeStacktraces($include = true)
+ {
+ $this->includeStacktraces = $include;
+ if ($this->includeStacktraces) {
+ $this->allowInlineLineBreaks = true;
+ }
+ }
+
+ public function allowInlineLineBreaks($allow = true)
+ {
+ $this->allowInlineLineBreaks = $allow;
+ }
+
+ public function ignoreEmptyContextAndExtra($ignore = true)
+ {
+ $this->ignoreEmptyContextAndExtra = $ignore;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ $vars = parent::format($record);
+
+ $output = $this->format;
+
+ foreach ($vars['extra'] as $var => $val) {
+ if (false !== strpos($output, '%extra.'.$var.'%')) {
+ $output = str_replace('%extra.'.$var.'%', $this->stringify($val), $output);
+ unset($vars['extra'][$var]);
+ }
+ }
+
+ foreach ($vars['context'] as $var => $val) {
+ if (false !== strpos($output, '%context.'.$var.'%')) {
+ $output = str_replace('%context.'.$var.'%', $this->stringify($val), $output);
+ unset($vars['context'][$var]);
+ }
+ }
+
+ if ($this->ignoreEmptyContextAndExtra) {
+ if (empty($vars['context'])) {
+ unset($vars['context']);
+ $output = str_replace('%context%', '', $output);
+ }
+
+ if (empty($vars['extra'])) {
+ unset($vars['extra']);
+ $output = str_replace('%extra%', '', $output);
+ }
+ }
+
+ foreach ($vars as $var => $val) {
+ if (false !== strpos($output, '%'.$var.'%')) {
+ $output = str_replace('%'.$var.'%', $this->stringify($val), $output);
+ }
+ }
+
+ return $output;
+ }
+
+ public function formatBatch(array $records)
+ {
+ $message = '';
+ foreach ($records as $record) {
+ $message .= $this->format($record);
+ }
+
+ return $message;
+ }
+
+ public function stringify($value)
+ {
+ return $this->replaceNewlines($this->convertToString($value));
+ }
+
+ protected function normalizeException($e)
+ {
+ // TODO 2.0 only check for Throwable
+ if (!$e instanceof \Exception && !$e instanceof \Throwable) {
+ throw new \InvalidArgumentException('Exception/Throwable expected, got '.gettype($e).' / '.get_class($e));
+ }
+
+ $previousText = '';
+ if ($previous = $e->getPrevious()) {
+ do {
+ $previousText .= ', '.get_class($previous).'(code: '.$previous->getCode().'): '.$previous->getMessage().' at '.$previous->getFile().':'.$previous->getLine();
+ } while ($previous = $previous->getPrevious());
+ }
+
+ $str = '[object] ('.get_class($e).'(code: '.$e->getCode().'): '.$e->getMessage().' at '.$e->getFile().':'.$e->getLine().$previousText.')';
+ if ($this->includeStacktraces) {
+ $str .= "\n[stacktrace]\n".$e->getTraceAsString();
+ }
+
+ return $str;
+ }
+
+ protected function convertToString($data)
+ {
+ if (null === $data || is_bool($data)) {
+ return var_export($data, true);
+ }
+
+ if (is_scalar($data)) {
+ return (string) $data;
+ }
+
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return $this->toJson($data, true);
+ }
+
+ return str_replace('\\/', '/', @json_encode($data));
+ }
+
+ protected function replaceNewlines($str)
+ {
+ if ($this->allowInlineLineBreaks) {
+ return $str;
+ }
+
+ return str_replace(array("\r\n", "\r", "\n"), ' ', $str);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php
new file mode 100644
index 0000000..401859b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php
@@ -0,0 +1,47 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Encodes message information into JSON in a format compatible with Loggly.
+ *
+ * @author Adam Pancutt
+ */
+class LogglyFormatter extends JsonFormatter
+{
+ /**
+ * Overrides the default batch mode to new lines for compatibility with the
+ * Loggly bulk API.
+ *
+ * @param int $batchMode
+ */
+ public function __construct($batchMode = self::BATCH_MODE_NEWLINES, $appendNewline = false)
+ {
+ parent::__construct($batchMode, $appendNewline);
+ }
+
+ /**
+ * Appends the 'timestamp' parameter for indexing by Loggly.
+ *
+ * @see https://www.loggly.com/docs/automated-parsing/#json
+ * @see \Monolog\Formatter\JsonFormatter::format()
+ */
+ public function format(array $record)
+ {
+ if (isset($record["datetime"]) && ($record["datetime"] instanceof \DateTime)) {
+ $record["timestamp"] = $record["datetime"]->format("Y-m-d\TH:i:s.uO");
+ // TODO 2.0 unset the 'datetime' parameter, retained for BC
+ }
+
+ return parent::format($record);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php
new file mode 100644
index 0000000..8f83bec
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php
@@ -0,0 +1,166 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Serializes a log message to Logstash Event Format
+ *
+ * @see http://logstash.net/
+ * @see https://github.com/logstash/logstash/blob/master/lib/logstash/event.rb
+ *
+ * @author Tim Mower
+ */
+class LogstashFormatter extends NormalizerFormatter
+{
+ const V0 = 0;
+ const V1 = 1;
+
+ /**
+ * @var string the name of the system for the Logstash log message, used to fill the @source field
+ */
+ protected $systemName;
+
+ /**
+ * @var string an application name for the Logstash log message, used to fill the @type field
+ */
+ protected $applicationName;
+
+ /**
+ * @var string a prefix for 'extra' fields from the Monolog record (optional)
+ */
+ protected $extraPrefix;
+
+ /**
+ * @var string a prefix for 'context' fields from the Monolog record (optional)
+ */
+ protected $contextPrefix;
+
+ /**
+ * @var int logstash format version to use
+ */
+ protected $version;
+
+ /**
+ * @param string $applicationName the application that sends the data, used as the "type" field of logstash
+ * @param string $systemName the system/machine name, used as the "source" field of logstash, defaults to the hostname of the machine
+ * @param string $extraPrefix prefix for extra keys inside logstash "fields"
+ * @param string $contextPrefix prefix for context keys inside logstash "fields", defaults to ctxt_
+ * @param int $version the logstash format version to use, defaults to 0
+ */
+ public function __construct($applicationName, $systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_', $version = self::V0)
+ {
+ // logstash requires a ISO 8601 format date with optional millisecond precision.
+ parent::__construct('Y-m-d\TH:i:s.uP');
+
+ $this->systemName = $systemName ?: gethostname();
+ $this->applicationName = $applicationName;
+ $this->extraPrefix = $extraPrefix;
+ $this->contextPrefix = $contextPrefix;
+ $this->version = $version;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ $record = parent::format($record);
+
+ if ($this->version === self::V1) {
+ $message = $this->formatV1($record);
+ } else {
+ $message = $this->formatV0($record);
+ }
+
+ return $this->toJson($message) . "\n";
+ }
+
+ protected function formatV0(array $record)
+ {
+ if (empty($record['datetime'])) {
+ $record['datetime'] = gmdate('c');
+ }
+ $message = array(
+ '@timestamp' => $record['datetime'],
+ '@source' => $this->systemName,
+ '@fields' => array(),
+ );
+ if (isset($record['message'])) {
+ $message['@message'] = $record['message'];
+ }
+ if (isset($record['channel'])) {
+ $message['@tags'] = array($record['channel']);
+ $message['@fields']['channel'] = $record['channel'];
+ }
+ if (isset($record['level'])) {
+ $message['@fields']['level'] = $record['level'];
+ }
+ if ($this->applicationName) {
+ $message['@type'] = $this->applicationName;
+ }
+ if (isset($record['extra']['server'])) {
+ $message['@source_host'] = $record['extra']['server'];
+ }
+ if (isset($record['extra']['url'])) {
+ $message['@source_path'] = $record['extra']['url'];
+ }
+ if (!empty($record['extra'])) {
+ foreach ($record['extra'] as $key => $val) {
+ $message['@fields'][$this->extraPrefix . $key] = $val;
+ }
+ }
+ if (!empty($record['context'])) {
+ foreach ($record['context'] as $key => $val) {
+ $message['@fields'][$this->contextPrefix . $key] = $val;
+ }
+ }
+
+ return $message;
+ }
+
+ protected function formatV1(array $record)
+ {
+ if (empty($record['datetime'])) {
+ $record['datetime'] = gmdate('c');
+ }
+ $message = array(
+ '@timestamp' => $record['datetime'],
+ '@version' => 1,
+ 'host' => $this->systemName,
+ );
+ if (isset($record['message'])) {
+ $message['message'] = $record['message'];
+ }
+ if (isset($record['channel'])) {
+ $message['type'] = $record['channel'];
+ $message['channel'] = $record['channel'];
+ }
+ if (isset($record['level_name'])) {
+ $message['level'] = $record['level_name'];
+ }
+ if ($this->applicationName) {
+ $message['type'] = $this->applicationName;
+ }
+ if (!empty($record['extra'])) {
+ foreach ($record['extra'] as $key => $val) {
+ $message[$this->extraPrefix . $key] = $val;
+ }
+ }
+ if (!empty($record['context'])) {
+ foreach ($record['context'] as $key => $val) {
+ $message[$this->contextPrefix . $key] = $val;
+ }
+ }
+
+ return $message;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php
new file mode 100644
index 0000000..eb067bb
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php
@@ -0,0 +1,105 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats a record for use with the MongoDBHandler.
+ *
+ * @author Florian Plattner
+ */
+class MongoDBFormatter implements FormatterInterface
+{
+ private $exceptionTraceAsString;
+ private $maxNestingLevel;
+
+ /**
+ * @param int $maxNestingLevel 0 means infinite nesting, the $record itself is level 1, $record['context'] is 2
+ * @param bool $exceptionTraceAsString set to false to log exception traces as a sub documents instead of strings
+ */
+ public function __construct($maxNestingLevel = 3, $exceptionTraceAsString = true)
+ {
+ $this->maxNestingLevel = max($maxNestingLevel, 0);
+ $this->exceptionTraceAsString = (bool) $exceptionTraceAsString;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public function format(array $record)
+ {
+ return $this->formatArray($record);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public function formatBatch(array $records)
+ {
+ foreach ($records as $key => $record) {
+ $records[$key] = $this->format($record);
+ }
+
+ return $records;
+ }
+
+ protected function formatArray(array $record, $nestingLevel = 0)
+ {
+ if ($this->maxNestingLevel == 0 || $nestingLevel <= $this->maxNestingLevel) {
+ foreach ($record as $name => $value) {
+ if ($value instanceof \DateTime) {
+ $record[$name] = $this->formatDate($value, $nestingLevel + 1);
+ } elseif ($value instanceof \Exception) {
+ $record[$name] = $this->formatException($value, $nestingLevel + 1);
+ } elseif (is_array($value)) {
+ $record[$name] = $this->formatArray($value, $nestingLevel + 1);
+ } elseif (is_object($value)) {
+ $record[$name] = $this->formatObject($value, $nestingLevel + 1);
+ }
+ }
+ } else {
+ $record = '[...]';
+ }
+
+ return $record;
+ }
+
+ protected function formatObject($value, $nestingLevel)
+ {
+ $objectVars = get_object_vars($value);
+ $objectVars['class'] = get_class($value);
+
+ return $this->formatArray($objectVars, $nestingLevel);
+ }
+
+ protected function formatException(\Exception $exception, $nestingLevel)
+ {
+ $formattedException = array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ );
+
+ if ($this->exceptionTraceAsString === true) {
+ $formattedException['trace'] = $exception->getTraceAsString();
+ } else {
+ $formattedException['trace'] = $exception->getTrace();
+ }
+
+ return $this->formatArray($formattedException, $nestingLevel);
+ }
+
+ protected function formatDate(\DateTime $value, $nestingLevel)
+ {
+ return new \MongoDate($value->getTimestamp());
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php
new file mode 100644
index 0000000..a76e2ae
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php
@@ -0,0 +1,280 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Exception;
+
+/**
+ * Normalizes incoming records to remove objects/resources so it's easier to dump to various targets
+ *
+ * @author Jordi Boggiano
+ */
+class NormalizerFormatter implements FormatterInterface
+{
+ const SIMPLE_DATE = "Y-m-d H:i:s";
+
+ protected $dateFormat;
+
+ /**
+ * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+ */
+ public function __construct($dateFormat = null)
+ {
+ $this->dateFormat = $dateFormat ?: static::SIMPLE_DATE;
+ if (!function_exists('json_encode')) {
+ throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s NormalizerFormatter');
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ return $this->normalize($record);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function formatBatch(array $records)
+ {
+ foreach ($records as $key => $record) {
+ $records[$key] = $this->format($record);
+ }
+
+ return $records;
+ }
+
+ protected function normalize($data)
+ {
+ if (null === $data || is_scalar($data)) {
+ if (is_float($data)) {
+ if (is_infinite($data)) {
+ return ($data > 0 ? '' : '-') . 'INF';
+ }
+ if (is_nan($data)) {
+ return 'NaN';
+ }
+ }
+
+ return $data;
+ }
+
+ if (is_array($data) || $data instanceof \Traversable) {
+ $normalized = array();
+
+ $count = 1;
+ foreach ($data as $key => $value) {
+ if ($count++ >= 1000) {
+ $normalized['...'] = 'Over 1000 items, aborting normalization';
+ break;
+ }
+ $normalized[$key] = $this->normalize($value);
+ }
+
+ return $normalized;
+ }
+
+ if ($data instanceof \DateTime) {
+ return $data->format($this->dateFormat);
+ }
+
+ if (is_object($data)) {
+ // TODO 2.0 only check for Throwable
+ if ($data instanceof Exception || (PHP_VERSION_ID > 70000 && $data instanceof \Throwable)) {
+ return $this->normalizeException($data);
+ }
+
+ // non-serializable objects that implement __toString stringified
+ if (method_exists($data, '__toString') && !$data instanceof \JsonSerializable) {
+ $value = $data->__toString();
+ } else {
+ // the rest is json-serialized in some way
+ $value = $this->toJson($data, true);
+ }
+
+ return sprintf("[object] (%s: %s)", get_class($data), $value);
+ }
+
+ if (is_resource($data)) {
+ return sprintf('[resource] (%s)', get_resource_type($data));
+ }
+
+ return '[unknown('.gettype($data).')]';
+ }
+
+ protected function normalizeException($e)
+ {
+ // TODO 2.0 only check for Throwable
+ if (!$e instanceof Exception && !$e instanceof \Throwable) {
+ throw new \InvalidArgumentException('Exception/Throwable expected, got '.gettype($e).' / '.get_class($e));
+ }
+
+ $data = array(
+ 'class' => get_class($e),
+ 'message' => $e->getMessage(),
+ 'code' => $e->getCode(),
+ 'file' => $e->getFile().':'.$e->getLine(),
+ );
+
+ $trace = $e->getTrace();
+ foreach ($trace as $frame) {
+ if (isset($frame['file'])) {
+ $data['trace'][] = $frame['file'].':'.$frame['line'];
+ } else {
+ // We should again normalize the frames, because it might contain invalid items
+ $data['trace'][] = $this->toJson($this->normalize($frame), true);
+ }
+ }
+
+ if ($previous = $e->getPrevious()) {
+ $data['previous'] = $this->normalizeException($previous);
+ }
+
+ return $data;
+ }
+
+ /**
+ * Return the JSON representation of a value
+ *
+ * @param mixed $data
+ * @param bool $ignoreErrors
+ * @throws \RuntimeException if encoding fails and errors are not ignored
+ * @return string
+ */
+ protected function toJson($data, $ignoreErrors = false)
+ {
+ // suppress json_encode errors since it's twitchy with some inputs
+ if ($ignoreErrors) {
+ return @$this->jsonEncode($data);
+ }
+
+ $json = $this->jsonEncode($data);
+
+ if ($json === false) {
+ $json = $this->handleJsonError(json_last_error(), $data);
+ }
+
+ return $json;
+ }
+
+ /**
+ * @param mixed $data
+ * @return string JSON encoded data or null on failure
+ */
+ private function jsonEncode($data)
+ {
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return json_encode($data);
+ }
+
+ /**
+ * Handle a json_encode failure.
+ *
+ * If the failure is due to invalid string encoding, try to clean the
+ * input and encode again. If the second encoding iattempt fails, the
+ * inital error is not encoding related or the input can't be cleaned then
+ * raise a descriptive exception.
+ *
+ * @param int $code return code of json_last_error function
+ * @param mixed $data data that was meant to be encoded
+ * @throws \RuntimeException if failure can't be corrected
+ * @return string JSON encoded data after error correction
+ */
+ private function handleJsonError($code, $data)
+ {
+ if ($code !== JSON_ERROR_UTF8) {
+ $this->throwEncodeError($code, $data);
+ }
+
+ if (is_string($data)) {
+ $this->detectAndCleanUtf8($data);
+ } elseif (is_array($data)) {
+ array_walk_recursive($data, array($this, 'detectAndCleanUtf8'));
+ } else {
+ $this->throwEncodeError($code, $data);
+ }
+
+ $json = $this->jsonEncode($data);
+
+ if ($json === false) {
+ $this->throwEncodeError(json_last_error(), $data);
+ }
+
+ return $json;
+ }
+
+ /**
+ * Throws an exception according to a given code with a customized message
+ *
+ * @param int $code return code of json_last_error function
+ * @param mixed $data data that was meant to be encoded
+ * @throws \RuntimeException
+ */
+ private function throwEncodeError($code, $data)
+ {
+ switch ($code) {
+ case JSON_ERROR_DEPTH:
+ $msg = 'Maximum stack depth exceeded';
+ break;
+ case JSON_ERROR_STATE_MISMATCH:
+ $msg = 'Underflow or the modes mismatch';
+ break;
+ case JSON_ERROR_CTRL_CHAR:
+ $msg = 'Unexpected control character found';
+ break;
+ case JSON_ERROR_UTF8:
+ $msg = 'Malformed UTF-8 characters, possibly incorrectly encoded';
+ break;
+ default:
+ $msg = 'Unknown error';
+ }
+
+ throw new \RuntimeException('JSON encoding failed: '.$msg.'. Encoding: '.var_export($data, true));
+ }
+
+ /**
+ * Detect invalid UTF-8 string characters and convert to valid UTF-8.
+ *
+ * Valid UTF-8 input will be left unmodified, but strings containing
+ * invalid UTF-8 codepoints will be reencoded as UTF-8 with an assumed
+ * original encoding of ISO-8859-15. This conversion may result in
+ * incorrect output if the actual encoding was not ISO-8859-15, but it
+ * will be clean UTF-8 output and will not rely on expensive and fragile
+ * detection algorithms.
+ *
+ * Function converts the input in place in the passed variable so that it
+ * can be used as a callback for array_walk_recursive.
+ *
+ * @param mixed &$data Input to check and convert if needed
+ * @private
+ */
+ public function detectAndCleanUtf8(&$data)
+ {
+ if (is_string($data) && !preg_match('//u', $data)) {
+ $data = preg_replace_callback(
+ '/[\x80-\xFF]+/',
+ function ($m) { return utf8_encode($m[0]); },
+ $data
+ );
+ $data = str_replace(
+ array('¤', '¦', '¨', '´', '¸', '¼', '½', '¾'),
+ array('€', 'Š', 'š', 'Ž', 'ž', 'Œ', 'œ', 'Ÿ'),
+ $data
+ );
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php
new file mode 100644
index 0000000..5d345d5
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php
@@ -0,0 +1,48 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats data into an associative array of scalar values.
+ * Objects and arrays will be JSON encoded.
+ *
+ * @author Andrew Lawson
+ */
+class ScalarFormatter extends NormalizerFormatter
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ foreach ($record as $key => $value) {
+ $record[$key] = $this->normalizeValue($value);
+ }
+
+ return $record;
+ }
+
+ /**
+ * @param mixed $value
+ * @return mixed
+ */
+ protected function normalizeValue($value)
+ {
+ $normalized = $this->normalize($value);
+
+ if (is_array($normalized) || is_object($normalized)) {
+ return $this->toJson($normalized, true);
+ }
+
+ return $normalized;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php
new file mode 100644
index 0000000..654710a
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php
@@ -0,0 +1,113 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Serializes a log message according to Wildfire's header requirements
+ *
+ * @author Eric Clemmons (@ericclemmons)
+ * @author Christophe Coevoet
+ * @author Kirill chEbba Chebunin
+ */
+class WildfireFormatter extends NormalizerFormatter
+{
+ const TABLE = 'table';
+
+ /**
+ * Translates Monolog log levels to Wildfire levels.
+ */
+ private $logLevels = array(
+ Logger::DEBUG => 'LOG',
+ Logger::INFO => 'INFO',
+ Logger::NOTICE => 'INFO',
+ Logger::WARNING => 'WARN',
+ Logger::ERROR => 'ERROR',
+ Logger::CRITICAL => 'ERROR',
+ Logger::ALERT => 'ERROR',
+ Logger::EMERGENCY => 'ERROR',
+ );
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ // Retrieve the line and file if set and remove them from the formatted extra
+ $file = $line = '';
+ if (isset($record['extra']['file'])) {
+ $file = $record['extra']['file'];
+ unset($record['extra']['file']);
+ }
+ if (isset($record['extra']['line'])) {
+ $line = $record['extra']['line'];
+ unset($record['extra']['line']);
+ }
+
+ $record = $this->normalize($record);
+ $message = array('message' => $record['message']);
+ $handleError = false;
+ if ($record['context']) {
+ $message['context'] = $record['context'];
+ $handleError = true;
+ }
+ if ($record['extra']) {
+ $message['extra'] = $record['extra'];
+ $handleError = true;
+ }
+ if (count($message) === 1) {
+ $message = reset($message);
+ }
+
+ if (isset($record['context'][self::TABLE])) {
+ $type = 'TABLE';
+ $label = $record['channel'] .': '. $record['message'];
+ $message = $record['context'][self::TABLE];
+ } else {
+ $type = $this->logLevels[$record['level']];
+ $label = $record['channel'];
+ }
+
+ // Create JSON object describing the appearance of the message in the console
+ $json = $this->toJson(array(
+ array(
+ 'Type' => $type,
+ 'File' => $file,
+ 'Line' => $line,
+ 'Label' => $label,
+ ),
+ $message,
+ ), $handleError);
+
+ // The message itself is a serialization of the above JSON object + it's length
+ return sprintf(
+ '%s|%s|',
+ strlen($json),
+ $json
+ );
+ }
+
+ public function formatBatch(array $records)
+ {
+ throw new \BadMethodCallException('Batch formatting does not make sense for the WildfireFormatter');
+ }
+
+ protected function normalize($data)
+ {
+ if (is_object($data) && !$data instanceof \DateTime) {
+ return $data;
+ }
+
+ return parent::normalize($data);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php
new file mode 100644
index 0000000..525e4f9
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php
@@ -0,0 +1,184 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * @author Jordi Boggiano
+ */
+abstract class AbstractHandler implements HandlerInterface
+{
+ protected $level = Logger::DEBUG;
+ protected $bubble = true;
+
+ /**
+ * @var FormatterInterface
+ */
+ protected $formatter;
+ protected $processors = array();
+
+ /**
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($level = Logger::DEBUG, $bubble = true)
+ {
+ $this->setLevel($level);
+ $this->bubble = $bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ return $record['level'] >= $this->level;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ foreach ($records as $record) {
+ $this->handle($record);
+ }
+ }
+
+ /**
+ * Closes the handler.
+ *
+ * This will be called automatically when the object is destroyed
+ */
+ public function close()
+ {
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function pushProcessor($callback)
+ {
+ if (!is_callable($callback)) {
+ throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+ }
+ array_unshift($this->processors, $callback);
+
+ return $this;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function popProcessor()
+ {
+ if (!$this->processors) {
+ throw new \LogicException('You tried to pop from an empty processor stack.');
+ }
+
+ return array_shift($this->processors);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function setFormatter(FormatterInterface $formatter)
+ {
+ $this->formatter = $formatter;
+
+ return $this;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function getFormatter()
+ {
+ if (!$this->formatter) {
+ $this->formatter = $this->getDefaultFormatter();
+ }
+
+ return $this->formatter;
+ }
+
+ /**
+ * Sets minimum logging level at which this handler will be triggered.
+ *
+ * @param int|string $level Level or level name
+ * @return self
+ */
+ public function setLevel($level)
+ {
+ $this->level = Logger::toMonologLevel($level);
+
+ return $this;
+ }
+
+ /**
+ * Gets minimum logging level at which this handler will be triggered.
+ *
+ * @return int
+ */
+ public function getLevel()
+ {
+ return $this->level;
+ }
+
+ /**
+ * Sets the bubbling behavior.
+ *
+ * @param Boolean $bubble true means that this handler allows bubbling.
+ * false means that bubbling is not permitted.
+ * @return self
+ */
+ public function setBubble($bubble)
+ {
+ $this->bubble = $bubble;
+
+ return $this;
+ }
+
+ /**
+ * Gets the bubbling behavior.
+ *
+ * @return Boolean true means that this handler allows bubbling.
+ * false means that bubbling is not permitted.
+ */
+ public function getBubble()
+ {
+ return $this->bubble;
+ }
+
+ public function __destruct()
+ {
+ try {
+ $this->close();
+ } catch (\Exception $e) {
+ // do nothing
+ }
+ }
+
+ /**
+ * Gets the default formatter.
+ *
+ * @return FormatterInterface
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php
new file mode 100644
index 0000000..6f18f72
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php
@@ -0,0 +1,66 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * Classes extending it should (in most cases) only implement write($record)
+ *
+ * @author Jordi Boggiano
+ * @author Christophe Coevoet
+ */
+abstract class AbstractProcessingHandler extends AbstractHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if (!$this->isHandling($record)) {
+ return false;
+ }
+
+ $record = $this->processRecord($record);
+
+ $record['formatted'] = $this->getFormatter()->format($record);
+
+ $this->write($record);
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * Writes the record down to the log of the implementing handler
+ *
+ * @param array $record
+ * @return void
+ */
+ abstract protected function write(array $record);
+
+ /**
+ * Processes a record.
+ *
+ * @param array $record
+ * @return array
+ */
+ protected function processRecord(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php
new file mode 100644
index 0000000..e2b2832
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php
@@ -0,0 +1,101 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Common syslog functionality
+ */
+abstract class AbstractSyslogHandler extends AbstractProcessingHandler
+{
+ protected $facility;
+
+ /**
+ * Translates Monolog log levels to syslog log priorities.
+ */
+ protected $logLevels = array(
+ Logger::DEBUG => LOG_DEBUG,
+ Logger::INFO => LOG_INFO,
+ Logger::NOTICE => LOG_NOTICE,
+ Logger::WARNING => LOG_WARNING,
+ Logger::ERROR => LOG_ERR,
+ Logger::CRITICAL => LOG_CRIT,
+ Logger::ALERT => LOG_ALERT,
+ Logger::EMERGENCY => LOG_EMERG,
+ );
+
+ /**
+ * List of valid log facility names.
+ */
+ protected $facilities = array(
+ 'auth' => LOG_AUTH,
+ 'authpriv' => LOG_AUTHPRIV,
+ 'cron' => LOG_CRON,
+ 'daemon' => LOG_DAEMON,
+ 'kern' => LOG_KERN,
+ 'lpr' => LOG_LPR,
+ 'mail' => LOG_MAIL,
+ 'news' => LOG_NEWS,
+ 'syslog' => LOG_SYSLOG,
+ 'user' => LOG_USER,
+ 'uucp' => LOG_UUCP,
+ );
+
+ /**
+ * @param mixed $facility
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($facility = LOG_USER, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ if (!defined('PHP_WINDOWS_VERSION_BUILD')) {
+ $this->facilities['local0'] = LOG_LOCAL0;
+ $this->facilities['local1'] = LOG_LOCAL1;
+ $this->facilities['local2'] = LOG_LOCAL2;
+ $this->facilities['local3'] = LOG_LOCAL3;
+ $this->facilities['local4'] = LOG_LOCAL4;
+ $this->facilities['local5'] = LOG_LOCAL5;
+ $this->facilities['local6'] = LOG_LOCAL6;
+ $this->facilities['local7'] = LOG_LOCAL7;
+ } else {
+ $this->facilities['local0'] = 128; // LOG_LOCAL0
+ $this->facilities['local1'] = 136; // LOG_LOCAL1
+ $this->facilities['local2'] = 144; // LOG_LOCAL2
+ $this->facilities['local3'] = 152; // LOG_LOCAL3
+ $this->facilities['local4'] = 160; // LOG_LOCAL4
+ $this->facilities['local5'] = 168; // LOG_LOCAL5
+ $this->facilities['local6'] = 176; // LOG_LOCAL6
+ $this->facilities['local7'] = 184; // LOG_LOCAL7
+ }
+
+ // convert textual description of facility to syslog constant
+ if (array_key_exists(strtolower($facility), $this->facilities)) {
+ $facility = $this->facilities[strtolower($facility)];
+ } elseif (!in_array($facility, array_values($this->facilities), true)) {
+ throw new \UnexpectedValueException('Unknown facility value "'.$facility.'" given');
+ }
+
+ $this->facility = $facility;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('%channel%.%level_name%: %message% %context% %extra%');
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php
new file mode 100644
index 0000000..95a91fc
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php
@@ -0,0 +1,148 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\JsonFormatter;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Channel\AMQPChannel;
+use AMQPExchange;
+
+class AmqpHandler extends AbstractProcessingHandler
+{
+ /**
+ * @var AMQPExchange|AMQPChannel $exchange
+ */
+ protected $exchange;
+
+ /**
+ * @var string
+ */
+ protected $exchangeName;
+
+ /**
+ * @param AMQPExchange|AMQPChannel $exchange AMQPExchange (php AMQP ext) or PHP AMQP lib channel, ready for use
+ * @param string $exchangeName
+ * @param int $level
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($exchange, $exchangeName = 'log', $level = Logger::DEBUG, $bubble = true)
+ {
+ if ($exchange instanceof AMQPExchange) {
+ $exchange->setName($exchangeName);
+ } elseif ($exchange instanceof AMQPChannel) {
+ $this->exchangeName = $exchangeName;
+ } else {
+ throw new \InvalidArgumentException('PhpAmqpLib\Channel\AMQPChannel or AMQPExchange instance required');
+ }
+ $this->exchange = $exchange;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $data = $record["formatted"];
+ $routingKey = $this->getRoutingKey($record);
+
+ if ($this->exchange instanceof AMQPExchange) {
+ $this->exchange->publish(
+ $data,
+ $routingKey,
+ 0,
+ array(
+ 'delivery_mode' => 2,
+ 'content_type' => 'application/json',
+ )
+ );
+ } else {
+ $this->exchange->basic_publish(
+ $this->createAmqpMessage($data),
+ $this->exchangeName,
+ $routingKey
+ );
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public function handleBatch(array $records)
+ {
+ if ($this->exchange instanceof AMQPExchange) {
+ parent::handleBatch($records);
+
+ return;
+ }
+
+ foreach ($records as $record) {
+ if (!$this->isHandling($record)) {
+ continue;
+ }
+
+ $record = $this->processRecord($record);
+ $data = $this->getFormatter()->format($record);
+
+ $this->exchange->batch_basic_publish(
+ $this->createAmqpMessage($data),
+ $this->exchangeName,
+ $this->getRoutingKey($record)
+ );
+ }
+
+ $this->exchange->publish_batch();
+ }
+
+ /**
+ * Gets the routing key for the AMQP exchange
+ *
+ * @param array $record
+ * @return string
+ */
+ private function getRoutingKey(array $record)
+ {
+ $routingKey = sprintf(
+ '%s.%s',
+ // TODO 2.0 remove substr call
+ substr($record['level_name'], 0, 4),
+ $record['channel']
+ );
+
+ return strtolower($routingKey);
+ }
+
+ /**
+ * @param string $data
+ * @return AMQPMessage
+ */
+ private function createAmqpMessage($data)
+ {
+ return new AMQPMessage(
+ (string) $data,
+ array(
+ 'delivery_mode' => 2,
+ 'content_type' => 'application/json',
+ )
+ );
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php
new file mode 100644
index 0000000..b3a21bd
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php
@@ -0,0 +1,230 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Handler sending logs to browser's javascript console with no browser extension required
+ *
+ * @author Olivier Poitrey
+ */
+class BrowserConsoleHandler extends AbstractProcessingHandler
+{
+ protected static $initialized = false;
+ protected static $records = array();
+
+ /**
+ * {@inheritDoc}
+ *
+ * Formatted output may contain some formatting markers to be transferred to `console.log` using the %c format.
+ *
+ * Example of formatted string:
+ *
+ * You can do [[blue text]]{color: blue} or [[green background]]{background-color: green; color: white}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('[[%channel%]]{macro: autolabel} [[%level_name%]]{font-weight: bold} %message%');
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ // Accumulate records
+ self::$records[] = $record;
+
+ // Register shutdown handler if not already done
+ if (!self::$initialized) {
+ self::$initialized = true;
+ $this->registerShutdownFunction();
+ }
+ }
+
+ /**
+ * Convert records to javascript console commands and send it to the browser.
+ * This method is automatically called on PHP shutdown if output is HTML or Javascript.
+ */
+ public static function send()
+ {
+ $format = self::getResponseFormat();
+ if ($format === 'unknown') {
+ return;
+ }
+
+ if (count(self::$records)) {
+ if ($format === 'html') {
+ self::writeOutput('');
+ } elseif ($format === 'js') {
+ self::writeOutput(self::generateScript());
+ }
+ self::reset();
+ }
+ }
+
+ /**
+ * Forget all logged records
+ */
+ public static function reset()
+ {
+ self::$records = array();
+ }
+
+ /**
+ * Wrapper for register_shutdown_function to allow overriding
+ */
+ protected function registerShutdownFunction()
+ {
+ if (PHP_SAPI !== 'cli') {
+ register_shutdown_function(array('Monolog\Handler\BrowserConsoleHandler', 'send'));
+ }
+ }
+
+ /**
+ * Wrapper for echo to allow overriding
+ *
+ * @param string $str
+ */
+ protected static function writeOutput($str)
+ {
+ echo $str;
+ }
+
+ /**
+ * Checks the format of the response
+ *
+ * If Content-Type is set to application/javascript or text/javascript -> js
+ * If Content-Type is set to text/html, or is unset -> html
+ * If Content-Type is anything else -> unknown
+ *
+ * @return string One of 'js', 'html' or 'unknown'
+ */
+ protected static function getResponseFormat()
+ {
+ // Check content type
+ foreach (headers_list() as $header) {
+ if (stripos($header, 'content-type:') === 0) {
+ // This handler only works with HTML and javascript outputs
+ // text/javascript is obsolete in favour of application/javascript, but still used
+ if (stripos($header, 'application/javascript') !== false || stripos($header, 'text/javascript') !== false) {
+ return 'js';
+ }
+ if (stripos($header, 'text/html') === false) {
+ return 'unknown';
+ }
+ break;
+ }
+ }
+
+ return 'html';
+ }
+
+ private static function generateScript()
+ {
+ $script = array();
+ foreach (self::$records as $record) {
+ $context = self::dump('Context', $record['context']);
+ $extra = self::dump('Extra', $record['extra']);
+
+ if (empty($context) && empty($extra)) {
+ $script[] = self::call_array('log', self::handleStyles($record['formatted']));
+ } else {
+ $script = array_merge($script,
+ array(self::call_array('groupCollapsed', self::handleStyles($record['formatted']))),
+ $context,
+ $extra,
+ array(self::call('groupEnd'))
+ );
+ }
+ }
+
+ return "(function (c) {if (c && c.groupCollapsed) {\n" . implode("\n", $script) . "\n}})(console);";
+ }
+
+ private static function handleStyles($formatted)
+ {
+ $args = array(self::quote('font-weight: normal'));
+ $format = '%c' . $formatted;
+ preg_match_all('/\[\[(.*?)\]\]\{([^}]*)\}/s', $format, $matches, PREG_OFFSET_CAPTURE | PREG_SET_ORDER);
+
+ foreach (array_reverse($matches) as $match) {
+ $args[] = self::quote(self::handleCustomStyles($match[2][0], $match[1][0]));
+ $args[] = '"font-weight: normal"';
+
+ $pos = $match[0][1];
+ $format = substr($format, 0, $pos) . '%c' . $match[1][0] . '%c' . substr($format, $pos + strlen($match[0][0]));
+ }
+
+ array_unshift($args, self::quote($format));
+
+ return $args;
+ }
+
+ private static function handleCustomStyles($style, $string)
+ {
+ static $colors = array('blue', 'green', 'red', 'magenta', 'orange', 'black', 'grey');
+ static $labels = array();
+
+ return preg_replace_callback('/macro\s*:(.*?)(?:;|$)/', function ($m) use ($string, &$colors, &$labels) {
+ if (trim($m[1]) === 'autolabel') {
+ // Format the string as a label with consistent auto assigned background color
+ if (!isset($labels[$string])) {
+ $labels[$string] = $colors[count($labels) % count($colors)];
+ }
+ $color = $labels[$string];
+
+ return "background-color: $color; color: white; border-radius: 3px; padding: 0 2px 0 2px";
+ }
+
+ return $m[1];
+ }, $style);
+ }
+
+ private static function dump($title, array $dict)
+ {
+ $script = array();
+ $dict = array_filter($dict);
+ if (empty($dict)) {
+ return $script;
+ }
+ $script[] = self::call('log', self::quote('%c%s'), self::quote('font-weight: bold'), self::quote($title));
+ foreach ($dict as $key => $value) {
+ $value = json_encode($value);
+ if (empty($value)) {
+ $value = self::quote('');
+ }
+ $script[] = self::call('log', self::quote('%s: %o'), self::quote($key), $value);
+ }
+
+ return $script;
+ }
+
+ private static function quote($arg)
+ {
+ return '"' . addcslashes($arg, "\"\n\\") . '"';
+ }
+
+ private static function call()
+ {
+ $args = func_get_args();
+ $method = array_shift($args);
+
+ return self::call_array($method, $args);
+ }
+
+ private static function call_array($method, array $args)
+ {
+ return 'c.' . $method . '(' . implode(', ', $args) . ');';
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php
new file mode 100644
index 0000000..72f8953
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php
@@ -0,0 +1,117 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Buffers all records until closing the handler and then pass them as batch.
+ *
+ * This is useful for a MailHandler to send only one mail per request instead of
+ * sending one per log message.
+ *
+ * @author Christophe Coevoet
+ */
+class BufferHandler extends AbstractHandler
+{
+ protected $handler;
+ protected $bufferSize = 0;
+ protected $bufferLimit;
+ protected $flushOnOverflow;
+ protected $buffer = array();
+ protected $initialized = false;
+
+ /**
+ * @param HandlerInterface $handler Handler.
+ * @param int $bufferLimit How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $flushOnOverflow If true, the buffer is flushed when the max size has been reached, by default oldest entries are discarded
+ */
+ public function __construct(HandlerInterface $handler, $bufferLimit = 0, $level = Logger::DEBUG, $bubble = true, $flushOnOverflow = false)
+ {
+ parent::__construct($level, $bubble);
+ $this->handler = $handler;
+ $this->bufferLimit = (int) $bufferLimit;
+ $this->flushOnOverflow = $flushOnOverflow;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($record['level'] < $this->level) {
+ return false;
+ }
+
+ if (!$this->initialized) {
+ // __destructor() doesn't get called on Fatal errors
+ register_shutdown_function(array($this, 'close'));
+ $this->initialized = true;
+ }
+
+ if ($this->bufferLimit > 0 && $this->bufferSize === $this->bufferLimit) {
+ if ($this->flushOnOverflow) {
+ $this->flush();
+ } else {
+ array_shift($this->buffer);
+ $this->bufferSize--;
+ }
+ }
+
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ $this->buffer[] = $record;
+ $this->bufferSize++;
+
+ return false === $this->bubble;
+ }
+
+ public function flush()
+ {
+ if ($this->bufferSize === 0) {
+ return;
+ }
+
+ $this->handler->handleBatch($this->buffer);
+ $this->clear();
+ }
+
+ public function __destruct()
+ {
+ // suppress the parent behavior since we already have register_shutdown_function()
+ // to call close(), and the reference contained there will prevent this from being
+ // GC'd until the end of the request
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ $this->flush();
+ }
+
+ /**
+ * Clears the buffer without flushing any messages down to the wrapped handler.
+ */
+ public function clear()
+ {
+ $this->bufferSize = 0;
+ $this->buffer = array();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php
new file mode 100644
index 0000000..b00fa84
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php
@@ -0,0 +1,211 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ChromePHPFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to the ChromePHP extension (http://www.chromephp.com/)
+ *
+ * This also works out of the box with Firefox 43+
+ *
+ * @author Christophe Coevoet
+ */
+class ChromePHPHandler extends AbstractProcessingHandler
+{
+ /**
+ * Version of the extension
+ */
+ const VERSION = '4.0';
+
+ /**
+ * Header name
+ */
+ const HEADER_NAME = 'X-ChromeLogger-Data';
+
+ /**
+ * Regular expression to detect supported browsers (matches any Chrome, or Firefox 43+)
+ */
+ const USER_AGENT_REGEX = '{\b(?:Chrome/\d+(?:\.\d+)*|Firefox/(?:4[3-9]|[5-9]\d|\d{3,})(?:\.\d)*)\b}';
+
+ protected static $initialized = false;
+
+ /**
+ * Tracks whether we sent too much data
+ *
+ * Chrome limits the headers to 256KB, so when we sent 240KB we stop sending
+ *
+ * @var Boolean
+ */
+ protected static $overflowed = false;
+
+ protected static $json = array(
+ 'version' => self::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(),
+ );
+
+ protected static $sendHeaders = true;
+
+ /**
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+ if (!function_exists('json_encode')) {
+ throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s ChromePHPHandler');
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $messages = array();
+
+ foreach ($records as $record) {
+ if ($record['level'] < $this->level) {
+ continue;
+ }
+ $messages[] = $this->processRecord($record);
+ }
+
+ if (!empty($messages)) {
+ $messages = $this->getFormatter()->formatBatch($messages);
+ self::$json['rows'] = array_merge(self::$json['rows'], $messages);
+ $this->send();
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new ChromePHPFormatter();
+ }
+
+ /**
+ * Creates & sends header for a record
+ *
+ * @see sendHeader()
+ * @see send()
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ self::$json['rows'][] = $record['formatted'];
+
+ $this->send();
+ }
+
+ /**
+ * Sends the log header
+ *
+ * @see sendHeader()
+ */
+ protected function send()
+ {
+ if (self::$overflowed || !self::$sendHeaders) {
+ return;
+ }
+
+ if (!self::$initialized) {
+ self::$initialized = true;
+
+ self::$sendHeaders = $this->headersAccepted();
+ if (!self::$sendHeaders) {
+ return;
+ }
+
+ self::$json['request_uri'] = isset($_SERVER['REQUEST_URI']) ? $_SERVER['REQUEST_URI'] : '';
+ }
+
+ $json = @json_encode(self::$json);
+ $data = base64_encode(utf8_encode($json));
+ if (strlen($data) > 240 * 1024) {
+ self::$overflowed = true;
+
+ $record = array(
+ 'message' => 'Incomplete logs, chrome header size limit reached',
+ 'context' => array(),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'monolog',
+ 'datetime' => new \DateTime(),
+ 'extra' => array(),
+ );
+ self::$json['rows'][count(self::$json['rows']) - 1] = $this->getFormatter()->format($record);
+ $json = @json_encode(self::$json);
+ $data = base64_encode(utf8_encode($json));
+ }
+
+ if (trim($data) !== '') {
+ $this->sendHeader(self::HEADER_NAME, $data);
+ }
+ }
+
+ /**
+ * Send header string to the client
+ *
+ * @param string $header
+ * @param string $content
+ */
+ protected function sendHeader($header, $content)
+ {
+ if (!headers_sent() && self::$sendHeaders) {
+ header(sprintf('%s: %s', $header, $content));
+ }
+ }
+
+ /**
+ * Verifies if the headers are accepted by the current user agent
+ *
+ * @return Boolean
+ */
+ protected function headersAccepted()
+ {
+ if (empty($_SERVER['HTTP_USER_AGENT'])) {
+ return false;
+ }
+
+ return preg_match(self::USER_AGENT_REGEX, $_SERVER['HTTP_USER_AGENT']);
+ }
+
+ /**
+ * BC getter for the sendHeaders property that has been made static
+ */
+ public function __get($property)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ return static::$sendHeaders;
+ }
+
+ /**
+ * BC setter for the sendHeaders property that has been made static
+ */
+ public function __set($property, $value)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ static::$sendHeaders = $value;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php
new file mode 100644
index 0000000..cc98697
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php
@@ -0,0 +1,72 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\JsonFormatter;
+use Monolog\Logger;
+
+/**
+ * CouchDB handler
+ *
+ * @author Markus Bachmann
+ */
+class CouchDBHandler extends AbstractProcessingHandler
+{
+ private $options;
+
+ public function __construct(array $options = array(), $level = Logger::DEBUG, $bubble = true)
+ {
+ $this->options = array_merge(array(
+ 'host' => 'localhost',
+ 'port' => 5984,
+ 'dbname' => 'logger',
+ 'username' => null,
+ 'password' => null,
+ ), $options);
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $basicAuth = null;
+ if ($this->options['username']) {
+ $basicAuth = sprintf('%s:%s@', $this->options['username'], $this->options['password']);
+ }
+
+ $url = 'http://'.$basicAuth.$this->options['host'].':'.$this->options['port'].'/'.$this->options['dbname'];
+ $context = stream_context_create(array(
+ 'http' => array(
+ 'method' => 'POST',
+ 'content' => $record['formatted'],
+ 'ignore_errors' => true,
+ 'max_redirects' => 0,
+ 'header' => 'Content-type: application/json',
+ ),
+ ));
+
+ if (false === @file_get_contents($url, null, $context)) {
+ throw new \RuntimeException(sprintf('Could not connect to %s', $url));
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php
new file mode 100644
index 0000000..96b3ca0
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php
@@ -0,0 +1,151 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to Cube.
+ *
+ * @link http://square.github.com/cube/
+ * @author Wan Chen
+ */
+class CubeHandler extends AbstractProcessingHandler
+{
+ private $udpConnection;
+ private $httpConnection;
+ private $scheme;
+ private $host;
+ private $port;
+ private $acceptedSchemes = array('http', 'udp');
+
+ /**
+ * Create a Cube handler
+ *
+ * @throws \UnexpectedValueException when given url is not a valid url.
+ * A valid url must consist of three parts : protocol://host:port
+ * Only valid protocols used by Cube are http and udp
+ */
+ public function __construct($url, $level = Logger::DEBUG, $bubble = true)
+ {
+ $urlInfo = parse_url($url);
+
+ if (!isset($urlInfo['scheme'], $urlInfo['host'], $urlInfo['port'])) {
+ throw new \UnexpectedValueException('URL "'.$url.'" is not valid');
+ }
+
+ if (!in_array($urlInfo['scheme'], $this->acceptedSchemes)) {
+ throw new \UnexpectedValueException(
+ 'Invalid protocol (' . $urlInfo['scheme'] . ').'
+ . ' Valid options are ' . implode(', ', $this->acceptedSchemes));
+ }
+
+ $this->scheme = $urlInfo['scheme'];
+ $this->host = $urlInfo['host'];
+ $this->port = $urlInfo['port'];
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * Establish a connection to an UDP socket
+ *
+ * @throws \LogicException when unable to connect to the socket
+ * @throws MissingExtensionException when there is no socket extension
+ */
+ protected function connectUdp()
+ {
+ if (!extension_loaded('sockets')) {
+ throw new MissingExtensionException('The sockets extension is required to use udp URLs with the CubeHandler');
+ }
+
+ $this->udpConnection = socket_create(AF_INET, SOCK_DGRAM, 0);
+ if (!$this->udpConnection) {
+ throw new \LogicException('Unable to create a socket');
+ }
+
+ if (!socket_connect($this->udpConnection, $this->host, $this->port)) {
+ throw new \LogicException('Unable to connect to the socket at ' . $this->host . ':' . $this->port);
+ }
+ }
+
+ /**
+ * Establish a connection to a http server
+ * @throws \LogicException when no curl extension
+ */
+ protected function connectHttp()
+ {
+ if (!extension_loaded('curl')) {
+ throw new \LogicException('The curl extension is needed to use http URLs with the CubeHandler');
+ }
+
+ $this->httpConnection = curl_init('http://'.$this->host.':'.$this->port.'/1.0/event/put');
+
+ if (!$this->httpConnection) {
+ throw new \LogicException('Unable to connect to ' . $this->host . ':' . $this->port);
+ }
+
+ curl_setopt($this->httpConnection, CURLOPT_CUSTOMREQUEST, "POST");
+ curl_setopt($this->httpConnection, CURLOPT_RETURNTRANSFER, true);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $date = $record['datetime'];
+
+ $data = array('time' => $date->format('Y-m-d\TH:i:s.uO'));
+ unset($record['datetime']);
+
+ if (isset($record['context']['type'])) {
+ $data['type'] = $record['context']['type'];
+ unset($record['context']['type']);
+ } else {
+ $data['type'] = $record['channel'];
+ }
+
+ $data['data'] = $record['context'];
+ $data['data']['level'] = $record['level'];
+
+ if ($this->scheme === 'http') {
+ $this->writeHttp(json_encode($data));
+ } else {
+ $this->writeUdp(json_encode($data));
+ }
+ }
+
+ private function writeUdp($data)
+ {
+ if (!$this->udpConnection) {
+ $this->connectUdp();
+ }
+
+ socket_send($this->udpConnection, $data, strlen($data), 0);
+ }
+
+ private function writeHttp($data)
+ {
+ if (!$this->httpConnection) {
+ $this->connectHttp();
+ }
+
+ curl_setopt($this->httpConnection, CURLOPT_POSTFIELDS, '['.$data.']');
+ curl_setopt($this->httpConnection, CURLOPT_HTTPHEADER, array(
+ 'Content-Type: application/json',
+ 'Content-Length: ' . strlen('['.$data.']'),
+ ));
+
+ Curl\Util::execute($this->httpConnection, 5, false);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/Curl/Util.php b/vendor/monolog/monolog/src/Monolog/Handler/Curl/Util.php
new file mode 100644
index 0000000..48d30b3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/Curl/Util.php
@@ -0,0 +1,57 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\Curl;
+
+class Util
+{
+ private static $retriableErrorCodes = array(
+ CURLE_COULDNT_RESOLVE_HOST,
+ CURLE_COULDNT_CONNECT,
+ CURLE_HTTP_NOT_FOUND,
+ CURLE_READ_ERROR,
+ CURLE_OPERATION_TIMEOUTED,
+ CURLE_HTTP_POST_ERROR,
+ CURLE_SSL_CONNECT_ERROR,
+ );
+
+ /**
+ * Executes a CURL request with optional retries and exception on failure
+ *
+ * @param resource $ch curl handler
+ * @throws \RuntimeException
+ */
+ public static function execute($ch, $retries = 5, $closeAfterDone = true)
+ {
+ while ($retries--) {
+ if (curl_exec($ch) === false) {
+ $curlErrno = curl_errno($ch);
+
+ if (false === in_array($curlErrno, self::$retriableErrorCodes, true) || !$retries) {
+ $curlError = curl_error($ch);
+
+ if ($closeAfterDone) {
+ curl_close($ch);
+ }
+
+ throw new \RuntimeException(sprintf('Curl error (code %s): %s', $curlErrno, $curlError));
+ }
+
+ continue;
+ }
+
+ if ($closeAfterDone) {
+ curl_close($ch);
+ }
+ break;
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DeduplicationHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DeduplicationHandler.php
new file mode 100644
index 0000000..7778c22
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/DeduplicationHandler.php
@@ -0,0 +1,169 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Simple handler wrapper that deduplicates log records across multiple requests
+ *
+ * It also includes the BufferHandler functionality and will buffer
+ * all messages until the end of the request or flush() is called.
+ *
+ * This works by storing all log records' messages above $deduplicationLevel
+ * to the file specified by $deduplicationStore. When further logs come in at the end of the
+ * request (or when flush() is called), all those above $deduplicationLevel are checked
+ * against the existing stored logs. If they match and the timestamps in the stored log is
+ * not older than $time seconds, the new log record is discarded. If no log record is new, the
+ * whole data set is discarded.
+ *
+ * This is mainly useful in combination with Mail handlers or things like Slack or HipChat handlers
+ * that send messages to people, to avoid spamming with the same message over and over in case of
+ * a major component failure like a database server being down which makes all requests fail in the
+ * same way.
+ *
+ * @author Jordi Boggiano
+ */
+class DeduplicationHandler extends BufferHandler
+{
+ /**
+ * @var string
+ */
+ protected $deduplicationStore;
+
+ /**
+ * @var int
+ */
+ protected $deduplicationLevel;
+
+ /**
+ * @var int
+ */
+ protected $time;
+
+ /**
+ * @var bool
+ */
+ private $gc = false;
+
+ /**
+ * @param HandlerInterface $handler Handler.
+ * @param string $deduplicationStore The file/path where the deduplication log should be kept
+ * @param int $deduplicationLevel The minimum logging level for log records to be looked at for deduplication purposes
+ * @param int $time The period (in seconds) during which duplicate entries should be suppressed after a given log is sent through
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(HandlerInterface $handler, $deduplicationStore = null, $deduplicationLevel = Logger::ERROR, $time = 60, $bubble = true)
+ {
+ parent::__construct($handler, 0, Logger::DEBUG, $bubble, false);
+
+ $this->deduplicationStore = $deduplicationStore === null ? sys_get_temp_dir() . '/monolog-dedup-' . substr(md5(__FILE__), 0, 20) .'.log' : $deduplicationStore;
+ $this->deduplicationLevel = Logger::toMonologLevel($deduplicationLevel);
+ $this->time = $time;
+ }
+
+ public function flush()
+ {
+ if ($this->bufferSize === 0) {
+ return;
+ }
+
+ $passthru = null;
+
+ foreach ($this->buffer as $record) {
+ if ($record['level'] >= $this->deduplicationLevel) {
+
+ $passthru = $passthru || !$this->isDuplicate($record);
+ if ($passthru) {
+ $this->appendRecord($record);
+ }
+ }
+ }
+
+ // default of null is valid as well as if no record matches duplicationLevel we just pass through
+ if ($passthru === true || $passthru === null) {
+ $this->handler->handleBatch($this->buffer);
+ }
+
+ $this->clear();
+
+ if ($this->gc) {
+ $this->collectLogs();
+ }
+ }
+
+ private function isDuplicate(array $record)
+ {
+ if (!file_exists($this->deduplicationStore)) {
+ return false;
+ }
+
+ $store = file($this->deduplicationStore, FILE_IGNORE_NEW_LINES | FILE_SKIP_EMPTY_LINES);
+ if (!is_array($store)) {
+ return false;
+ }
+
+ $yesterday = time() - 86400;
+ $timestampValidity = $record['datetime']->getTimestamp() - $this->time;
+ $expectedMessage = preg_replace('{[\r\n].*}', '', $record['message']);
+
+ for ($i = count($store) - 1; $i >= 0; $i--) {
+ list($timestamp, $level, $message) = explode(':', $store[$i], 3);
+
+ if ($level === $record['level_name'] && $message === $expectedMessage && $timestamp > $timestampValidity) {
+ return true;
+ }
+
+ if ($timestamp < $yesterday) {
+ $this->gc = true;
+ }
+ }
+
+ return false;
+ }
+
+ private function collectLogs()
+ {
+ if (!file_exists($this->deduplicationStore)) {
+ return false;
+ }
+
+ $handle = fopen($this->deduplicationStore, 'rw+');
+ flock($handle, LOCK_EX);
+ $validLogs = array();
+
+ $timestampValidity = time() - $this->time;
+
+ while (!feof($handle)) {
+ $log = fgets($handle);
+ if (substr($log, 0, 10) >= $timestampValidity) {
+ $validLogs[] = $log;
+ }
+ }
+
+ ftruncate($handle, 0);
+ rewind($handle);
+ foreach ($validLogs as $log) {
+ fwrite($handle, $log);
+ }
+
+ flock($handle, LOCK_UN);
+ fclose($handle);
+
+ $this->gc = false;
+ }
+
+ private function appendRecord(array $record)
+ {
+ file_put_contents($this->deduplicationStore, $record['datetime']->getTimestamp() . ':' . $record['level_name'] . ':' . preg_replace('{[\r\n].*}', '', $record['message']) . "\n", FILE_APPEND);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php
new file mode 100644
index 0000000..b91ffec
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php
@@ -0,0 +1,45 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+use Doctrine\CouchDB\CouchDBClient;
+
+/**
+ * CouchDB handler for Doctrine CouchDB ODM
+ *
+ * @author Markus Bachmann
+ */
+class DoctrineCouchDBHandler extends AbstractProcessingHandler
+{
+ private $client;
+
+ public function __construct(CouchDBClient $client, $level = Logger::DEBUG, $bubble = true)
+ {
+ $this->client = $client;
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $this->client->postDocument($record['formatted']);
+ }
+
+ protected function getDefaultFormatter()
+ {
+ return new NormalizerFormatter;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php
new file mode 100644
index 0000000..7b20830
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php
@@ -0,0 +1,89 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Aws\Common\Aws;
+use Aws\DynamoDb\DynamoDbClient;
+use Monolog\Formatter\ScalarFormatter;
+use Monolog\Logger;
+
+/**
+ * Amazon DynamoDB handler (http://aws.amazon.com/dynamodb/)
+ *
+ * @link https://github.com/aws/aws-sdk-php/
+ * @author Andrew Lawson
+ */
+class DynamoDbHandler extends AbstractProcessingHandler
+{
+ const DATE_FORMAT = 'Y-m-d\TH:i:s.uO';
+
+ /**
+ * @var DynamoDbClient
+ */
+ protected $client;
+
+ /**
+ * @var string
+ */
+ protected $table;
+
+ /**
+ * @param DynamoDbClient $client
+ * @param string $table
+ * @param int $level
+ * @param bool $bubble
+ */
+ public function __construct(DynamoDbClient $client, $table, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!defined('Aws\Common\Aws::VERSION') || version_compare('3.0', Aws::VERSION, '<=')) {
+ throw new \RuntimeException('The DynamoDbHandler is only known to work with the AWS SDK 2.x releases');
+ }
+
+ $this->client = $client;
+ $this->table = $table;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $filtered = $this->filterEmptyFields($record['formatted']);
+ $formatted = $this->client->formatAttributes($filtered);
+
+ $this->client->putItem(array(
+ 'TableName' => $this->table,
+ 'Item' => $formatted,
+ ));
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ protected function filterEmptyFields(array $record)
+ {
+ return array_filter($record, function ($value) {
+ return !empty($value) || false === $value || 0 === $value;
+ });
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new ScalarFormatter(self::DATE_FORMAT);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php
new file mode 100644
index 0000000..8196740
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php
@@ -0,0 +1,128 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\ElasticaFormatter;
+use Monolog\Logger;
+use Elastica\Client;
+use Elastica\Exception\ExceptionInterface;
+
+/**
+ * Elastic Search handler
+ *
+ * Usage example:
+ *
+ * $client = new \Elastica\Client();
+ * $options = array(
+ * 'index' => 'elastic_index_name',
+ * 'type' => 'elastic_doc_type',
+ * );
+ * $handler = new ElasticSearchHandler($client, $options);
+ * $log = new Logger('application');
+ * $log->pushHandler($handler);
+ *
+ * @author Jelle Vink
+ */
+class ElasticSearchHandler extends AbstractProcessingHandler
+{
+ /**
+ * @var Client
+ */
+ protected $client;
+
+ /**
+ * @var array Handler config options
+ */
+ protected $options = array();
+
+ /**
+ * @param Client $client Elastica Client object
+ * @param array $options Handler configuration
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(Client $client, array $options = array(), $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+ $this->client = $client;
+ $this->options = array_merge(
+ array(
+ 'index' => 'monolog', // Elastic index name
+ 'type' => 'record', // Elastic document type
+ 'ignore_error' => false, // Suppress Elastica exceptions
+ ),
+ $options
+ );
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $this->bulkSend(array($record['formatted']));
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function setFormatter(FormatterInterface $formatter)
+ {
+ if ($formatter instanceof ElasticaFormatter) {
+ return parent::setFormatter($formatter);
+ }
+ throw new \InvalidArgumentException('ElasticSearchHandler is only compatible with ElasticaFormatter');
+ }
+
+ /**
+ * Getter options
+ * @return array
+ */
+ public function getOptions()
+ {
+ return $this->options;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new ElasticaFormatter($this->options['index'], $this->options['type']);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $documents = $this->getFormatter()->formatBatch($records);
+ $this->bulkSend($documents);
+ }
+
+ /**
+ * Use Elasticsearch bulk API to send list of documents
+ * @param array $documents
+ * @throws \RuntimeException
+ */
+ protected function bulkSend(array $documents)
+ {
+ try {
+ $this->client->addDocuments($documents);
+ } catch (ExceptionInterface $e) {
+ if (!$this->options['ignore_error']) {
+ throw new \RuntimeException("Error sending messages to Elasticsearch", 0, $e);
+ }
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php
new file mode 100644
index 0000000..1447a58
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php
@@ -0,0 +1,82 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+
+/**
+ * Stores to PHP error_log() handler.
+ *
+ * @author Elan Ruusamäe
+ */
+class ErrorLogHandler extends AbstractProcessingHandler
+{
+ const OPERATING_SYSTEM = 0;
+ const SAPI = 4;
+
+ protected $messageType;
+ protected $expandNewlines;
+
+ /**
+ * @param int $messageType Says where the error should go.
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $expandNewlines If set to true, newlines in the message will be expanded to be take multiple log entries
+ */
+ public function __construct($messageType = self::OPERATING_SYSTEM, $level = Logger::DEBUG, $bubble = true, $expandNewlines = false)
+ {
+ parent::__construct($level, $bubble);
+
+ if (false === in_array($messageType, self::getAvailableTypes())) {
+ $message = sprintf('The given message type "%s" is not supported', print_r($messageType, true));
+ throw new \InvalidArgumentException($message);
+ }
+
+ $this->messageType = $messageType;
+ $this->expandNewlines = $expandNewlines;
+ }
+
+ /**
+ * @return array With all available types
+ */
+ public static function getAvailableTypes()
+ {
+ return array(
+ self::OPERATING_SYSTEM,
+ self::SAPI,
+ );
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('[%datetime%] %channel%.%level_name%: %message% %context% %extra%');
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if ($this->expandNewlines) {
+ $lines = preg_split('{[\r\n]+}', (string) $record['formatted']);
+ foreach ($lines as $line) {
+ error_log($line, $this->messageType);
+ }
+ } else {
+ error_log((string) $record['formatted'], $this->messageType);
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php
new file mode 100644
index 0000000..2a0f7fd
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php
@@ -0,0 +1,140 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Simple handler wrapper that filters records based on a list of levels
+ *
+ * It can be configured with an exact list of levels to allow, or a min/max level.
+ *
+ * @author Hennadiy Verkh
+ * @author Jordi Boggiano
+ */
+class FilterHandler extends AbstractHandler
+{
+ /**
+ * Handler or factory callable($record, $this)
+ *
+ * @var callable|\Monolog\Handler\HandlerInterface
+ */
+ protected $handler;
+
+ /**
+ * Minimum level for logs that are passed to handler
+ *
+ * @var int[]
+ */
+ protected $acceptedLevels;
+
+ /**
+ * Whether the messages that are handled can bubble up the stack or not
+ *
+ * @var Boolean
+ */
+ protected $bubble;
+
+ /**
+ * @param callable|HandlerInterface $handler Handler or factory callable($record, $this).
+ * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided
+ * @param int $maxLevel Maximum level to accept, only used if $minLevelOrList is not an array
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($handler, $minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY, $bubble = true)
+ {
+ $this->handler = $handler;
+ $this->bubble = $bubble;
+ $this->setAcceptedLevels($minLevelOrList, $maxLevel);
+
+ if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+ throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+ }
+ }
+
+ /**
+ * @return array
+ */
+ public function getAcceptedLevels()
+ {
+ return array_flip($this->acceptedLevels);
+ }
+
+ /**
+ * @param int|string|array $minLevelOrList A list of levels to accept or a minimum level or level name if maxLevel is provided
+ * @param int|string $maxLevel Maximum level or level name to accept, only used if $minLevelOrList is not an array
+ */
+ public function setAcceptedLevels($minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY)
+ {
+ if (is_array($minLevelOrList)) {
+ $acceptedLevels = array_map('Monolog\Logger::toMonologLevel', $minLevelOrList);
+ } else {
+ $minLevelOrList = Logger::toMonologLevel($minLevelOrList);
+ $maxLevel = Logger::toMonologLevel($maxLevel);
+ $acceptedLevels = array_values(array_filter(Logger::getLevels(), function ($level) use ($minLevelOrList, $maxLevel) {
+ return $level >= $minLevelOrList && $level <= $maxLevel;
+ }));
+ }
+ $this->acceptedLevels = array_flip($acceptedLevels);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ return isset($this->acceptedLevels[$record['level']]);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if (!$this->isHandling($record)) {
+ return false;
+ }
+
+ // The same logic as in FingersCrossedHandler
+ if (!$this->handler instanceof HandlerInterface) {
+ $this->handler = call_user_func($this->handler, $record, $this);
+ if (!$this->handler instanceof HandlerInterface) {
+ throw new \RuntimeException("The factory callable should return a HandlerInterface");
+ }
+ }
+
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ $this->handler->handle($record);
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $filtered = array();
+ foreach ($records as $record) {
+ if ($this->isHandling($record)) {
+ $filtered[] = $record;
+ }
+ }
+
+ $this->handler->handleBatch($filtered);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php
new file mode 100644
index 0000000..c3e42ef
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php
@@ -0,0 +1,28 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+/**
+ * Interface for activation strategies for the FingersCrossedHandler.
+ *
+ * @author Johannes M. Schmitt
+ */
+interface ActivationStrategyInterface
+{
+ /**
+ * Returns whether the given record activates the handler.
+ *
+ * @param array $record
+ * @return Boolean
+ */
+ public function isHandlerActivated(array $record);
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php
new file mode 100644
index 0000000..2a2a64d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php
@@ -0,0 +1,59 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+use Monolog\Logger;
+
+/**
+ * Channel and Error level based monolog activation strategy. Allows to trigger activation
+ * based on level per channel. e.g. trigger activation on level 'ERROR' by default, except
+ * for records of the 'sql' channel; those should trigger activation on level 'WARN'.
+ *
+ * Example:
+ *
+ *
+ * $activationStrategy = new ChannelLevelActivationStrategy(
+ * Logger::CRITICAL,
+ * array(
+ * 'request' => Logger::ALERT,
+ * 'sensitive' => Logger::ERROR,
+ * )
+ * );
+ * $handler = new FingersCrossedHandler(new StreamHandler('php://stderr'), $activationStrategy);
+ *
+ *
+ * @author Mike Meessen
+ */
+class ChannelLevelActivationStrategy implements ActivationStrategyInterface
+{
+ private $defaultActionLevel;
+ private $channelToActionLevel;
+
+ /**
+ * @param int $defaultActionLevel The default action level to be used if the record's category doesn't match any
+ * @param array $channelToActionLevel An array that maps channel names to action levels.
+ */
+ public function __construct($defaultActionLevel, $channelToActionLevel = array())
+ {
+ $this->defaultActionLevel = Logger::toMonologLevel($defaultActionLevel);
+ $this->channelToActionLevel = array_map('Monolog\Logger::toMonologLevel', $channelToActionLevel);
+ }
+
+ public function isHandlerActivated(array $record)
+ {
+ if (isset($this->channelToActionLevel[$record['channel']])) {
+ return $record['level'] >= $this->channelToActionLevel[$record['channel']];
+ }
+
+ return $record['level'] >= $this->defaultActionLevel;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php
new file mode 100644
index 0000000..6e63085
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php
@@ -0,0 +1,34 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+use Monolog\Logger;
+
+/**
+ * Error level based activation strategy.
+ *
+ * @author Johannes M. Schmitt
+ */
+class ErrorLevelActivationStrategy implements ActivationStrategyInterface
+{
+ private $actionLevel;
+
+ public function __construct($actionLevel)
+ {
+ $this->actionLevel = Logger::toMonologLevel($actionLevel);
+ }
+
+ public function isHandlerActivated(array $record)
+ {
+ return $record['level'] >= $this->actionLevel;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php
new file mode 100644
index 0000000..30a85dd
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php
@@ -0,0 +1,153 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ActivationStrategyInterface;
+use Monolog\Logger;
+
+/**
+ * Buffers all records until a certain level is reached
+ *
+ * The advantage of this approach is that you don't get any clutter in your log files.
+ * Only requests which actually trigger an error (or whatever your actionLevel is) will be
+ * in the logs, but they will contain all records, not only those above the level threshold.
+ *
+ * You can find the various activation strategies in the
+ * Monolog\Handler\FingersCrossed\ namespace.
+ *
+ * @author Jordi Boggiano
+ */
+class FingersCrossedHandler extends AbstractHandler
+{
+ protected $handler;
+ protected $activationStrategy;
+ protected $buffering = true;
+ protected $bufferSize;
+ protected $buffer = array();
+ protected $stopBuffering;
+ protected $passthruLevel;
+
+ /**
+ * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler).
+ * @param int|ActivationStrategyInterface $activationStrategy Strategy which determines when this handler takes action
+ * @param int $bufferSize How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $stopBuffering Whether the handler should stop buffering after being triggered (default true)
+ * @param int $passthruLevel Minimum level to always flush to handler on close, even if strategy not triggered
+ */
+ public function __construct($handler, $activationStrategy = null, $bufferSize = 0, $bubble = true, $stopBuffering = true, $passthruLevel = null)
+ {
+ if (null === $activationStrategy) {
+ $activationStrategy = new ErrorLevelActivationStrategy(Logger::WARNING);
+ }
+
+ // convert simple int activationStrategy to an object
+ if (!$activationStrategy instanceof ActivationStrategyInterface) {
+ $activationStrategy = new ErrorLevelActivationStrategy($activationStrategy);
+ }
+
+ $this->handler = $handler;
+ $this->activationStrategy = $activationStrategy;
+ $this->bufferSize = $bufferSize;
+ $this->bubble = $bubble;
+ $this->stopBuffering = $stopBuffering;
+
+ if ($passthruLevel !== null) {
+ $this->passthruLevel = Logger::toMonologLevel($passthruLevel);
+ }
+
+ if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+ throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ return true;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ if ($this->buffering) {
+ $this->buffer[] = $record;
+ if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) {
+ array_shift($this->buffer);
+ }
+ if ($this->activationStrategy->isHandlerActivated($record)) {
+ if ($this->stopBuffering) {
+ $this->buffering = false;
+ }
+ if (!$this->handler instanceof HandlerInterface) {
+ $this->handler = call_user_func($this->handler, $record, $this);
+ if (!$this->handler instanceof HandlerInterface) {
+ throw new \RuntimeException("The factory callable should return a HandlerInterface");
+ }
+ }
+ $this->handler->handleBatch($this->buffer);
+ $this->buffer = array();
+ }
+ } else {
+ $this->handler->handle($record);
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ if (null !== $this->passthruLevel) {
+ $level = $this->passthruLevel;
+ $this->buffer = array_filter($this->buffer, function ($record) use ($level) {
+ return $record['level'] >= $level;
+ });
+ if (count($this->buffer) > 0) {
+ $this->handler->handleBatch($this->buffer);
+ $this->buffer = array();
+ }
+ }
+ }
+
+ /**
+ * Resets the state of the handler. Stops forwarding records to the wrapped handler.
+ */
+ public function reset()
+ {
+ $this->buffering = true;
+ }
+
+ /**
+ * Clears the buffer without flushing any messages down to the wrapped handler.
+ *
+ * It also resets the handler to its initial buffering state.
+ */
+ public function clear()
+ {
+ $this->buffer = array();
+ $this->reset();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php
new file mode 100644
index 0000000..fee4795
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php
@@ -0,0 +1,195 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\WildfireFormatter;
+
+/**
+ * Simple FirePHP Handler (http://www.firephp.org/), which uses the Wildfire protocol.
+ *
+ * @author Eric Clemmons (@ericclemmons)
+ */
+class FirePHPHandler extends AbstractProcessingHandler
+{
+ /**
+ * WildFire JSON header message format
+ */
+ const PROTOCOL_URI = 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2';
+
+ /**
+ * FirePHP structure for parsing messages & their presentation
+ */
+ const STRUCTURE_URI = 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1';
+
+ /**
+ * Must reference a "known" plugin, otherwise headers won't display in FirePHP
+ */
+ const PLUGIN_URI = 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3';
+
+ /**
+ * Header prefix for Wildfire to recognize & parse headers
+ */
+ const HEADER_PREFIX = 'X-Wf';
+
+ /**
+ * Whether or not Wildfire vendor-specific headers have been generated & sent yet
+ */
+ protected static $initialized = false;
+
+ /**
+ * Shared static message index between potentially multiple handlers
+ * @var int
+ */
+ protected static $messageIndex = 1;
+
+ protected static $sendHeaders = true;
+
+ /**
+ * Base header creation function used by init headers & record headers
+ *
+ * @param array $meta Wildfire Plugin, Protocol & Structure Indexes
+ * @param string $message Log message
+ * @return array Complete header string ready for the client as key and message as value
+ */
+ protected function createHeader(array $meta, $message)
+ {
+ $header = sprintf('%s-%s', self::HEADER_PREFIX, join('-', $meta));
+
+ return array($header => $message);
+ }
+
+ /**
+ * Creates message header from record
+ *
+ * @see createHeader()
+ * @param array $record
+ * @return string
+ */
+ protected function createRecordHeader(array $record)
+ {
+ // Wildfire is extensible to support multiple protocols & plugins in a single request,
+ // but we're not taking advantage of that (yet), so we're using "1" for simplicity's sake.
+ return $this->createHeader(
+ array(1, 1, 1, self::$messageIndex++),
+ $record['formatted']
+ );
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new WildfireFormatter();
+ }
+
+ /**
+ * Wildfire initialization headers to enable message parsing
+ *
+ * @see createHeader()
+ * @see sendHeader()
+ * @return array
+ */
+ protected function getInitHeaders()
+ {
+ // Initial payload consists of required headers for Wildfire
+ return array_merge(
+ $this->createHeader(array('Protocol', 1), self::PROTOCOL_URI),
+ $this->createHeader(array(1, 'Structure', 1), self::STRUCTURE_URI),
+ $this->createHeader(array(1, 'Plugin', 1), self::PLUGIN_URI)
+ );
+ }
+
+ /**
+ * Send header string to the client
+ *
+ * @param string $header
+ * @param string $content
+ */
+ protected function sendHeader($header, $content)
+ {
+ if (!headers_sent() && self::$sendHeaders) {
+ header(sprintf('%s: %s', $header, $content));
+ }
+ }
+
+ /**
+ * Creates & sends header for a record, ensuring init headers have been sent prior
+ *
+ * @see sendHeader()
+ * @see sendInitHeaders()
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ if (!self::$sendHeaders) {
+ return;
+ }
+
+ // WildFire-specific headers must be sent prior to any messages
+ if (!self::$initialized) {
+ self::$initialized = true;
+
+ self::$sendHeaders = $this->headersAccepted();
+ if (!self::$sendHeaders) {
+ return;
+ }
+
+ foreach ($this->getInitHeaders() as $header => $content) {
+ $this->sendHeader($header, $content);
+ }
+ }
+
+ $header = $this->createRecordHeader($record);
+ if (trim(current($header)) !== '') {
+ $this->sendHeader(key($header), current($header));
+ }
+ }
+
+ /**
+ * Verifies if the headers are accepted by the current user agent
+ *
+ * @return Boolean
+ */
+ protected function headersAccepted()
+ {
+ if (!empty($_SERVER['HTTP_USER_AGENT']) && preg_match('{\bFirePHP/\d+\.\d+\b}', $_SERVER['HTTP_USER_AGENT'])) {
+ return true;
+ }
+
+ return isset($_SERVER['HTTP_X_FIREPHP_VERSION']);
+ }
+
+ /**
+ * BC getter for the sendHeaders property that has been made static
+ */
+ public function __get($property)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ return static::$sendHeaders;
+ }
+
+ /**
+ * BC setter for the sendHeaders property that has been made static
+ */
+ public function __set($property, $value)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ static::$sendHeaders = $value;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php
new file mode 100644
index 0000000..c43c013
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php
@@ -0,0 +1,126 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+
+/**
+ * Sends logs to Fleep.io using Webhook integrations
+ *
+ * You'll need a Fleep.io account to use this handler.
+ *
+ * @see https://fleep.io/integrations/webhooks/ Fleep Webhooks Documentation
+ * @author Ando Roots
+ */
+class FleepHookHandler extends SocketHandler
+{
+ const FLEEP_HOST = 'fleep.io';
+
+ const FLEEP_HOOK_URI = '/hook/';
+
+ /**
+ * @var string Webhook token (specifies the conversation where logs are sent)
+ */
+ protected $token;
+
+ /**
+ * Construct a new Fleep.io Handler.
+ *
+ * For instructions on how to create a new web hook in your conversations
+ * see https://fleep.io/integrations/webhooks/
+ *
+ * @param string $token Webhook token
+ * @param bool|int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ * @throws MissingExtensionException
+ */
+ public function __construct($token, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FleepHookHandler');
+ }
+
+ $this->token = $token;
+
+ $connectionString = 'ssl://' . self::FLEEP_HOST . ':443';
+ parent::__construct($connectionString, $level, $bubble);
+ }
+
+ /**
+ * Returns the default formatter to use with this handler
+ *
+ * Overloaded to remove empty context and extra arrays from the end of the log message.
+ *
+ * @return LineFormatter
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter(null, null, true, true);
+ }
+
+ /**
+ * Handles a log record
+ *
+ * @param array $record
+ */
+ public function write(array $record)
+ {
+ parent::write($record);
+ $this->closeSocket();
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ $header = "POST " . self::FLEEP_HOOK_URI . $this->token . " HTTP/1.1\r\n";
+ $header .= "Host: " . self::FLEEP_HOST . "\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ $dataArray = array(
+ 'message' => $record['formatted'],
+ );
+
+ return http_build_query($dataArray);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php
new file mode 100644
index 0000000..dd9a361
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php
@@ -0,0 +1,127 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\FlowdockFormatter;
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * Sends notifications through the Flowdock push API
+ *
+ * This must be configured with a FlowdockFormatter instance via setFormatter()
+ *
+ * Notes:
+ * API token - Flowdock API token
+ *
+ * @author Dominik Liebler
+ * @see https://www.flowdock.com/api/push
+ */
+class FlowdockHandler extends SocketHandler
+{
+ /**
+ * @var string
+ */
+ protected $apiToken;
+
+ /**
+ * @param string $apiToken
+ * @param bool|int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ *
+ * @throws MissingExtensionException if OpenSSL is missing
+ */
+ public function __construct($apiToken, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FlowdockHandler');
+ }
+
+ parent::__construct('ssl://api.flowdock.com:443', $level, $bubble);
+ $this->apiToken = $apiToken;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function setFormatter(FormatterInterface $formatter)
+ {
+ if (!$formatter instanceof FlowdockFormatter) {
+ throw new \InvalidArgumentException('The FlowdockHandler requires an instance of Monolog\Formatter\FlowdockFormatter to function correctly');
+ }
+
+ return parent::setFormatter($formatter);
+ }
+
+ /**
+ * Gets the default formatter.
+ *
+ * @return FormatterInterface
+ */
+ protected function getDefaultFormatter()
+ {
+ throw new \InvalidArgumentException('The FlowdockHandler must be configured (via setFormatter) with an instance of Monolog\Formatter\FlowdockFormatter to function correctly');
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ parent::write($record);
+
+ $this->closeSocket();
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ return json_encode($record['formatted']['flowdock']);
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ $header = "POST /v1/messages/team_inbox/" . $this->apiToken . " HTTP/1.1\r\n";
+ $header .= "Host: api.flowdock.com\r\n";
+ $header .= "Content-Type: application/json\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php
new file mode 100644
index 0000000..d3847d8
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php
@@ -0,0 +1,73 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\IMessagePublisher;
+use Gelf\PublisherInterface;
+use Gelf\Publisher;
+use InvalidArgumentException;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+/**
+ * Handler to send messages to a Graylog2 (http://www.graylog2.org) server
+ *
+ * @author Matt Lehner
+ * @author Benjamin Zikarsky
+ */
+class GelfHandler extends AbstractProcessingHandler
+{
+ /**
+ * @var Publisher the publisher object that sends the message to the server
+ */
+ protected $publisher;
+
+ /**
+ * @param PublisherInterface|IMessagePublisher|Publisher $publisher a publisher object
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($publisher, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ if (!$publisher instanceof Publisher && !$publisher instanceof IMessagePublisher && !$publisher instanceof PublisherInterface) {
+ throw new InvalidArgumentException('Invalid publisher, expected a Gelf\Publisher, Gelf\IMessagePublisher or Gelf\PublisherInterface instance');
+ }
+
+ $this->publisher = $publisher;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ $this->publisher = null;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->publisher->publish($record['formatted']);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new GelfMessageFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php
new file mode 100644
index 0000000..48e7b8e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php
@@ -0,0 +1,94 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * Forwards records to multiple handlers
+ *
+ * @author Lenar Lõhmus
+ */
+class GroupHandler extends AbstractHandler
+{
+ protected $handlers;
+
+ /**
+ * @param array $handlers Array of Handlers.
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(array $handlers, $bubble = true)
+ {
+ foreach ($handlers as $handler) {
+ if (!$handler instanceof HandlerInterface) {
+ throw new \InvalidArgumentException('The first argument of the GroupHandler must be an array of HandlerInterface instances.');
+ }
+ }
+
+ $this->handlers = $handlers;
+ $this->bubble = $bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ foreach ($this->handlers as $handler) {
+ if ($handler->isHandling($record)) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ foreach ($this->handlers as $handler) {
+ $handler->handle($record);
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ foreach ($this->handlers as $handler) {
+ $handler->handleBatch($records);
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function setFormatter(FormatterInterface $formatter)
+ {
+ foreach ($this->handlers as $handler) {
+ $handler->setFormatter($formatter);
+ }
+
+ return $this;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php
new file mode 100644
index 0000000..d920c4b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php
@@ -0,0 +1,90 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * Interface that all Monolog Handlers must implement
+ *
+ * @author Jordi Boggiano
+ */
+interface HandlerInterface
+{
+ /**
+ * Checks whether the given record will be handled by this handler.
+ *
+ * This is mostly done for performance reasons, to avoid calling processors for nothing.
+ *
+ * Handlers should still check the record levels within handle(), returning false in isHandling()
+ * is no guarantee that handle() will not be called, and isHandling() might not be called
+ * for a given record.
+ *
+ * @param array $record Partial log record containing only a level key
+ *
+ * @return Boolean
+ */
+ public function isHandling(array $record);
+
+ /**
+ * Handles a record.
+ *
+ * All records may be passed to this method, and the handler should discard
+ * those that it does not want to handle.
+ *
+ * The return value of this function controls the bubbling process of the handler stack.
+ * Unless the bubbling is interrupted (by returning true), the Logger class will keep on
+ * calling further handlers in the stack with a given log record.
+ *
+ * @param array $record The record to handle
+ * @return Boolean true means that this handler handled the record, and that bubbling is not permitted.
+ * false means the record was either not processed or that this handler allows bubbling.
+ */
+ public function handle(array $record);
+
+ /**
+ * Handles a set of records at once.
+ *
+ * @param array $records The records to handle (an array of record arrays)
+ */
+ public function handleBatch(array $records);
+
+ /**
+ * Adds a processor in the stack.
+ *
+ * @param callable $callback
+ * @return self
+ */
+ public function pushProcessor($callback);
+
+ /**
+ * Removes the processor on top of the stack and returns it.
+ *
+ * @return callable
+ */
+ public function popProcessor();
+
+ /**
+ * Sets the formatter.
+ *
+ * @param FormatterInterface $formatter
+ * @return self
+ */
+ public function setFormatter(FormatterInterface $formatter);
+
+ /**
+ * Gets the formatter.
+ *
+ * @return FormatterInterface
+ */
+ public function getFormatter();
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HandlerWrapper.php b/vendor/monolog/monolog/src/Monolog/Handler/HandlerWrapper.php
new file mode 100644
index 0000000..ad2bd81
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/HandlerWrapper.php
@@ -0,0 +1,106 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * This simple wrapper class can be used to extend handlers functionality.
+ *
+ * Example: A filtering handle. Inherit from this class, override isHandling() like this
+ *
+ * public function isHandling(array $record)
+ * {
+ * if ($record meets certain conditions) {
+ * return false;
+ * }
+ * return $this->handler->isHandling($record);
+ * }
+ *
+ * @author Alexey Karapetov
+ */
+class HandlerWrapper implements HandlerInterface
+{
+ /**
+ * @var HandlerInterface
+ */
+ private $handler;
+
+ /**
+ * HandlerWrapper constructor.
+ * @param HandlerInterface $handler
+ */
+ public function __construct(HandlerInterface $handler)
+ {
+ $this->handler = $handler;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ return $this->handler->isHandling($record);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ return $this->handler->handle($record);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ return $this->handler->handleBatch($records);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function pushProcessor($callback)
+ {
+ $this->handler->pushProcessor($callback);
+
+ return $this;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function popProcessor()
+ {
+ return $this->handler->popProcessor();
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function setFormatter(FormatterInterface $formatter)
+ {
+ $this->handler->setFormatter($formatter);
+
+ return $this;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function getFormatter()
+ {
+ return $this->handler->getFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php
new file mode 100644
index 0000000..73049f3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php
@@ -0,0 +1,350 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the hipchat api to a hipchat room
+ *
+ * Notes:
+ * API token - HipChat API token
+ * Room - HipChat Room Id or name, where messages are sent
+ * Name - Name used to send the message (from)
+ * notify - Should the message trigger a notification in the clients
+ * version - The API version to use (HipChatHandler::API_V1 | HipChatHandler::API_V2)
+ *
+ * @author Rafael Dohms
+ * @see https://www.hipchat.com/docs/api
+ */
+class HipChatHandler extends SocketHandler
+{
+ /**
+ * Use API version 1
+ */
+ const API_V1 = 'v1';
+
+ /**
+ * Use API version v2
+ */
+ const API_V2 = 'v2';
+
+ /**
+ * The maximum allowed length for the name used in the "from" field.
+ */
+ const MAXIMUM_NAME_LENGTH = 15;
+
+ /**
+ * The maximum allowed length for the message.
+ */
+ const MAXIMUM_MESSAGE_LENGTH = 9500;
+
+ /**
+ * @var string
+ */
+ private $token;
+
+ /**
+ * @var string
+ */
+ private $room;
+
+ /**
+ * @var string
+ */
+ private $name;
+
+ /**
+ * @var bool
+ */
+ private $notify;
+
+ /**
+ * @var string
+ */
+ private $format;
+
+ /**
+ * @var string
+ */
+ private $host;
+
+ /**
+ * @var string
+ */
+ private $version;
+
+ /**
+ * @param string $token HipChat API Token
+ * @param string $room The room that should be alerted of the message (Id or Name)
+ * @param string $name Name used in the "from" field.
+ * @param bool $notify Trigger a notification in clients or not
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param bool $useSSL Whether to connect via SSL.
+ * @param string $format The format of the messages (default to text, can be set to html if you have html in the messages)
+ * @param string $host The HipChat server hostname.
+ * @param string $version The HipChat API version (default HipChatHandler::API_V1)
+ */
+ public function __construct($token, $room, $name = 'Monolog', $notify = false, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $format = 'text', $host = 'api.hipchat.com', $version = self::API_V1)
+ {
+ if ($version == self::API_V1 && !$this->validateStringLength($name, static::MAXIMUM_NAME_LENGTH)) {
+ throw new \InvalidArgumentException('The supplied name is too long. HipChat\'s v1 API supports names up to 15 UTF-8 characters.');
+ }
+
+ $connectionString = $useSSL ? 'ssl://'.$host.':443' : $host.':80';
+ parent::__construct($connectionString, $level, $bubble);
+
+ $this->token = $token;
+ $this->name = $name;
+ $this->notify = $notify;
+ $this->room = $room;
+ $this->format = $format;
+ $this->host = $host;
+ $this->version = $version;
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ $dataArray = array(
+ 'notify' => $this->version == self::API_V1 ?
+ ($this->notify ? 1 : 0) :
+ ($this->notify ? 'true' : 'false'),
+ 'message' => $record['formatted'],
+ 'message_format' => $this->format,
+ 'color' => $this->getAlertColor($record['level']),
+ );
+
+ if (!$this->validateStringLength($dataArray['message'], static::MAXIMUM_MESSAGE_LENGTH)) {
+ if (function_exists('mb_substr')) {
+ $dataArray['message'] = mb_substr($dataArray['message'], 0, static::MAXIMUM_MESSAGE_LENGTH).' [truncated]';
+ } else {
+ $dataArray['message'] = substr($dataArray['message'], 0, static::MAXIMUM_MESSAGE_LENGTH).' [truncated]';
+ }
+ }
+
+ // if we are using the legacy API then we need to send some additional information
+ if ($this->version == self::API_V1) {
+ $dataArray['room_id'] = $this->room;
+ }
+
+ // append the sender name if it is set
+ // always append it if we use the v1 api (it is required in v1)
+ if ($this->version == self::API_V1 || $this->name !== null) {
+ $dataArray['from'] = (string) $this->name;
+ }
+
+ return http_build_query($dataArray);
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ if ($this->version == self::API_V1) {
+ $header = "POST /v1/rooms/message?format=json&auth_token={$this->token} HTTP/1.1\r\n";
+ } else {
+ // needed for rooms with special (spaces, etc) characters in the name
+ $room = rawurlencode($this->room);
+ $header = "POST /v2/room/{$room}/notification?auth_token={$this->token} HTTP/1.1\r\n";
+ }
+
+ $header .= "Host: {$this->host}\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ /**
+ * Assigns a color to each level of log records.
+ *
+ * @param int $level
+ * @return string
+ */
+ protected function getAlertColor($level)
+ {
+ switch (true) {
+ case $level >= Logger::ERROR:
+ return 'red';
+ case $level >= Logger::WARNING:
+ return 'yellow';
+ case $level >= Logger::INFO:
+ return 'green';
+ case $level == Logger::DEBUG:
+ return 'gray';
+ default:
+ return 'yellow';
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ parent::write($record);
+ $this->closeSocket();
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ if (count($records) == 0) {
+ return true;
+ }
+
+ $batchRecords = $this->combineRecords($records);
+
+ $handled = false;
+ foreach ($batchRecords as $batchRecord) {
+ if ($this->isHandling($batchRecord)) {
+ $this->write($batchRecord);
+ $handled = true;
+ }
+ }
+
+ if (!$handled) {
+ return false;
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * Combines multiple records into one. Error level of the combined record
+ * will be the highest level from the given records. Datetime will be taken
+ * from the first record.
+ *
+ * @param $records
+ * @return array
+ */
+ private function combineRecords($records)
+ {
+ $batchRecord = null;
+ $batchRecords = array();
+ $messages = array();
+ $formattedMessages = array();
+ $level = 0;
+ $levelName = null;
+ $datetime = null;
+
+ foreach ($records as $record) {
+ $record = $this->processRecord($record);
+
+ if ($record['level'] > $level) {
+ $level = $record['level'];
+ $levelName = $record['level_name'];
+ }
+
+ if (null === $datetime) {
+ $datetime = $record['datetime'];
+ }
+
+ $messages[] = $record['message'];
+ $messageStr = implode(PHP_EOL, $messages);
+ $formattedMessages[] = $this->getFormatter()->format($record);
+ $formattedMessageStr = implode('', $formattedMessages);
+
+ $batchRecord = array(
+ 'message' => $messageStr,
+ 'formatted' => $formattedMessageStr,
+ 'context' => array(),
+ 'extra' => array(),
+ );
+
+ if (!$this->validateStringLength($batchRecord['formatted'], static::MAXIMUM_MESSAGE_LENGTH)) {
+ // Pop the last message and implode the remaining messages
+ $lastMessage = array_pop($messages);
+ $lastFormattedMessage = array_pop($formattedMessages);
+ $batchRecord['message'] = implode(PHP_EOL, $messages);
+ $batchRecord['formatted'] = implode('', $formattedMessages);
+
+ $batchRecords[] = $batchRecord;
+ $messages = array($lastMessage);
+ $formattedMessages = array($lastFormattedMessage);
+
+ $batchRecord = null;
+ }
+ }
+
+ if (null !== $batchRecord) {
+ $batchRecords[] = $batchRecord;
+ }
+
+ // Set the max level and datetime for all records
+ foreach ($batchRecords as &$batchRecord) {
+ $batchRecord = array_merge(
+ $batchRecord,
+ array(
+ 'level' => $level,
+ 'level_name' => $levelName,
+ 'datetime' => $datetime,
+ )
+ );
+ }
+
+ return $batchRecords;
+ }
+
+ /**
+ * Validates the length of a string.
+ *
+ * If the `mb_strlen()` function is available, it will use that, as HipChat
+ * allows UTF-8 characters. Otherwise, it will fall back to `strlen()`.
+ *
+ * Note that this might cause false failures in the specific case of using
+ * a valid name with less than 16 characters, but 16 or more bytes, on a
+ * system where `mb_strlen()` is unavailable.
+ *
+ * @param string $str
+ * @param int $length
+ *
+ * @return bool
+ */
+ private function validateStringLength($str, $length)
+ {
+ if (function_exists('mb_strlen')) {
+ return (mb_strlen($str) <= $length);
+ }
+
+ return (strlen($str) <= $length);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/IFTTTHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/IFTTTHandler.php
new file mode 100644
index 0000000..d60a3c8
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/IFTTTHandler.php
@@ -0,0 +1,69 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * IFTTTHandler uses cURL to trigger IFTTT Maker actions
+ *
+ * Register a secret key and trigger/event name at https://ifttt.com/maker
+ *
+ * value1 will be the channel from monolog's Logger constructor,
+ * value2 will be the level name (ERROR, WARNING, ..)
+ * value3 will be the log record's message
+ *
+ * @author Nehal Patel
+ */
+class IFTTTHandler extends AbstractProcessingHandler
+{
+ private $eventName;
+ private $secretKey;
+
+ /**
+ * @param string $eventName The name of the IFTTT Maker event that should be triggered
+ * @param string $secretKey A valid IFTTT secret key
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($eventName, $secretKey, $level = Logger::ERROR, $bubble = true)
+ {
+ $this->eventName = $eventName;
+ $this->secretKey = $secretKey;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function write(array $record)
+ {
+ $postData = array(
+ "value1" => $record["channel"],
+ "value2" => $record["level_name"],
+ "value3" => $record["message"],
+ );
+ $postString = json_encode($postData);
+
+ $ch = curl_init();
+ curl_setopt($ch, CURLOPT_URL, "https://maker.ifttt.com/trigger/" . $this->eventName . "/with/key/" . $this->secretKey);
+ curl_setopt($ch, CURLOPT_POST, true);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
+ curl_setopt($ch, CURLOPT_POSTFIELDS, $postString);
+ curl_setopt($ch, CURLOPT_HTTPHEADER, array(
+ "Content-Type: application/json",
+ ));
+
+ Curl\Util::execute($ch);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php
new file mode 100644
index 0000000..494c605
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php
@@ -0,0 +1,55 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III
+ */
+class LogEntriesHandler extends SocketHandler
+{
+ /**
+ * @var string
+ */
+ protected $logToken;
+
+ /**
+ * @param string $token Log token supplied by LogEntries
+ * @param bool $useSSL Whether or not SSL encryption should be used.
+ * @param int $level The minimum logging level to trigger this handler
+ * @param bool $bubble Whether or not messages that are handled should bubble up the stack.
+ *
+ * @throws MissingExtensionException If SSL encryption is set to true and OpenSSL is missing
+ */
+ public function __construct($token, $useSSL = true, $level = Logger::DEBUG, $bubble = true)
+ {
+ if ($useSSL && !extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP plugin is required to use SSL encrypted connection for LogEntriesHandler');
+ }
+
+ $endpoint = $useSSL ? 'ssl://data.logentries.com:443' : 'data.logentries.com:80';
+ parent::__construct($endpoint, $level, $bubble);
+ $this->logToken = $token;
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ return $this->logToken . ' ' . $record['formatted'];
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php
new file mode 100644
index 0000000..bcd62e1
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php
@@ -0,0 +1,102 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LogglyFormatter;
+
+/**
+ * Sends errors to Loggly.
+ *
+ * @author Przemek Sobstel
+ * @author Adam Pancutt
+ * @author Gregory Barchard
+ */
+class LogglyHandler extends AbstractProcessingHandler
+{
+ const HOST = 'logs-01.loggly.com';
+ const ENDPOINT_SINGLE = 'inputs';
+ const ENDPOINT_BATCH = 'bulk';
+
+ protected $token;
+
+ protected $tag = array();
+
+ public function __construct($token, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!extension_loaded('curl')) {
+ throw new \LogicException('The curl extension is needed to use the LogglyHandler');
+ }
+
+ $this->token = $token;
+
+ parent::__construct($level, $bubble);
+ }
+
+ public function setTag($tag)
+ {
+ $tag = !empty($tag) ? $tag : array();
+ $this->tag = is_array($tag) ? $tag : array($tag);
+ }
+
+ public function addTag($tag)
+ {
+ if (!empty($tag)) {
+ $tag = is_array($tag) ? $tag : array($tag);
+ $this->tag = array_unique(array_merge($this->tag, $tag));
+ }
+ }
+
+ protected function write(array $record)
+ {
+ $this->send($record["formatted"], self::ENDPOINT_SINGLE);
+ }
+
+ public function handleBatch(array $records)
+ {
+ $level = $this->level;
+
+ $records = array_filter($records, function ($record) use ($level) {
+ return ($record['level'] >= $level);
+ });
+
+ if ($records) {
+ $this->send($this->getFormatter()->formatBatch($records), self::ENDPOINT_BATCH);
+ }
+ }
+
+ protected function send($data, $endpoint)
+ {
+ $url = sprintf("https://%s/%s/%s/", self::HOST, $endpoint, $this->token);
+
+ $headers = array('Content-Type: application/json');
+
+ if (!empty($this->tag)) {
+ $headers[] = 'X-LOGGLY-TAG: '.implode(',', $this->tag);
+ }
+
+ $ch = curl_init();
+
+ curl_setopt($ch, CURLOPT_URL, $url);
+ curl_setopt($ch, CURLOPT_POST, true);
+ curl_setopt($ch, CURLOPT_POSTFIELDS, $data);
+ curl_setopt($ch, CURLOPT_HTTPHEADER, $headers);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
+
+ Curl\Util::execute($ch);
+ }
+
+ protected function getDefaultFormatter()
+ {
+ return new LogglyFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php
new file mode 100644
index 0000000..9e23283
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php
@@ -0,0 +1,67 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base class for all mail handlers
+ *
+ * @author Gyula Sallai
+ */
+abstract class MailHandler extends AbstractProcessingHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $messages = array();
+
+ foreach ($records as $record) {
+ if ($record['level'] < $this->level) {
+ continue;
+ }
+ $messages[] = $this->processRecord($record);
+ }
+
+ if (!empty($messages)) {
+ $this->send((string) $this->getFormatter()->formatBatch($messages), $messages);
+ }
+ }
+
+ /**
+ * Send a mail with the given content
+ *
+ * @param string $content formatted email body to be sent
+ * @param array $records the array of log records that formed this content
+ */
+ abstract protected function send($content, array $records);
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->send((string) $record['formatted'], array($record));
+ }
+
+ protected function getHighestRecord(array $records)
+ {
+ $highestRecord = null;
+ foreach ($records as $record) {
+ if ($highestRecord === null || $highestRecord['level'] < $record['level']) {
+ $highestRecord = $record;
+ }
+ }
+
+ return $highestRecord;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php
new file mode 100644
index 0000000..ab95924
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php
@@ -0,0 +1,68 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * MandrillHandler uses cURL to send the emails to the Mandrill API
+ *
+ * @author Adam Nicholson
+ */
+class MandrillHandler extends MailHandler
+{
+ protected $message;
+ protected $apiKey;
+
+ /**
+ * @param string $apiKey A valid Mandrill API key
+ * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($apiKey, $message, $level = Logger::ERROR, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ if (!$message instanceof \Swift_Message && is_callable($message)) {
+ $message = call_user_func($message);
+ }
+ if (!$message instanceof \Swift_Message) {
+ throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it');
+ }
+ $this->message = $message;
+ $this->apiKey = $apiKey;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function send($content, array $records)
+ {
+ $message = clone $this->message;
+ $message->setBody($content);
+ $message->setDate(time());
+
+ $ch = curl_init();
+
+ curl_setopt($ch, CURLOPT_URL, 'https://mandrillapp.com/api/1.0/messages/send-raw.json');
+ curl_setopt($ch, CURLOPT_POST, 1);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query(array(
+ 'key' => $this->apiKey,
+ 'raw_message' => (string) $message,
+ 'async' => false,
+ )));
+
+ Curl\Util::execute($ch);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php
new file mode 100644
index 0000000..4724a7e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php
@@ -0,0 +1,21 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Exception can be thrown if an extension for an handler is missing
+ *
+ * @author Christian Bergau
+ */
+class MissingExtensionException extends \Exception
+{
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php
new file mode 100644
index 0000000..56fe755
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php
@@ -0,0 +1,59 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+
+/**
+ * Logs to a MongoDB database.
+ *
+ * usage example:
+ *
+ * $log = new Logger('application');
+ * $mongodb = new MongoDBHandler(new \Mongo("mongodb://localhost:27017"), "logs", "prod");
+ * $log->pushHandler($mongodb);
+ *
+ * @author Thomas Tourlourat
+ */
+class MongoDBHandler extends AbstractProcessingHandler
+{
+ protected $mongoCollection;
+
+ public function __construct($mongo, $database, $collection, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!($mongo instanceof \MongoClient || $mongo instanceof \Mongo || $mongo instanceof \MongoDB\Client)) {
+ throw new \InvalidArgumentException('MongoClient, Mongo or MongoDB\Client instance required');
+ }
+
+ $this->mongoCollection = $mongo->selectCollection($database, $collection);
+
+ parent::__construct($level, $bubble);
+ }
+
+ protected function write(array $record)
+ {
+ if ($this->mongoCollection instanceof \MongoDB\Collection) {
+ $this->mongoCollection->insertOne($record["formatted"]);
+ } else {
+ $this->mongoCollection->save($record["formatted"]);
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new NormalizerFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php
new file mode 100644
index 0000000..d7807fd
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php
@@ -0,0 +1,185 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * NativeMailerHandler uses the mail() function to send the emails
+ *
+ * @author Christophe Coevoet
+ * @author Mark Garrett
+ */
+class NativeMailerHandler extends MailHandler
+{
+ /**
+ * The email addresses to which the message will be sent
+ * @var array
+ */
+ protected $to;
+
+ /**
+ * The subject of the email
+ * @var string
+ */
+ protected $subject;
+
+ /**
+ * Optional headers for the message
+ * @var array
+ */
+ protected $headers = array();
+
+ /**
+ * Optional parameters for the message
+ * @var array
+ */
+ protected $parameters = array();
+
+ /**
+ * The wordwrap length for the message
+ * @var int
+ */
+ protected $maxColumnWidth;
+
+ /**
+ * The Content-type for the message
+ * @var string
+ */
+ protected $contentType = 'text/plain';
+
+ /**
+ * The encoding for the message
+ * @var string
+ */
+ protected $encoding = 'utf-8';
+
+ /**
+ * @param string|array $to The receiver of the mail
+ * @param string $subject The subject of the mail
+ * @param string $from The sender of the mail
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int $maxColumnWidth The maximum column width that the message lines will have
+ */
+ public function __construct($to, $subject, $from, $level = Logger::ERROR, $bubble = true, $maxColumnWidth = 70)
+ {
+ parent::__construct($level, $bubble);
+ $this->to = is_array($to) ? $to : array($to);
+ $this->subject = $subject;
+ $this->addHeader(sprintf('From: %s', $from));
+ $this->maxColumnWidth = $maxColumnWidth;
+ }
+
+ /**
+ * Add headers to the message
+ *
+ * @param string|array $headers Custom added headers
+ * @return self
+ */
+ public function addHeader($headers)
+ {
+ foreach ((array) $headers as $header) {
+ if (strpos($header, "\n") !== false || strpos($header, "\r") !== false) {
+ throw new \InvalidArgumentException('Headers can not contain newline characters for security reasons');
+ }
+ $this->headers[] = $header;
+ }
+
+ return $this;
+ }
+
+ /**
+ * Add parameters to the message
+ *
+ * @param string|array $parameters Custom added parameters
+ * @return self
+ */
+ public function addParameter($parameters)
+ {
+ $this->parameters = array_merge($this->parameters, (array) $parameters);
+
+ return $this;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function send($content, array $records)
+ {
+ $content = wordwrap($content, $this->maxColumnWidth);
+ $headers = ltrim(implode("\r\n", $this->headers) . "\r\n", "\r\n");
+ $headers .= 'Content-type: ' . $this->getContentType() . '; charset=' . $this->getEncoding() . "\r\n";
+ if ($this->getContentType() == 'text/html' && false === strpos($headers, 'MIME-Version:')) {
+ $headers .= 'MIME-Version: 1.0' . "\r\n";
+ }
+
+ $subject = $this->subject;
+ if ($records) {
+ $subjectFormatter = new LineFormatter($this->subject);
+ $subject = $subjectFormatter->format($this->getHighestRecord($records));
+ }
+
+ $parameters = implode(' ', $this->parameters);
+ foreach ($this->to as $to) {
+ mail($to, $subject, $content, $headers, $parameters);
+ }
+ }
+
+ /**
+ * @return string $contentType
+ */
+ public function getContentType()
+ {
+ return $this->contentType;
+ }
+
+ /**
+ * @return string $encoding
+ */
+ public function getEncoding()
+ {
+ return $this->encoding;
+ }
+
+ /**
+ * @param string $contentType The content type of the email - Defaults to text/plain. Use text/html for HTML
+ * messages.
+ * @return self
+ */
+ public function setContentType($contentType)
+ {
+ if (strpos($contentType, "\n") !== false || strpos($contentType, "\r") !== false) {
+ throw new \InvalidArgumentException('The content type can not contain newline characters to prevent email header injection');
+ }
+
+ $this->contentType = $contentType;
+
+ return $this;
+ }
+
+ /**
+ * @param string $encoding
+ * @return self
+ */
+ public function setEncoding($encoding)
+ {
+ if (strpos($encoding, "\n") !== false || strpos($encoding, "\r") !== false) {
+ throw new \InvalidArgumentException('The encoding can not contain newline characters to prevent email header injection');
+ }
+
+ $this->encoding = $encoding;
+
+ return $this;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php
new file mode 100644
index 0000000..4eece76
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php
@@ -0,0 +1,198 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+
+/**
+ * Class to record a log on a NewRelic application.
+ * Enabling New Relic High Security mode may prevent capture of useful information.
+ *
+ * @see https://docs.newrelic.com/docs/agents/php-agent
+ * @see https://docs.newrelic.com/docs/accounts-partnerships/accounts/security/high-security
+ */
+class NewRelicHandler extends AbstractProcessingHandler
+{
+ /**
+ * Name of the New Relic application that will receive logs from this handler.
+ *
+ * @var string
+ */
+ protected $appName;
+
+ /**
+ * Name of the current transaction
+ *
+ * @var string
+ */
+ protected $transactionName;
+
+ /**
+ * Some context and extra data is passed into the handler as arrays of values. Do we send them as is
+ * (useful if we are using the API), or explode them for display on the NewRelic RPM website?
+ *
+ * @var bool
+ */
+ protected $explodeArrays;
+
+ /**
+ * {@inheritDoc}
+ *
+ * @param string $appName
+ * @param bool $explodeArrays
+ * @param string $transactionName
+ */
+ public function __construct(
+ $level = Logger::ERROR,
+ $bubble = true,
+ $appName = null,
+ $explodeArrays = false,
+ $transactionName = null
+ ) {
+ parent::__construct($level, $bubble);
+
+ $this->appName = $appName;
+ $this->explodeArrays = $explodeArrays;
+ $this->transactionName = $transactionName;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ if (!$this->isNewRelicEnabled()) {
+ throw new MissingExtensionException('The newrelic PHP extension is required to use the NewRelicHandler');
+ }
+
+ if ($appName = $this->getAppName($record['context'])) {
+ $this->setNewRelicAppName($appName);
+ }
+
+ if ($transactionName = $this->getTransactionName($record['context'])) {
+ $this->setNewRelicTransactionName($transactionName);
+ unset($record['formatted']['context']['transaction_name']);
+ }
+
+ if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+ newrelic_notice_error($record['message'], $record['context']['exception']);
+ unset($record['formatted']['context']['exception']);
+ } else {
+ newrelic_notice_error($record['message']);
+ }
+
+ foreach ($record['formatted']['context'] as $key => $parameter) {
+ if (is_array($parameter) && $this->explodeArrays) {
+ foreach ($parameter as $paramKey => $paramValue) {
+ $this->setNewRelicParameter('context_' . $key . '_' . $paramKey, $paramValue);
+ }
+ } else {
+ $this->setNewRelicParameter('context_' . $key, $parameter);
+ }
+ }
+
+ foreach ($record['formatted']['extra'] as $key => $parameter) {
+ if (is_array($parameter) && $this->explodeArrays) {
+ foreach ($parameter as $paramKey => $paramValue) {
+ $this->setNewRelicParameter('extra_' . $key . '_' . $paramKey, $paramValue);
+ }
+ } else {
+ $this->setNewRelicParameter('extra_' . $key, $parameter);
+ }
+ }
+ }
+
+ /**
+ * Checks whether the NewRelic extension is enabled in the system.
+ *
+ * @return bool
+ */
+ protected function isNewRelicEnabled()
+ {
+ return extension_loaded('newrelic');
+ }
+
+ /**
+ * Returns the appname where this log should be sent. Each log can override the default appname, set in this
+ * handler's constructor, by providing the appname in it's context.
+ *
+ * @param array $context
+ * @return null|string
+ */
+ protected function getAppName(array $context)
+ {
+ if (isset($context['appname'])) {
+ return $context['appname'];
+ }
+
+ return $this->appName;
+ }
+
+ /**
+ * Returns the name of the current transaction. Each log can override the default transaction name, set in this
+ * handler's constructor, by providing the transaction_name in it's context
+ *
+ * @param array $context
+ *
+ * @return null|string
+ */
+ protected function getTransactionName(array $context)
+ {
+ if (isset($context['transaction_name'])) {
+ return $context['transaction_name'];
+ }
+
+ return $this->transactionName;
+ }
+
+ /**
+ * Sets the NewRelic application that should receive this log.
+ *
+ * @param string $appName
+ */
+ protected function setNewRelicAppName($appName)
+ {
+ newrelic_set_appname($appName);
+ }
+
+ /**
+ * Overwrites the name of the current transaction
+ *
+ * @param string $transactionName
+ */
+ protected function setNewRelicTransactionName($transactionName)
+ {
+ newrelic_name_transaction($transactionName);
+ }
+
+ /**
+ * @param string $key
+ * @param mixed $value
+ */
+ protected function setNewRelicParameter($key, $value)
+ {
+ if (null === $value || is_scalar($value)) {
+ newrelic_add_custom_parameter($key, $value);
+ } else {
+ newrelic_add_custom_parameter($key, @json_encode($value));
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new NormalizerFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php
new file mode 100644
index 0000000..4b84588
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php
@@ -0,0 +1,45 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Blackhole
+ *
+ * Any record it can handle will be thrown away. This can be used
+ * to put on top of an existing stack to override it temporarily.
+ *
+ * @author Jordi Boggiano
+ */
+class NullHandler extends AbstractHandler
+{
+ /**
+ * @param int $level The minimum logging level at which this handler will be triggered
+ */
+ public function __construct($level = Logger::DEBUG)
+ {
+ parent::__construct($level, false);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($record['level'] < $this->level) {
+ return false;
+ }
+
+ return true;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PHPConsoleHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PHPConsoleHandler.php
new file mode 100644
index 0000000..1f2076a
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/PHPConsoleHandler.php
@@ -0,0 +1,242 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Exception;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+use PhpConsole\Connector;
+use PhpConsole\Handler;
+use PhpConsole\Helper;
+
+/**
+ * Monolog handler for Google Chrome extension "PHP Console"
+ *
+ * Display PHP error/debug log messages in Google Chrome console and notification popups, executes PHP code remotely
+ *
+ * Usage:
+ * 1. Install Google Chrome extension https://chrome.google.com/webstore/detail/php-console/nfhmhhlpfleoednkpnnnkolmclajemef
+ * 2. See overview https://github.com/barbushin/php-console#overview
+ * 3. Install PHP Console library https://github.com/barbushin/php-console#installation
+ * 4. Example (result will looks like http://i.hizliresim.com/vg3Pz4.png)
+ *
+ * $logger = new \Monolog\Logger('all', array(new \Monolog\Handler\PHPConsoleHandler()));
+ * \Monolog\ErrorHandler::register($logger);
+ * echo $undefinedVar;
+ * $logger->addDebug('SELECT * FROM users', array('db', 'time' => 0.012));
+ * PC::debug($_SERVER); // PHP Console debugger for any type of vars
+ *
+ * @author Sergey Barbushin https://www.linkedin.com/in/barbushin
+ */
+class PHPConsoleHandler extends AbstractProcessingHandler
+{
+ private $options = array(
+ 'enabled' => true, // bool Is PHP Console server enabled
+ 'classesPartialsTraceIgnore' => array('Monolog\\'), // array Hide calls of classes started with...
+ 'debugTagsKeysInContext' => array(0, 'tag'), // bool Is PHP Console server enabled
+ 'useOwnErrorsHandler' => false, // bool Enable errors handling
+ 'useOwnExceptionsHandler' => false, // bool Enable exceptions handling
+ 'sourcesBasePath' => null, // string Base path of all project sources to strip in errors source paths
+ 'registerHelper' => true, // bool Register PhpConsole\Helper that allows short debug calls like PC::debug($var, 'ta.g.s')
+ 'serverEncoding' => null, // string|null Server internal encoding
+ 'headersLimit' => null, // int|null Set headers size limit for your web-server
+ 'password' => null, // string|null Protect PHP Console connection by password
+ 'enableSslOnlyMode' => false, // bool Force connection by SSL for clients with PHP Console installed
+ 'ipMasks' => array(), // array Set IP masks of clients that will be allowed to connect to PHP Console: array('192.168.*.*', '127.0.0.1')
+ 'enableEvalListener' => false, // bool Enable eval request to be handled by eval dispatcher(if enabled, 'password' option is also required)
+ 'dumperDetectCallbacks' => false, // bool Convert callback items in dumper vars to (callback SomeClass::someMethod) strings
+ 'dumperLevelLimit' => 5, // int Maximum dumped vars array or object nested dump level
+ 'dumperItemsCountLimit' => 100, // int Maximum dumped var same level array items or object properties number
+ 'dumperItemSizeLimit' => 5000, // int Maximum length of any string or dumped array item
+ 'dumperDumpSizeLimit' => 500000, // int Maximum approximate size of dumped vars result formatted in JSON
+ 'detectDumpTraceAndSource' => false, // bool Autodetect and append trace data to debug
+ 'dataStorage' => null, // PhpConsole\Storage|null Fixes problem with custom $_SESSION handler(see http://goo.gl/Ne8juJ)
+ );
+
+ /** @var Connector */
+ private $connector;
+
+ /**
+ * @param array $options See \Monolog\Handler\PHPConsoleHandler::$options for more details
+ * @param Connector|null $connector Instance of \PhpConsole\Connector class (optional)
+ * @param int $level
+ * @param bool $bubble
+ * @throws Exception
+ */
+ public function __construct(array $options = array(), Connector $connector = null, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!class_exists('PhpConsole\Connector')) {
+ throw new Exception('PHP Console library not found. See https://github.com/barbushin/php-console#installation');
+ }
+ parent::__construct($level, $bubble);
+ $this->options = $this->initOptions($options);
+ $this->connector = $this->initConnector($connector);
+ }
+
+ private function initOptions(array $options)
+ {
+ $wrongOptions = array_diff(array_keys($options), array_keys($this->options));
+ if ($wrongOptions) {
+ throw new Exception('Unknown options: ' . implode(', ', $wrongOptions));
+ }
+
+ return array_replace($this->options, $options);
+ }
+
+ private function initConnector(Connector $connector = null)
+ {
+ if (!$connector) {
+ if ($this->options['dataStorage']) {
+ Connector::setPostponeStorage($this->options['dataStorage']);
+ }
+ $connector = Connector::getInstance();
+ }
+
+ if ($this->options['registerHelper'] && !Helper::isRegistered()) {
+ Helper::register();
+ }
+
+ if ($this->options['enabled'] && $connector->isActiveClient()) {
+ if ($this->options['useOwnErrorsHandler'] || $this->options['useOwnExceptionsHandler']) {
+ $handler = Handler::getInstance();
+ $handler->setHandleErrors($this->options['useOwnErrorsHandler']);
+ $handler->setHandleExceptions($this->options['useOwnExceptionsHandler']);
+ $handler->start();
+ }
+ if ($this->options['sourcesBasePath']) {
+ $connector->setSourcesBasePath($this->options['sourcesBasePath']);
+ }
+ if ($this->options['serverEncoding']) {
+ $connector->setServerEncoding($this->options['serverEncoding']);
+ }
+ if ($this->options['password']) {
+ $connector->setPassword($this->options['password']);
+ }
+ if ($this->options['enableSslOnlyMode']) {
+ $connector->enableSslOnlyMode();
+ }
+ if ($this->options['ipMasks']) {
+ $connector->setAllowedIpMasks($this->options['ipMasks']);
+ }
+ if ($this->options['headersLimit']) {
+ $connector->setHeadersLimit($this->options['headersLimit']);
+ }
+ if ($this->options['detectDumpTraceAndSource']) {
+ $connector->getDebugDispatcher()->detectTraceAndSource = true;
+ }
+ $dumper = $connector->getDumper();
+ $dumper->levelLimit = $this->options['dumperLevelLimit'];
+ $dumper->itemsCountLimit = $this->options['dumperItemsCountLimit'];
+ $dumper->itemSizeLimit = $this->options['dumperItemSizeLimit'];
+ $dumper->dumpSizeLimit = $this->options['dumperDumpSizeLimit'];
+ $dumper->detectCallbacks = $this->options['dumperDetectCallbacks'];
+ if ($this->options['enableEvalListener']) {
+ $connector->startEvalRequestsListener();
+ }
+ }
+
+ return $connector;
+ }
+
+ public function getConnector()
+ {
+ return $this->connector;
+ }
+
+ public function getOptions()
+ {
+ return $this->options;
+ }
+
+ public function handle(array $record)
+ {
+ if ($this->options['enabled'] && $this->connector->isActiveClient()) {
+ return parent::handle($record);
+ }
+
+ return !$this->bubble;
+ }
+
+ /**
+ * Writes the record down to the log of the implementing handler
+ *
+ * @param array $record
+ * @return void
+ */
+ protected function write(array $record)
+ {
+ if ($record['level'] < Logger::NOTICE) {
+ $this->handleDebugRecord($record);
+ } elseif (isset($record['context']['exception']) && $record['context']['exception'] instanceof Exception) {
+ $this->handleExceptionRecord($record);
+ } else {
+ $this->handleErrorRecord($record);
+ }
+ }
+
+ private function handleDebugRecord(array $record)
+ {
+ $tags = $this->getRecordTags($record);
+ $message = $record['message'];
+ if ($record['context']) {
+ $message .= ' ' . json_encode($this->connector->getDumper()->dump(array_filter($record['context'])));
+ }
+ $this->connector->getDebugDispatcher()->dispatchDebug($message, $tags, $this->options['classesPartialsTraceIgnore']);
+ }
+
+ private function handleExceptionRecord(array $record)
+ {
+ $this->connector->getErrorsDispatcher()->dispatchException($record['context']['exception']);
+ }
+
+ private function handleErrorRecord(array $record)
+ {
+ $context = $record['context'];
+
+ $this->connector->getErrorsDispatcher()->dispatchError(
+ isset($context['code']) ? $context['code'] : null,
+ isset($context['message']) ? $context['message'] : $record['message'],
+ isset($context['file']) ? $context['file'] : null,
+ isset($context['line']) ? $context['line'] : null,
+ $this->options['classesPartialsTraceIgnore']
+ );
+ }
+
+ private function getRecordTags(array &$record)
+ {
+ $tags = null;
+ if (!empty($record['context'])) {
+ $context = & $record['context'];
+ foreach ($this->options['debugTagsKeysInContext'] as $key) {
+ if (!empty($context[$key])) {
+ $tags = $context[$key];
+ if ($key === 0) {
+ array_shift($context);
+ } else {
+ unset($context[$key]);
+ }
+ break;
+ }
+ }
+ }
+
+ return $tags ?: strtolower($record['level_name']);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('%message%');
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php
new file mode 100644
index 0000000..1ae8584
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php
@@ -0,0 +1,56 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Psr\Log\LoggerInterface;
+
+/**
+ * Proxies log messages to an existing PSR-3 compliant logger.
+ *
+ * @author Michael Moussa
+ */
+class PsrHandler extends AbstractHandler
+{
+ /**
+ * PSR-3 compliant logger
+ *
+ * @var LoggerInterface
+ */
+ protected $logger;
+
+ /**
+ * @param LoggerInterface $logger The underlying PSR-3 compliant logger to which messages will be proxied
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(LoggerInterface $logger, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ $this->logger = $logger;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public function handle(array $record)
+ {
+ if (!$this->isHandling($record)) {
+ return false;
+ }
+
+ $this->logger->log(strtolower($record['level_name']), $record['message'], $record['context']);
+
+ return false === $this->bubble;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php
new file mode 100644
index 0000000..bba7200
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php
@@ -0,0 +1,185 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the pushover api to mobile phones
+ *
+ * @author Sebastian Göttschkes
+ * @see https://www.pushover.net/api
+ */
+class PushoverHandler extends SocketHandler
+{
+ private $token;
+ private $users;
+ private $title;
+ private $user;
+ private $retry;
+ private $expire;
+
+ private $highPriorityLevel;
+ private $emergencyLevel;
+ private $useFormattedMessage = false;
+
+ /**
+ * All parameters that can be sent to Pushover
+ * @see https://pushover.net/api
+ * @var array
+ */
+ private $parameterNames = array(
+ 'token' => true,
+ 'user' => true,
+ 'message' => true,
+ 'device' => true,
+ 'title' => true,
+ 'url' => true,
+ 'url_title' => true,
+ 'priority' => true,
+ 'timestamp' => true,
+ 'sound' => true,
+ 'retry' => true,
+ 'expire' => true,
+ 'callback' => true,
+ );
+
+ /**
+ * Sounds the api supports by default
+ * @see https://pushover.net/api#sounds
+ * @var array
+ */
+ private $sounds = array(
+ 'pushover', 'bike', 'bugle', 'cashregister', 'classical', 'cosmic', 'falling', 'gamelan', 'incoming',
+ 'intermission', 'magic', 'mechanical', 'pianobar', 'siren', 'spacealarm', 'tugboat', 'alien', 'climb',
+ 'persistent', 'echo', 'updown', 'none',
+ );
+
+ /**
+ * @param string $token Pushover api token
+ * @param string|array $users Pushover user id or array of ids the message will be sent to
+ * @param string $title Title sent to the Pushover API
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $useSSL Whether to connect via SSL. Required when pushing messages to users that are not
+ * the pushover.net app owner. OpenSSL is required for this option.
+ * @param int $highPriorityLevel The minimum logging level at which this handler will start
+ * sending "high priority" requests to the Pushover API
+ * @param int $emergencyLevel The minimum logging level at which this handler will start
+ * sending "emergency" requests to the Pushover API
+ * @param int $retry The retry parameter specifies how often (in seconds) the Pushover servers will send the same notification to the user.
+ * @param int $expire The expire parameter specifies how many seconds your notification will continue to be retried for (every retry seconds).
+ */
+ public function __construct($token, $users, $title = null, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $highPriorityLevel = Logger::CRITICAL, $emergencyLevel = Logger::EMERGENCY, $retry = 30, $expire = 25200)
+ {
+ $connectionString = $useSSL ? 'ssl://api.pushover.net:443' : 'api.pushover.net:80';
+ parent::__construct($connectionString, $level, $bubble);
+
+ $this->token = $token;
+ $this->users = (array) $users;
+ $this->title = $title ?: gethostname();
+ $this->highPriorityLevel = Logger::toMonologLevel($highPriorityLevel);
+ $this->emergencyLevel = Logger::toMonologLevel($emergencyLevel);
+ $this->retry = $retry;
+ $this->expire = $expire;
+ }
+
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ private function buildContent($record)
+ {
+ // Pushover has a limit of 512 characters on title and message combined.
+ $maxMessageLength = 512 - strlen($this->title);
+
+ $message = ($this->useFormattedMessage) ? $record['formatted'] : $record['message'];
+ $message = substr($message, 0, $maxMessageLength);
+
+ $timestamp = $record['datetime']->getTimestamp();
+
+ $dataArray = array(
+ 'token' => $this->token,
+ 'user' => $this->user,
+ 'message' => $message,
+ 'title' => $this->title,
+ 'timestamp' => $timestamp,
+ );
+
+ if (isset($record['level']) && $record['level'] >= $this->emergencyLevel) {
+ $dataArray['priority'] = 2;
+ $dataArray['retry'] = $this->retry;
+ $dataArray['expire'] = $this->expire;
+ } elseif (isset($record['level']) && $record['level'] >= $this->highPriorityLevel) {
+ $dataArray['priority'] = 1;
+ }
+
+ // First determine the available parameters
+ $context = array_intersect_key($record['context'], $this->parameterNames);
+ $extra = array_intersect_key($record['extra'], $this->parameterNames);
+
+ // Least important info should be merged with subsequent info
+ $dataArray = array_merge($extra, $context, $dataArray);
+
+ // Only pass sounds that are supported by the API
+ if (isset($dataArray['sound']) && !in_array($dataArray['sound'], $this->sounds)) {
+ unset($dataArray['sound']);
+ }
+
+ return http_build_query($dataArray);
+ }
+
+ private function buildHeader($content)
+ {
+ $header = "POST /1/messages.json HTTP/1.1\r\n";
+ $header .= "Host: api.pushover.net\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ protected function write(array $record)
+ {
+ foreach ($this->users as $user) {
+ $this->user = $user;
+
+ parent::write($record);
+ $this->closeSocket();
+ }
+
+ $this->user = null;
+ }
+
+ public function setHighPriorityLevel($value)
+ {
+ $this->highPriorityLevel = $value;
+ }
+
+ public function setEmergencyLevel($value)
+ {
+ $this->emergencyLevel = $value;
+ }
+
+ /**
+ * Use the formatted message?
+ * @param bool $value
+ */
+ public function useFormattedMessage($value)
+ {
+ $this->useFormattedMessage = (boolean) $value;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php
new file mode 100644
index 0000000..9075827
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php
@@ -0,0 +1,231 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Logger;
+use Raven_Client;
+
+/**
+ * Handler to send messages to a Sentry (https://github.com/getsentry/sentry) server
+ * using raven-php (https://github.com/getsentry/raven-php)
+ *
+ * @author Marc Abramowitz
+ */
+class RavenHandler extends AbstractProcessingHandler
+{
+ /**
+ * Translates Monolog log levels to Raven log levels.
+ */
+ private $logLevels = array(
+ Logger::DEBUG => Raven_Client::DEBUG,
+ Logger::INFO => Raven_Client::INFO,
+ Logger::NOTICE => Raven_Client::INFO,
+ Logger::WARNING => Raven_Client::WARNING,
+ Logger::ERROR => Raven_Client::ERROR,
+ Logger::CRITICAL => Raven_Client::FATAL,
+ Logger::ALERT => Raven_Client::FATAL,
+ Logger::EMERGENCY => Raven_Client::FATAL,
+ );
+
+ /**
+ * @var string should represent the current version of the calling
+ * software. Can be any string (git commit, version number)
+ */
+ private $release;
+
+ /**
+ * @var Raven_Client the client object that sends the message to the server
+ */
+ protected $ravenClient;
+
+ /**
+ * @var LineFormatter The formatter to use for the logs generated via handleBatch()
+ */
+ protected $batchFormatter;
+
+ /**
+ * @param Raven_Client $ravenClient
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(Raven_Client $ravenClient, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ $this->ravenClient = $ravenClient;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $level = $this->level;
+
+ // filter records based on their level
+ $records = array_filter($records, function ($record) use ($level) {
+ return $record['level'] >= $level;
+ });
+
+ if (!$records) {
+ return;
+ }
+
+ // the record with the highest severity is the "main" one
+ $record = array_reduce($records, function ($highest, $record) {
+ if ($record['level'] >= $highest['level']) {
+ return $record;
+ }
+
+ return $highest;
+ });
+
+ // the other ones are added as a context item
+ $logs = array();
+ foreach ($records as $r) {
+ $logs[] = $this->processRecord($r);
+ }
+
+ if ($logs) {
+ $record['context']['logs'] = (string) $this->getBatchFormatter()->formatBatch($logs);
+ }
+
+ $this->handle($record);
+ }
+
+ /**
+ * Sets the formatter for the logs generated by handleBatch().
+ *
+ * @param FormatterInterface $formatter
+ */
+ public function setBatchFormatter(FormatterInterface $formatter)
+ {
+ $this->batchFormatter = $formatter;
+ }
+
+ /**
+ * Gets the formatter for the logs generated by handleBatch().
+ *
+ * @return FormatterInterface
+ */
+ public function getBatchFormatter()
+ {
+ if (!$this->batchFormatter) {
+ $this->batchFormatter = $this->getDefaultBatchFormatter();
+ }
+
+ return $this->batchFormatter;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $previousUserContext = false;
+ $options = array();
+ $options['level'] = $this->logLevels[$record['level']];
+ $options['tags'] = array();
+ if (!empty($record['extra']['tags'])) {
+ $options['tags'] = array_merge($options['tags'], $record['extra']['tags']);
+ unset($record['extra']['tags']);
+ }
+ if (!empty($record['context']['tags'])) {
+ $options['tags'] = array_merge($options['tags'], $record['context']['tags']);
+ unset($record['context']['tags']);
+ }
+ if (!empty($record['context']['fingerprint'])) {
+ $options['fingerprint'] = $record['context']['fingerprint'];
+ unset($record['context']['fingerprint']);
+ }
+ if (!empty($record['context']['logger'])) {
+ $options['logger'] = $record['context']['logger'];
+ unset($record['context']['logger']);
+ } else {
+ $options['logger'] = $record['channel'];
+ }
+ foreach ($this->getExtraParameters() as $key) {
+ foreach (array('extra', 'context') as $source) {
+ if (!empty($record[$source][$key])) {
+ $options[$key] = $record[$source][$key];
+ unset($record[$source][$key]);
+ }
+ }
+ }
+ if (!empty($record['context'])) {
+ $options['extra']['context'] = $record['context'];
+ if (!empty($record['context']['user'])) {
+ $previousUserContext = $this->ravenClient->context->user;
+ $this->ravenClient->user_context($record['context']['user']);
+ unset($options['extra']['context']['user']);
+ }
+ }
+ if (!empty($record['extra'])) {
+ $options['extra']['extra'] = $record['extra'];
+ }
+
+ if (!empty($this->release) && !isset($options['release'])) {
+ $options['release'] = $this->release;
+ }
+
+ if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+ $options['extra']['message'] = $record['formatted'];
+ $this->ravenClient->captureException($record['context']['exception'], $options);
+ } else {
+ $this->ravenClient->captureMessage($record['formatted'], array(), $options);
+ }
+
+ if ($previousUserContext !== false) {
+ $this->ravenClient->user_context($previousUserContext);
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('[%channel%] %message%');
+ }
+
+ /**
+ * Gets the default formatter for the logs generated by handleBatch().
+ *
+ * @return FormatterInterface
+ */
+ protected function getDefaultBatchFormatter()
+ {
+ return new LineFormatter();
+ }
+
+ /**
+ * Gets extra parameters supported by Raven that can be found in "extra" and "context"
+ *
+ * @return array
+ */
+ protected function getExtraParameters()
+ {
+ return array('checksum', 'release');
+ }
+
+ /**
+ * @param string $value
+ */
+ public function setRelease($value)
+ {
+ $this->release = $value;
+
+ return $this;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php
new file mode 100644
index 0000000..590f996
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php
@@ -0,0 +1,97 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+
+/**
+ * Logs to a Redis key using rpush
+ *
+ * usage example:
+ *
+ * $log = new Logger('application');
+ * $redis = new RedisHandler(new Predis\Client("tcp://localhost:6379"), "logs", "prod");
+ * $log->pushHandler($redis);
+ *
+ * @author Thomas Tourlourat
+ */
+class RedisHandler extends AbstractProcessingHandler
+{
+ private $redisClient;
+ private $redisKey;
+ protected $capSize;
+
+ /**
+ * @param \Predis\Client|\Redis $redis The redis instance
+ * @param string $key The key name to push records to
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int $capSize Number of entries to limit list size to
+ */
+ public function __construct($redis, $key, $level = Logger::DEBUG, $bubble = true, $capSize = false)
+ {
+ if (!(($redis instanceof \Predis\Client) || ($redis instanceof \Redis))) {
+ throw new \InvalidArgumentException('Predis\Client or Redis instance required');
+ }
+
+ $this->redisClient = $redis;
+ $this->redisKey = $key;
+ $this->capSize = $capSize;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ if ($this->capSize) {
+ $this->writeCapped($record);
+ } else {
+ $this->redisClient->rpush($this->redisKey, $record["formatted"]);
+ }
+ }
+
+ /**
+ * Write and cap the collection
+ * Writes the record to the redis list and caps its
+ *
+ * @param array $record associative record array
+ * @return void
+ */
+ protected function writeCapped(array $record)
+ {
+ if ($this->redisClient instanceof \Redis) {
+ $this->redisClient->multi()
+ ->rpush($this->redisKey, $record["formatted"])
+ ->ltrim($this->redisKey, -$this->capSize, -1)
+ ->exec();
+ } else {
+ $redisKey = $this->redisKey;
+ $capSize = $this->capSize;
+ $this->redisClient->transaction(function ($tx) use ($record, $redisKey, $capSize) {
+ $tx->rpush($redisKey, $record["formatted"]);
+ $tx->ltrim($redisKey, -$capSize, -1);
+ });
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php
new file mode 100644
index 0000000..e11d464
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php
@@ -0,0 +1,106 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use RollbarNotifier;
+use Exception;
+use Monolog\Logger;
+
+/**
+ * Sends errors to Rollbar
+ *
+ * If the context data contains a `payload` key, that is used as an array
+ * of payload options to RollbarNotifier's report_message/report_exception methods.
+ *
+ * @author Paul Statezny
+ */
+class RollbarHandler extends AbstractProcessingHandler
+{
+ /**
+ * Rollbar notifier
+ *
+ * @var RollbarNotifier
+ */
+ protected $rollbarNotifier;
+
+ /**
+ * Records whether any log records have been added since the last flush of the rollbar notifier
+ *
+ * @var bool
+ */
+ private $hasRecords = false;
+
+ /**
+ * @param RollbarNotifier $rollbarNotifier RollbarNotifier object constructed with valid token
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(RollbarNotifier $rollbarNotifier, $level = Logger::ERROR, $bubble = true)
+ {
+ $this->rollbarNotifier = $rollbarNotifier;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if (isset($record['context']['exception']) && $record['context']['exception'] instanceof Exception) {
+ $context = $record['context'];
+ $exception = $context['exception'];
+ unset($context['exception']);
+
+ $payload = array();
+ if (isset($context['payload'])) {
+ $payload = $context['payload'];
+ unset($context['payload']);
+ }
+
+ $this->rollbarNotifier->report_exception($exception, $context, $payload);
+ } else {
+ $extraData = array(
+ 'level' => $record['level'],
+ 'channel' => $record['channel'],
+ 'datetime' => $record['datetime']->format('U'),
+ );
+
+ $context = $record['context'];
+ $payload = array();
+ if (isset($context['payload'])) {
+ $payload = $context['payload'];
+ unset($context['payload']);
+ }
+
+ $this->rollbarNotifier->report_message(
+ $record['message'],
+ $record['level_name'],
+ array_merge($record['context'], $record['extra'], $extraData),
+ $payload
+ );
+ }
+
+ $this->hasRecords = true;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ if ($this->hasRecords) {
+ $this->rollbarNotifier->flush();
+ $this->hasRecords = false;
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php
new file mode 100644
index 0000000..22e6c3d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php
@@ -0,0 +1,159 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores logs to files that are rotated every day and a limited number of files are kept.
+ *
+ * This rotation is only intended to be used as a workaround. Using logrotate to
+ * handle the rotation is strongly encouraged when you can use it.
+ *
+ * @author Christophe Coevoet
+ * @author Jordi Boggiano
+ */
+class RotatingFileHandler extends StreamHandler
+{
+ protected $filename;
+ protected $maxFiles;
+ protected $mustRotate;
+ protected $nextRotation;
+ protected $filenameFormat;
+ protected $dateFormat;
+
+ /**
+ * @param string $filename
+ * @param int $maxFiles The maximal amount of files to keep (0 means unlimited)
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write)
+ * @param Boolean $useLocking Try to lock log file before doing any writes
+ */
+ public function __construct($filename, $maxFiles = 0, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false)
+ {
+ $this->filename = $filename;
+ $this->maxFiles = (int) $maxFiles;
+ $this->nextRotation = new \DateTime('tomorrow');
+ $this->filenameFormat = '{filename}-{date}';
+ $this->dateFormat = 'Y-m-d';
+
+ parent::__construct($this->getTimedFilename(), $level, $bubble, $filePermission, $useLocking);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ parent::close();
+
+ if (true === $this->mustRotate) {
+ $this->rotate();
+ }
+ }
+
+ public function setFilenameFormat($filenameFormat, $dateFormat)
+ {
+ $this->filenameFormat = $filenameFormat;
+ $this->dateFormat = $dateFormat;
+ $this->url = $this->getTimedFilename();
+ $this->close();
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ // on the first record written, if the log is new, we should rotate (once per day)
+ if (null === $this->mustRotate) {
+ $this->mustRotate = !file_exists($this->url);
+ }
+
+ if ($this->nextRotation < $record['datetime']) {
+ $this->mustRotate = true;
+ $this->close();
+ }
+
+ parent::write($record);
+ }
+
+ /**
+ * Rotates the files.
+ */
+ protected function rotate()
+ {
+ // update filename
+ $this->url = $this->getTimedFilename();
+ $this->nextRotation = new \DateTime('tomorrow');
+
+ // skip GC of old logs if files are unlimited
+ if (0 === $this->maxFiles) {
+ return;
+ }
+
+ $logFiles = glob($this->getGlobPattern());
+ if ($this->maxFiles >= count($logFiles)) {
+ // no files to remove
+ return;
+ }
+
+ // Sorting the files by name to remove the older ones
+ usort($logFiles, function ($a, $b) {
+ return strcmp($b, $a);
+ });
+
+ foreach (array_slice($logFiles, $this->maxFiles) as $file) {
+ if (is_writable($file)) {
+ // suppress errors here as unlink() might fail if two processes
+ // are cleaning up/rotating at the same time
+ set_error_handler(function ($errno, $errstr, $errfile, $errline) {});
+ unlink($file);
+ restore_error_handler();
+ }
+ }
+
+ $this->mustRotate = false;
+ }
+
+ protected function getTimedFilename()
+ {
+ $fileInfo = pathinfo($this->filename);
+ $timedFilename = str_replace(
+ array('{filename}', '{date}'),
+ array($fileInfo['filename'], date($this->dateFormat)),
+ $fileInfo['dirname'] . '/' . $this->filenameFormat
+ );
+
+ if (!empty($fileInfo['extension'])) {
+ $timedFilename .= '.'.$fileInfo['extension'];
+ }
+
+ return $timedFilename;
+ }
+
+ protected function getGlobPattern()
+ {
+ $fileInfo = pathinfo($this->filename);
+ $glob = str_replace(
+ array('{filename}', '{date}'),
+ array($fileInfo['filename'], '*'),
+ $fileInfo['dirname'] . '/' . $this->filenameFormat
+ );
+ if (!empty($fileInfo['extension'])) {
+ $glob .= '.'.$fileInfo['extension'];
+ }
+
+ return $glob;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php
new file mode 100644
index 0000000..9509ae3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php
@@ -0,0 +1,82 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Sampling handler
+ *
+ * A sampled event stream can be useful for logging high frequency events in
+ * a production environment where you only need an idea of what is happening
+ * and are not concerned with capturing every occurrence. Since the decision to
+ * handle or not handle a particular event is determined randomly, the
+ * resulting sampled log is not guaranteed to contain 1/N of the events that
+ * occurred in the application, but based on the Law of large numbers, it will
+ * tend to be close to this ratio with a large number of attempts.
+ *
+ * @author Bryan Davis
+ * @author Kunal Mehta
+ */
+class SamplingHandler extends AbstractHandler
+{
+ /**
+ * @var callable|HandlerInterface $handler
+ */
+ protected $handler;
+
+ /**
+ * @var int $factor
+ */
+ protected $factor;
+
+ /**
+ * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler).
+ * @param int $factor Sample factor
+ */
+ public function __construct($handler, $factor)
+ {
+ parent::__construct();
+ $this->handler = $handler;
+ $this->factor = $factor;
+
+ if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+ throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+ }
+ }
+
+ public function isHandling(array $record)
+ {
+ return $this->handler->isHandling($record);
+ }
+
+ public function handle(array $record)
+ {
+ if ($this->isHandling($record) && mt_rand(1, $this->factor) === 1) {
+ // The same logic as in FingersCrossedHandler
+ if (!$this->handler instanceof HandlerInterface) {
+ $this->handler = call_user_func($this->handler, $record, $this);
+ if (!$this->handler instanceof HandlerInterface) {
+ throw new \RuntimeException("The factory callable should return a HandlerInterface");
+ }
+ }
+
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ $this->handler->handle($record);
+ }
+
+ return false === $this->bubble;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php
new file mode 100644
index 0000000..ac2af02
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php
@@ -0,0 +1,289 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Sends notifications through Slack API
+ *
+ * @author Greg Kedzierski
+ * @see https://api.slack.com/
+ */
+class SlackHandler extends SocketHandler
+{
+ /**
+ * Slack API token
+ * @var string
+ */
+ private $token;
+
+ /**
+ * Slack channel (encoded ID or name)
+ * @var string
+ */
+ private $channel;
+
+ /**
+ * Name of a bot
+ * @var string
+ */
+ private $username;
+
+ /**
+ * Emoji icon name
+ * @var string
+ */
+ private $iconEmoji;
+
+ /**
+ * Whether the message should be added to Slack as attachment (plain text otherwise)
+ * @var bool
+ */
+ private $useAttachment;
+
+ /**
+ * Whether the the context/extra messages added to Slack as attachments are in a short style
+ * @var bool
+ */
+ private $useShortAttachment;
+
+ /**
+ * Whether the attachment should include context and extra data
+ * @var bool
+ */
+ private $includeContextAndExtra;
+
+ /**
+ * @var LineFormatter
+ */
+ private $lineFormatter;
+
+ /**
+ * @param string $token Slack API token
+ * @param string $channel Slack channel (encoded ID or name)
+ * @param string $username Name of a bot
+ * @param bool $useAttachment Whether the message should be added to Slack as attachment (plain text otherwise)
+ * @param string|null $iconEmoji The emoji name to use (or null)
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param bool $useShortAttachment Whether the the context/extra messages added to Slack as attachments are in a short style
+ * @param bool $includeContextAndExtra Whether the attachment should include context and extra data
+ * @throws MissingExtensionException If no OpenSSL PHP extension configured
+ */
+ public function __construct($token, $channel, $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $level = Logger::CRITICAL, $bubble = true, $useShortAttachment = false, $includeContextAndExtra = false)
+ {
+ if (!extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP extension is required to use the SlackHandler');
+ }
+
+ parent::__construct('ssl://slack.com:443', $level, $bubble);
+
+ $this->token = $token;
+ $this->channel = $channel;
+ $this->username = $username;
+ $this->iconEmoji = trim($iconEmoji, ':');
+ $this->useAttachment = $useAttachment;
+ $this->useShortAttachment = $useShortAttachment;
+ $this->includeContextAndExtra = $includeContextAndExtra;
+
+ if ($this->includeContextAndExtra && $this->useShortAttachment) {
+ $this->lineFormatter = new LineFormatter;
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ $dataArray = $this->prepareContentData($record);
+
+ return http_build_query($dataArray);
+ }
+
+ /**
+ * Prepares content data
+ *
+ * @param array $record
+ * @return array
+ */
+ protected function prepareContentData($record)
+ {
+ $dataArray = array(
+ 'token' => $this->token,
+ 'channel' => $this->channel,
+ 'username' => $this->username,
+ 'text' => '',
+ 'attachments' => array(),
+ );
+
+ if ($this->useAttachment) {
+ $attachment = array(
+ 'fallback' => $record['message'],
+ 'color' => $this->getAttachmentColor($record['level']),
+ 'fields' => array(),
+ );
+
+ if ($this->useShortAttachment) {
+ $attachment['title'] = $record['level_name'];
+ $attachment['text'] = $record['message'];
+ } else {
+ $attachment['title'] = 'Message';
+ $attachment['text'] = $record['message'];
+ $attachment['fields'][] = array(
+ 'title' => 'Level',
+ 'value' => $record['level_name'],
+ 'short' => true,
+ );
+ }
+
+ if ($this->includeContextAndExtra) {
+ if (!empty($record['extra'])) {
+ if ($this->useShortAttachment) {
+ $attachment['fields'][] = array(
+ 'title' => "Extra",
+ 'value' => $this->stringify($record['extra']),
+ 'short' => $this->useShortAttachment,
+ );
+ } else {
+ // Add all extra fields as individual fields in attachment
+ foreach ($record['extra'] as $var => $val) {
+ $attachment['fields'][] = array(
+ 'title' => $var,
+ 'value' => $val,
+ 'short' => $this->useShortAttachment,
+ );
+ }
+ }
+ }
+
+ if (!empty($record['context'])) {
+ if ($this->useShortAttachment) {
+ $attachment['fields'][] = array(
+ 'title' => "Context",
+ 'value' => $this->stringify($record['context']),
+ 'short' => $this->useShortAttachment,
+ );
+ } else {
+ // Add all context fields as individual fields in attachment
+ foreach ($record['context'] as $var => $val) {
+ $attachment['fields'][] = array(
+ 'title' => $var,
+ 'value' => $val,
+ 'short' => $this->useShortAttachment,
+ );
+ }
+ }
+ }
+ }
+
+ $dataArray['attachments'] = json_encode(array($attachment));
+ } else {
+ $dataArray['text'] = $record['message'];
+ }
+
+ if ($this->iconEmoji) {
+ $dataArray['icon_emoji'] = ":{$this->iconEmoji}:";
+ }
+
+ return $dataArray;
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ $header = "POST /api/chat.postMessage HTTP/1.1\r\n";
+ $header .= "Host: slack.com\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ parent::write($record);
+ $res = $this->getResource();
+ if (is_resource($res)) {
+ @fread($res, 2048);
+ }
+ $this->closeSocket();
+ }
+
+ /**
+ * Returned a Slack message attachment color associated with
+ * provided level.
+ *
+ * @param int $level
+ * @return string
+ */
+ protected function getAttachmentColor($level)
+ {
+ switch (true) {
+ case $level >= Logger::ERROR:
+ return 'danger';
+ case $level >= Logger::WARNING:
+ return 'warning';
+ case $level >= Logger::INFO:
+ return 'good';
+ default:
+ return '#e3e4e6';
+ }
+ }
+
+ /**
+ * Stringifies an array of key/value pairs to be used in attachment fields
+ *
+ * @param array $fields
+ * @return string
+ */
+ protected function stringify($fields)
+ {
+ $string = '';
+ foreach ($fields as $var => $val) {
+ $string .= $var.': '.$this->lineFormatter->stringify($val)." | ";
+ }
+
+ $string = rtrim($string, " |");
+
+ return $string;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php
new file mode 100644
index 0000000..7a61bf4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php
@@ -0,0 +1,346 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any socket - uses fsockopen() or pfsockopen().
+ *
+ * @author Pablo de Leon Belloc
+ * @see http://php.net/manual/en/function.fsockopen.php
+ */
+class SocketHandler extends AbstractProcessingHandler
+{
+ private $connectionString;
+ private $connectionTimeout;
+ private $resource;
+ private $timeout = 0;
+ private $writingTimeout = 10;
+ private $lastSentBytes = null;
+ private $persistent = false;
+ private $errno;
+ private $errstr;
+ private $lastWritingAt;
+
+ /**
+ * @param string $connectionString Socket connection string
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($connectionString, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+ $this->connectionString = $connectionString;
+ $this->connectionTimeout = (float) ini_get('default_socket_timeout');
+ }
+
+ /**
+ * Connect (if necessary) and write to the socket
+ *
+ * @param array $record
+ *
+ * @throws \UnexpectedValueException
+ * @throws \RuntimeException
+ */
+ protected function write(array $record)
+ {
+ $this->connectIfNotConnected();
+ $data = $this->generateDataStream($record);
+ $this->writeToSocket($data);
+ }
+
+ /**
+ * We will not close a PersistentSocket instance so it can be reused in other requests.
+ */
+ public function close()
+ {
+ if (!$this->isPersistent()) {
+ $this->closeSocket();
+ }
+ }
+
+ /**
+ * Close socket, if open
+ */
+ public function closeSocket()
+ {
+ if (is_resource($this->resource)) {
+ fclose($this->resource);
+ $this->resource = null;
+ }
+ }
+
+ /**
+ * Set socket connection to nbe persistent. It only has effect before the connection is initiated.
+ *
+ * @param bool $persistent
+ */
+ public function setPersistent($persistent)
+ {
+ $this->persistent = (boolean) $persistent;
+ }
+
+ /**
+ * Set connection timeout. Only has effect before we connect.
+ *
+ * @param float $seconds
+ *
+ * @see http://php.net/manual/en/function.fsockopen.php
+ */
+ public function setConnectionTimeout($seconds)
+ {
+ $this->validateTimeout($seconds);
+ $this->connectionTimeout = (float) $seconds;
+ }
+
+ /**
+ * Set write timeout. Only has effect before we connect.
+ *
+ * @param float $seconds
+ *
+ * @see http://php.net/manual/en/function.stream-set-timeout.php
+ */
+ public function setTimeout($seconds)
+ {
+ $this->validateTimeout($seconds);
+ $this->timeout = (float) $seconds;
+ }
+
+ /**
+ * Set writing timeout. Only has effect during connection in the writing cycle.
+ *
+ * @param float $seconds 0 for no timeout
+ */
+ public function setWritingTimeout($seconds)
+ {
+ $this->validateTimeout($seconds);
+ $this->writingTimeout = (float) $seconds;
+ }
+
+ /**
+ * Get current connection string
+ *
+ * @return string
+ */
+ public function getConnectionString()
+ {
+ return $this->connectionString;
+ }
+
+ /**
+ * Get persistent setting
+ *
+ * @return bool
+ */
+ public function isPersistent()
+ {
+ return $this->persistent;
+ }
+
+ /**
+ * Get current connection timeout setting
+ *
+ * @return float
+ */
+ public function getConnectionTimeout()
+ {
+ return $this->connectionTimeout;
+ }
+
+ /**
+ * Get current in-transfer timeout
+ *
+ * @return float
+ */
+ public function getTimeout()
+ {
+ return $this->timeout;
+ }
+
+ /**
+ * Get current local writing timeout
+ *
+ * @return float
+ */
+ public function getWritingTimeout()
+ {
+ return $this->writingTimeout;
+ }
+
+ /**
+ * Check to see if the socket is currently available.
+ *
+ * UDP might appear to be connected but might fail when writing. See http://php.net/fsockopen for details.
+ *
+ * @return bool
+ */
+ public function isConnected()
+ {
+ return is_resource($this->resource)
+ && !feof($this->resource); // on TCP - other party can close connection.
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function pfsockopen()
+ {
+ return @pfsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function fsockopen()
+ {
+ return @fsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ *
+ * @see http://php.net/manual/en/function.stream-set-timeout.php
+ */
+ protected function streamSetTimeout()
+ {
+ $seconds = floor($this->timeout);
+ $microseconds = round(($this->timeout - $seconds) * 1e6);
+
+ return stream_set_timeout($this->resource, $seconds, $microseconds);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function fwrite($data)
+ {
+ return @fwrite($this->resource, $data);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function streamGetMetadata()
+ {
+ return stream_get_meta_data($this->resource);
+ }
+
+ private function validateTimeout($value)
+ {
+ $ok = filter_var($value, FILTER_VALIDATE_FLOAT);
+ if ($ok === false || $value < 0) {
+ throw new \InvalidArgumentException("Timeout must be 0 or a positive float (got $value)");
+ }
+ }
+
+ private function connectIfNotConnected()
+ {
+ if ($this->isConnected()) {
+ return;
+ }
+ $this->connect();
+ }
+
+ protected function generateDataStream($record)
+ {
+ return (string) $record['formatted'];
+ }
+
+ /**
+ * @return resource|null
+ */
+ protected function getResource()
+ {
+ return $this->resource;
+ }
+
+ private function connect()
+ {
+ $this->createSocketResource();
+ $this->setSocketTimeout();
+ }
+
+ private function createSocketResource()
+ {
+ if ($this->isPersistent()) {
+ $resource = $this->pfsockopen();
+ } else {
+ $resource = $this->fsockopen();
+ }
+ if (!$resource) {
+ throw new \UnexpectedValueException("Failed connecting to $this->connectionString ($this->errno: $this->errstr)");
+ }
+ $this->resource = $resource;
+ }
+
+ private function setSocketTimeout()
+ {
+ if (!$this->streamSetTimeout()) {
+ throw new \UnexpectedValueException("Failed setting timeout with stream_set_timeout()");
+ }
+ }
+
+ private function writeToSocket($data)
+ {
+ $length = strlen($data);
+ $sent = 0;
+ $this->lastSentBytes = $sent;
+ while ($this->isConnected() && $sent < $length) {
+ if (0 == $sent) {
+ $chunk = $this->fwrite($data);
+ } else {
+ $chunk = $this->fwrite(substr($data, $sent));
+ }
+ if ($chunk === false) {
+ throw new \RuntimeException("Could not write to socket");
+ }
+ $sent += $chunk;
+ $socketInfo = $this->streamGetMetadata();
+ if ($socketInfo['timed_out']) {
+ throw new \RuntimeException("Write timed-out");
+ }
+
+ if ($this->writingIsTimedOut($sent)) {
+ throw new \RuntimeException("Write timed-out, no data sent for `{$this->writingTimeout}` seconds, probably we got disconnected (sent $sent of $length)");
+ }
+ }
+ if (!$this->isConnected() && $sent < $length) {
+ throw new \RuntimeException("End-of-file reached, probably we got disconnected (sent $sent of $length)");
+ }
+ }
+
+ private function writingIsTimedOut($sent)
+ {
+ $writingTimeout = (int) floor($this->writingTimeout);
+ if (0 === $writingTimeout) {
+ return false;
+ }
+
+ if ($sent !== $this->lastSentBytes) {
+ $this->lastWritingAt = time();
+ $this->lastSentBytes = $sent;
+
+ return false;
+ } else {
+ usleep(100);
+ }
+
+ if ((time() - $this->lastWritingAt) >= $writingTimeout) {
+ $this->closeSocket();
+
+ return true;
+ }
+
+ return false;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php
new file mode 100644
index 0000000..139356c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php
@@ -0,0 +1,156 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any stream resource
+ *
+ * Can be used to store into php://stderr, remote and local files, etc.
+ *
+ * @author Jordi Boggiano
+ */
+class StreamHandler extends AbstractProcessingHandler
+{
+ protected $stream;
+ protected $url;
+ private $errorMessage;
+ protected $filePermission;
+ protected $useLocking;
+ private $dirCreated;
+
+ /**
+ * @param resource|string $stream
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write)
+ * @param Boolean $useLocking Try to lock log file before doing any writes
+ *
+ * @throws \Exception If a missing directory is not buildable
+ * @throws \InvalidArgumentException If stream is not a resource or string
+ */
+ public function __construct($stream, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false)
+ {
+ parent::__construct($level, $bubble);
+ if (is_resource($stream)) {
+ $this->stream = $stream;
+ } elseif (is_string($stream)) {
+ $this->url = $stream;
+ } else {
+ throw new \InvalidArgumentException('A stream must either be a resource or a string.');
+ }
+
+ $this->filePermission = $filePermission;
+ $this->useLocking = $useLocking;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ if ($this->url && is_resource($this->stream)) {
+ fclose($this->stream);
+ }
+ $this->stream = null;
+ }
+
+ /**
+ * Return the currently active stream if it is open
+ *
+ * @return resource|null
+ */
+ public function getStream()
+ {
+ return $this->stream;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if (!is_resource($this->stream)) {
+ if (!$this->url) {
+ throw new \LogicException('Missing stream url, the stream can not be opened. This may be caused by a premature call to close().');
+ }
+ $this->createDir();
+ $this->errorMessage = null;
+ set_error_handler(array($this, 'customErrorHandler'));
+ $this->stream = fopen($this->url, 'a');
+ if ($this->filePermission !== null) {
+ @chmod($this->url, $this->filePermission);
+ }
+ restore_error_handler();
+ if (!is_resource($this->stream)) {
+ $this->stream = null;
+ throw new \UnexpectedValueException(sprintf('The stream or file "%s" could not be opened: '.$this->errorMessage, $this->url));
+ }
+ }
+
+ if ($this->useLocking) {
+ // ignoring errors here, there's not much we can do about them
+ flock($this->stream, LOCK_EX);
+ }
+
+ fwrite($this->stream, (string) $record['formatted']);
+
+ if ($this->useLocking) {
+ flock($this->stream, LOCK_UN);
+ }
+ }
+
+ private function customErrorHandler($code, $msg)
+ {
+ $this->errorMessage = preg_replace('{^(fopen|mkdir)\(.*?\): }', '', $msg);
+ }
+
+ /**
+ * @param string $stream
+ *
+ * @return null|string
+ */
+ private function getDirFromStream($stream)
+ {
+ $pos = strpos($stream, '://');
+ if ($pos === false) {
+ return dirname($stream);
+ }
+
+ if ('file://' === substr($stream, 0, 7)) {
+ return dirname(substr($stream, 7));
+ }
+
+ return;
+ }
+
+ private function createDir()
+ {
+ // Do not try to create dir if it has already been tried.
+ if ($this->dirCreated) {
+ return;
+ }
+
+ $dir = $this->getDirFromStream($this->url);
+ if (null !== $dir && !is_dir($dir)) {
+ $this->errorMessage = null;
+ set_error_handler(array($this, 'customErrorHandler'));
+ $status = mkdir($dir, 0777, true);
+ restore_error_handler();
+ if (false === $status) {
+ throw new \UnexpectedValueException(sprintf('There is no existing directory at "%s" and its not buildable: '.$this->errorMessage, $dir));
+ }
+ }
+ $this->dirCreated = true;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php
new file mode 100644
index 0000000..aba1396
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php
@@ -0,0 +1,94 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * SwiftMailerHandler uses Swift_Mailer to send the emails
+ *
+ * @author Gyula Sallai
+ */
+class SwiftMailerHandler extends MailHandler
+{
+ protected $mailer;
+ private $messageTemplate;
+
+ /**
+ * @param \Swift_Mailer $mailer The mailer to use
+ * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(\Swift_Mailer $mailer, $message, $level = Logger::ERROR, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ $this->mailer = $mailer;
+ $this->messageTemplate = $message;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function send($content, array $records)
+ {
+ $this->mailer->send($this->buildMessage($content, $records));
+ }
+
+ /**
+ * Creates instance of Swift_Message to be sent
+ *
+ * @param string $content formatted email body to be sent
+ * @param array $records Log records that formed the content
+ * @return \Swift_Message
+ */
+ protected function buildMessage($content, array $records)
+ {
+ $message = null;
+ if ($this->messageTemplate instanceof \Swift_Message) {
+ $message = clone $this->messageTemplate;
+ $message->generateId();
+ } elseif (is_callable($this->messageTemplate)) {
+ $message = call_user_func($this->messageTemplate, $content, $records);
+ }
+
+ if (!$message instanceof \Swift_Message) {
+ throw new \InvalidArgumentException('Could not resolve message as instance of Swift_Message or a callable returning it');
+ }
+
+ if ($records) {
+ $subjectFormatter = new LineFormatter($message->getSubject());
+ $message->setSubject($subjectFormatter->format($this->getHighestRecord($records)));
+ }
+
+ $message->setBody($content);
+ $message->setDate(time());
+
+ return $message;
+ }
+
+ /**
+ * BC getter, to be removed in 2.0
+ */
+ public function __get($name)
+ {
+ if ($name === 'message') {
+ trigger_error('SwiftMailerHandler->message is deprecated, use ->buildMessage() instead to retrieve the message', E_USER_DEPRECATED);
+
+ return $this->buildMessage(null, array());
+ }
+
+ throw new \InvalidArgumentException('Invalid property '.$name);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php
new file mode 100644
index 0000000..376bc3b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php
@@ -0,0 +1,67 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to syslog service.
+ *
+ * usage example:
+ *
+ * $log = new Logger('application');
+ * $syslog = new SyslogHandler('myfacility', 'local6');
+ * $formatter = new LineFormatter("%channel%.%level_name%: %message% %extra%");
+ * $syslog->setFormatter($formatter);
+ * $log->pushHandler($syslog);
+ *
+ * @author Sven Paulus
+ */
+class SyslogHandler extends AbstractSyslogHandler
+{
+ protected $ident;
+ protected $logopts;
+
+ /**
+ * @param string $ident
+ * @param mixed $facility
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int $logopts Option flags for the openlog() call, defaults to LOG_PID
+ */
+ public function __construct($ident, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true, $logopts = LOG_PID)
+ {
+ parent::__construct($facility, $level, $bubble);
+
+ $this->ident = $ident;
+ $this->logopts = $logopts;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ closelog();
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if (!openlog($this->ident, $this->logopts, $this->facility)) {
+ throw new \LogicException('Can\'t open syslog for ident "'.$this->ident.'" and facility "'.$this->facility.'"');
+ }
+ syslog($this->logLevels[$record['level']], (string) $record['formatted']);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php
new file mode 100644
index 0000000..3bff085
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php
@@ -0,0 +1,56 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\SyslogUdp;
+
+class UdpSocket
+{
+ const DATAGRAM_MAX_LENGTH = 65023;
+
+ protected $ip;
+ protected $port;
+ protected $socket;
+
+ public function __construct($ip, $port = 514)
+ {
+ $this->ip = $ip;
+ $this->port = $port;
+ $this->socket = socket_create(AF_INET, SOCK_DGRAM, SOL_UDP);
+ }
+
+ public function write($line, $header = "")
+ {
+ $this->send($this->assembleMessage($line, $header));
+ }
+
+ public function close()
+ {
+ if (is_resource($this->socket)) {
+ socket_close($this->socket);
+ $this->socket = null;
+ }
+ }
+
+ protected function send($chunk)
+ {
+ if (!is_resource($this->socket)) {
+ throw new \LogicException('The UdpSocket to '.$this->ip.':'.$this->port.' has been closed and can not be written to anymore');
+ }
+ socket_sendto($this->socket, $chunk, strlen($chunk), $flags = 0, $this->ip, $this->port);
+ }
+
+ protected function assembleMessage($line, $header)
+ {
+ $chunkSize = self::DATAGRAM_MAX_LENGTH - strlen($header);
+
+ return $header . substr($line, 0, $chunkSize);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php
new file mode 100644
index 0000000..b175cc3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php
@@ -0,0 +1,82 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Handler\SyslogUdp\UdpSocket;
+
+/**
+ * A Handler for logging to a remote syslogd server.
+ *
+ * @author Jesper Skovgaard Nielsen
+ */
+class SyslogUdpHandler extends AbstractSyslogHandler
+{
+ protected $socket;
+
+ /**
+ * @param string $host
+ * @param int $port
+ * @param mixed $facility
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($host, $port = 514, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($facility, $level, $bubble);
+
+ $this->socket = new UdpSocket($host, $port ?: 514);
+ }
+
+ protected function write(array $record)
+ {
+ $lines = $this->splitMessageIntoLines($record['formatted']);
+
+ $header = $this->makeCommonSyslogHeader($this->logLevels[$record['level']]);
+
+ foreach ($lines as $line) {
+ $this->socket->write($line, $header);
+ }
+ }
+
+ public function close()
+ {
+ $this->socket->close();
+ }
+
+ private function splitMessageIntoLines($message)
+ {
+ if (is_array($message)) {
+ $message = implode("\n", $message);
+ }
+
+ return preg_split('/$\R?^/m', $message);
+ }
+
+ /**
+ * Make common syslog header (see rfc5424)
+ */
+ protected function makeCommonSyslogHeader($severity)
+ {
+ $priority = $severity + $this->facility;
+
+ return "<$priority>1 ";
+ }
+
+ /**
+ * Inject your own socket, mainly used for testing
+ */
+ public function setSocket($socket)
+ {
+ $this->socket = $socket;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php
new file mode 100644
index 0000000..458020b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php
@@ -0,0 +1,154 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Used for testing purposes.
+ *
+ * It records all records and gives you access to them for verification.
+ *
+ * @author Jordi Boggiano
+ *
+ * @method bool hasEmergency($record)
+ * @method bool hasAlert($record)
+ * @method bool hasCritical($record)
+ * @method bool hasError($record)
+ * @method bool hasWarning($record)
+ * @method bool hasNotice($record)
+ * @method bool hasInfo($record)
+ * @method bool hasDebug($record)
+ *
+ * @method bool hasEmergencyRecords()
+ * @method bool hasAlertRecords()
+ * @method bool hasCriticalRecords()
+ * @method bool hasErrorRecords()
+ * @method bool hasWarningRecords()
+ * @method bool hasNoticeRecords()
+ * @method bool hasInfoRecords()
+ * @method bool hasDebugRecords()
+ *
+ * @method bool hasEmergencyThatContains($message)
+ * @method bool hasAlertThatContains($message)
+ * @method bool hasCriticalThatContains($message)
+ * @method bool hasErrorThatContains($message)
+ * @method bool hasWarningThatContains($message)
+ * @method bool hasNoticeThatContains($message)
+ * @method bool hasInfoThatContains($message)
+ * @method bool hasDebugThatContains($message)
+ *
+ * @method bool hasEmergencyThatMatches($message)
+ * @method bool hasAlertThatMatches($message)
+ * @method bool hasCriticalThatMatches($message)
+ * @method bool hasErrorThatMatches($message)
+ * @method bool hasWarningThatMatches($message)
+ * @method bool hasNoticeThatMatches($message)
+ * @method bool hasInfoThatMatches($message)
+ * @method bool hasDebugThatMatches($message)
+ *
+ * @method bool hasEmergencyThatPasses($message)
+ * @method bool hasAlertThatPasses($message)
+ * @method bool hasCriticalThatPasses($message)
+ * @method bool hasErrorThatPasses($message)
+ * @method bool hasWarningThatPasses($message)
+ * @method bool hasNoticeThatPasses($message)
+ * @method bool hasInfoThatPasses($message)
+ * @method bool hasDebugThatPasses($message)
+ */
+class TestHandler extends AbstractProcessingHandler
+{
+ protected $records = array();
+ protected $recordsByLevel = array();
+
+ public function getRecords()
+ {
+ return $this->records;
+ }
+
+ public function clear()
+ {
+ $this->records = array();
+ $this->recordsByLevel = array();
+ }
+
+ protected function hasRecordRecords($level)
+ {
+ return isset($this->recordsByLevel[$level]);
+ }
+
+ protected function hasRecord($record, $level)
+ {
+ if (is_array($record)) {
+ $record = $record['message'];
+ }
+
+ return $this->hasRecordThatPasses(function ($rec) use ($record) {
+ return $rec['message'] === $record;
+ }, $level);
+ }
+
+ public function hasRecordThatContains($message, $level)
+ {
+ return $this->hasRecordThatPasses(function ($rec) use ($message) {
+ return strpos($rec['message'], $message) !== false;
+ }, $level);
+ }
+
+ public function hasRecordThatMatches($regex, $level)
+ {
+ return $this->hasRecordThatPasses(function ($rec) use ($regex) {
+ return preg_match($regex, $rec['message']) > 0;
+ }, $level);
+ }
+
+ public function hasRecordThatPasses($predicate, $level)
+ {
+ if (!is_callable($predicate)) {
+ throw new \InvalidArgumentException("Expected a callable for hasRecordThatSucceeds");
+ }
+
+ if (!isset($this->recordsByLevel[$level])) {
+ return false;
+ }
+
+ foreach ($this->recordsByLevel[$level] as $i => $rec) {
+ if (call_user_func($predicate, $rec, $i)) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->recordsByLevel[$record['level']][] = $record;
+ $this->records[] = $record;
+ }
+
+ public function __call($method, $args)
+ {
+ if (preg_match('/(.*)(Debug|Info|Notice|Warning|Error|Critical|Alert|Emergency)(.*)/', $method, $matches) > 0) {
+ $genericMethod = $matches[1] . 'Record' . $matches[3];
+ $level = constant('Monolog\Logger::' . strtoupper($matches[2]));
+ if (method_exists($this, $genericMethod)) {
+ $args[] = $level;
+
+ return call_user_func_array(array($this, $genericMethod), $args);
+ }
+ }
+
+ throw new \BadMethodCallException('Call to undefined method ' . get_class($this) . '::' . $method . '()');
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php
new file mode 100644
index 0000000..05a8817
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php
@@ -0,0 +1,57 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Forwards records to multiple handlers suppressing failures of each handler
+ * and continuing through to give every handler a chance to succeed.
+ *
+ * @author Craig D'Amelio
+ */
+class WhatFailureGroupHandler extends GroupHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ foreach ($this->handlers as $handler) {
+ try {
+ $handler->handle($record);
+ } catch (\Exception $e) {
+ // What failure?
+ }
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ foreach ($this->handlers as $handler) {
+ try {
+ $handler->handleBatch($records);
+ } catch (\Exception $e) {
+ // What failure?
+ }
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php
new file mode 100644
index 0000000..f22cf21
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php
@@ -0,0 +1,95 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to Zend Monitor
+ *
+ * @author Christian Bergau
+ */
+class ZendMonitorHandler extends AbstractProcessingHandler
+{
+ /**
+ * Monolog level / ZendMonitor Custom Event priority map
+ *
+ * @var array
+ */
+ protected $levelMap = array(
+ Logger::DEBUG => 1,
+ Logger::INFO => 2,
+ Logger::NOTICE => 3,
+ Logger::WARNING => 4,
+ Logger::ERROR => 5,
+ Logger::CRITICAL => 6,
+ Logger::ALERT => 7,
+ Logger::EMERGENCY => 0,
+ );
+
+ /**
+ * Construct
+ *
+ * @param int $level
+ * @param bool $bubble
+ * @throws MissingExtensionException
+ */
+ public function __construct($level = Logger::DEBUG, $bubble = true)
+ {
+ if (!function_exists('zend_monitor_custom_event')) {
+ throw new MissingExtensionException('You must have Zend Server installed in order to use this handler');
+ }
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->writeZendMonitorCustomEvent(
+ $this->levelMap[$record['level']],
+ $record['message'],
+ $record['formatted']
+ );
+ }
+
+ /**
+ * Write a record to Zend Monitor
+ *
+ * @param int $level
+ * @param string $message
+ * @param array $formatted
+ */
+ protected function writeZendMonitorCustomEvent($level, $message, $formatted)
+ {
+ zend_monitor_custom_event($level, $message, $formatted);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function getDefaultFormatter()
+ {
+ return new NormalizerFormatter();
+ }
+
+ /**
+ * Get the level map
+ *
+ * @return array
+ */
+ public function getLevelMap()
+ {
+ return $this->levelMap;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Logger.php b/vendor/monolog/monolog/src/Monolog/Logger.php
new file mode 100644
index 0000000..2fbc02c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Logger.php
@@ -0,0 +1,699 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\HandlerInterface;
+use Monolog\Handler\StreamHandler;
+use Psr\Log\LoggerInterface;
+use Psr\Log\InvalidArgumentException;
+
+/**
+ * Monolog log channel
+ *
+ * It contains a stack of Handlers and a stack of Processors,
+ * and uses them to store records that are added to it.
+ *
+ * @author Jordi Boggiano
+ */
+class Logger implements LoggerInterface
+{
+ /**
+ * Detailed debug information
+ */
+ const DEBUG = 100;
+
+ /**
+ * Interesting events
+ *
+ * Examples: User logs in, SQL logs.
+ */
+ const INFO = 200;
+
+ /**
+ * Uncommon events
+ */
+ const NOTICE = 250;
+
+ /**
+ * Exceptional occurrences that are not errors
+ *
+ * Examples: Use of deprecated APIs, poor use of an API,
+ * undesirable things that are not necessarily wrong.
+ */
+ const WARNING = 300;
+
+ /**
+ * Runtime errors
+ */
+ const ERROR = 400;
+
+ /**
+ * Critical conditions
+ *
+ * Example: Application component unavailable, unexpected exception.
+ */
+ const CRITICAL = 500;
+
+ /**
+ * Action must be taken immediately
+ *
+ * Example: Entire website down, database unavailable, etc.
+ * This should trigger the SMS alerts and wake you up.
+ */
+ const ALERT = 550;
+
+ /**
+ * Urgent alert.
+ */
+ const EMERGENCY = 600;
+
+ /**
+ * Monolog API version
+ *
+ * This is only bumped when API breaks are done and should
+ * follow the major version of the library
+ *
+ * @var int
+ */
+ const API = 1;
+
+ /**
+ * Logging levels from syslog protocol defined in RFC 5424
+ *
+ * @var array $levels Logging levels
+ */
+ protected static $levels = array(
+ self::DEBUG => 'DEBUG',
+ self::INFO => 'INFO',
+ self::NOTICE => 'NOTICE',
+ self::WARNING => 'WARNING',
+ self::ERROR => 'ERROR',
+ self::CRITICAL => 'CRITICAL',
+ self::ALERT => 'ALERT',
+ self::EMERGENCY => 'EMERGENCY',
+ );
+
+ /**
+ * @var \DateTimeZone
+ */
+ protected static $timezone;
+
+ /**
+ * @var string
+ */
+ protected $name;
+
+ /**
+ * The handler stack
+ *
+ * @var HandlerInterface[]
+ */
+ protected $handlers;
+
+ /**
+ * Processors that will process all log records
+ *
+ * To process records of a single handler instead, add the processor on that specific handler
+ *
+ * @var callable[]
+ */
+ protected $processors;
+
+ /**
+ * @var bool
+ */
+ protected $microsecondTimestamps = true;
+
+ /**
+ * @param string $name The logging channel
+ * @param HandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc.
+ * @param callable[] $processors Optional array of processors
+ */
+ public function __construct($name, array $handlers = array(), array $processors = array())
+ {
+ $this->name = $name;
+ $this->handlers = $handlers;
+ $this->processors = $processors;
+ }
+
+ /**
+ * @return string
+ */
+ public function getName()
+ {
+ return $this->name;
+ }
+
+ /**
+ * Return a new cloned instance with the name changed
+ *
+ * @return static
+ */
+ public function withName($name)
+ {
+ $new = clone $this;
+ $new->name = $name;
+
+ return $new;
+ }
+
+ /**
+ * Pushes a handler on to the stack.
+ *
+ * @param HandlerInterface $handler
+ * @return $this
+ */
+ public function pushHandler(HandlerInterface $handler)
+ {
+ array_unshift($this->handlers, $handler);
+
+ return $this;
+ }
+
+ /**
+ * Pops a handler from the stack
+ *
+ * @return HandlerInterface
+ */
+ public function popHandler()
+ {
+ if (!$this->handlers) {
+ throw new \LogicException('You tried to pop from an empty handler stack.');
+ }
+
+ return array_shift($this->handlers);
+ }
+
+ /**
+ * Set handlers, replacing all existing ones.
+ *
+ * If a map is passed, keys will be ignored.
+ *
+ * @param HandlerInterface[] $handlers
+ * @return $this
+ */
+ public function setHandlers(array $handlers)
+ {
+ $this->handlers = array();
+ foreach (array_reverse($handlers) as $handler) {
+ $this->pushHandler($handler);
+ }
+
+ return $this;
+ }
+
+ /**
+ * @return HandlerInterface[]
+ */
+ public function getHandlers()
+ {
+ return $this->handlers;
+ }
+
+ /**
+ * Adds a processor on to the stack.
+ *
+ * @param callable $callback
+ * @return $this
+ */
+ public function pushProcessor($callback)
+ {
+ if (!is_callable($callback)) {
+ throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+ }
+ array_unshift($this->processors, $callback);
+
+ return $this;
+ }
+
+ /**
+ * Removes the processor on top of the stack and returns it.
+ *
+ * @return callable
+ */
+ public function popProcessor()
+ {
+ if (!$this->processors) {
+ throw new \LogicException('You tried to pop from an empty processor stack.');
+ }
+
+ return array_shift($this->processors);
+ }
+
+ /**
+ * @return callable[]
+ */
+ public function getProcessors()
+ {
+ return $this->processors;
+ }
+
+ /**
+ * Control the use of microsecond resolution timestamps in the 'datetime'
+ * member of new records.
+ *
+ * Generating microsecond resolution timestamps by calling
+ * microtime(true), formatting the result via sprintf() and then parsing
+ * the resulting string via \DateTime::createFromFormat() can incur
+ * a measurable runtime overhead vs simple usage of DateTime to capture
+ * a second resolution timestamp in systems which generate a large number
+ * of log events.
+ *
+ * @param bool $micro True to use microtime() to create timestamps
+ */
+ public function useMicrosecondTimestamps($micro)
+ {
+ $this->microsecondTimestamps = (bool) $micro;
+ }
+
+ /**
+ * Adds a log record.
+ *
+ * @param int $level The logging level
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addRecord($level, $message, array $context = array())
+ {
+ if (!$this->handlers) {
+ $this->pushHandler(new StreamHandler('php://stderr', static::DEBUG));
+ }
+
+ $levelName = static::getLevelName($level);
+
+ // check if any handler will handle this message so we can return early and save cycles
+ $handlerKey = null;
+ reset($this->handlers);
+ while ($handler = current($this->handlers)) {
+ if ($handler->isHandling(array('level' => $level))) {
+ $handlerKey = key($this->handlers);
+ break;
+ }
+
+ next($this->handlers);
+ }
+
+ if (null === $handlerKey) {
+ return false;
+ }
+
+ if (!static::$timezone) {
+ static::$timezone = new \DateTimeZone(date_default_timezone_get() ?: 'UTC');
+ }
+
+ if ($this->microsecondTimestamps) {
+ $ts = \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true)), static::$timezone);
+ } else {
+ $ts = new \DateTime(null, static::$timezone);
+ }
+ $ts->setTimezone(static::$timezone);
+
+ $record = array(
+ 'message' => (string) $message,
+ 'context' => $context,
+ 'level' => $level,
+ 'level_name' => $levelName,
+ 'channel' => $this->name,
+ 'datetime' => $ts,
+ 'extra' => array(),
+ );
+
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+
+ while ($handler = current($this->handlers)) {
+ if (true === $handler->handle($record)) {
+ break;
+ }
+
+ next($this->handlers);
+ }
+
+ return true;
+ }
+
+ /**
+ * Adds a log record at the DEBUG level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addDebug($message, array $context = array())
+ {
+ return $this->addRecord(static::DEBUG, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the INFO level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addInfo($message, array $context = array())
+ {
+ return $this->addRecord(static::INFO, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the NOTICE level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addNotice($message, array $context = array())
+ {
+ return $this->addRecord(static::NOTICE, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the WARNING level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addWarning($message, array $context = array())
+ {
+ return $this->addRecord(static::WARNING, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ERROR level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addError($message, array $context = array())
+ {
+ return $this->addRecord(static::ERROR, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the CRITICAL level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addCritical($message, array $context = array())
+ {
+ return $this->addRecord(static::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ALERT level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addAlert($message, array $context = array())
+ {
+ return $this->addRecord(static::ALERT, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the EMERGENCY level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addEmergency($message, array $context = array())
+ {
+ return $this->addRecord(static::EMERGENCY, $message, $context);
+ }
+
+ /**
+ * Gets all supported logging levels.
+ *
+ * @return array Assoc array with human-readable level names => level codes.
+ */
+ public static function getLevels()
+ {
+ return array_flip(static::$levels);
+ }
+
+ /**
+ * Gets the name of the logging level.
+ *
+ * @param int $level
+ * @return string
+ */
+ public static function getLevelName($level)
+ {
+ if (!isset(static::$levels[$level])) {
+ throw new InvalidArgumentException('Level "'.$level.'" is not defined, use one of: '.implode(', ', array_keys(static::$levels)));
+ }
+
+ return static::$levels[$level];
+ }
+
+ /**
+ * Converts PSR-3 levels to Monolog ones if necessary
+ *
+ * @param string|int Level number (monolog) or name (PSR-3)
+ * @return int
+ */
+ public static function toMonologLevel($level)
+ {
+ if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) {
+ return constant(__CLASS__.'::'.strtoupper($level));
+ }
+
+ return $level;
+ }
+
+ /**
+ * Checks whether the Logger has a handler that listens on the given level
+ *
+ * @param int $level
+ * @return Boolean
+ */
+ public function isHandling($level)
+ {
+ $record = array(
+ 'level' => $level,
+ );
+
+ foreach ($this->handlers as $handler) {
+ if ($handler->isHandling($record)) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * Adds a log record at an arbitrary level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param mixed $level The log level
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function log($level, $message, array $context = array())
+ {
+ $level = static::toMonologLevel($level);
+
+ return $this->addRecord($level, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the DEBUG level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function debug($message, array $context = array())
+ {
+ return $this->addRecord(static::DEBUG, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the INFO level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function info($message, array $context = array())
+ {
+ return $this->addRecord(static::INFO, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the NOTICE level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function notice($message, array $context = array())
+ {
+ return $this->addRecord(static::NOTICE, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the WARNING level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function warn($message, array $context = array())
+ {
+ return $this->addRecord(static::WARNING, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the WARNING level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function warning($message, array $context = array())
+ {
+ return $this->addRecord(static::WARNING, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ERROR level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function err($message, array $context = array())
+ {
+ return $this->addRecord(static::ERROR, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ERROR level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function error($message, array $context = array())
+ {
+ return $this->addRecord(static::ERROR, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the CRITICAL level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function crit($message, array $context = array())
+ {
+ return $this->addRecord(static::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the CRITICAL level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function critical($message, array $context = array())
+ {
+ return $this->addRecord(static::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ALERT level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function alert($message, array $context = array())
+ {
+ return $this->addRecord(static::ALERT, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the EMERGENCY level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function emerg($message, array $context = array())
+ {
+ return $this->addRecord(static::EMERGENCY, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the EMERGENCY level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function emergency($message, array $context = array())
+ {
+ return $this->addRecord(static::EMERGENCY, $message, $context);
+ }
+
+ /**
+ * Set the timezone to be used for the timestamp of log records.
+ *
+ * This is stored globally for all Logger instances
+ *
+ * @param \DateTimeZone $tz Timezone object
+ */
+ public static function setTimezone(\DateTimeZone $tz)
+ {
+ self::$timezone = $tz;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php
new file mode 100644
index 0000000..1899400
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php
@@ -0,0 +1,64 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+
+/**
+ * Injects Git branch and Git commit SHA in all records
+ *
+ * @author Nick Otter
+ * @author Jordi Boggiano
+ */
+class GitProcessor
+{
+ private $level;
+ private static $cache;
+
+ public function __construct($level = Logger::DEBUG)
+ {
+ $this->level = Logger::toMonologLevel($level);
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ // return if the level is not high enough
+ if ($record['level'] < $this->level) {
+ return $record;
+ }
+
+ $record['extra']['git'] = self::getGitInfo();
+
+ return $record;
+ }
+
+ private static function getGitInfo()
+ {
+ if (self::$cache) {
+ return self::$cache;
+ }
+
+ $branches = `git branch -v --no-abbrev`;
+ if (preg_match('{^\* (.+?)\s+([a-f0-9]{40})(?:\s|$)}m', $branches, $matches)) {
+ return self::$cache = array(
+ 'branch' => $matches[1],
+ 'commit' => $matches[2],
+ );
+ }
+
+ return self::$cache = array();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php
new file mode 100644
index 0000000..2691630
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php
@@ -0,0 +1,107 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+
+/**
+ * Injects line/file:class/function where the log message came from
+ *
+ * Warning: This only works if the handler processes the logs directly.
+ * If you put the processor on a handler that is behind a FingersCrossedHandler
+ * for example, the processor will only be called once the trigger level is reached,
+ * and all the log records will have the same file/line/.. data from the call that
+ * triggered the FingersCrossedHandler.
+ *
+ * @author Jordi Boggiano
+ */
+class IntrospectionProcessor
+{
+ private $level;
+
+ private $skipClassesPartials;
+
+ private $skipStackFramesCount;
+
+ private $skipFunctions = array(
+ 'call_user_func',
+ 'call_user_func_array',
+ );
+
+ public function __construct($level = Logger::DEBUG, array $skipClassesPartials = array(), $skipStackFramesCount = 0)
+ {
+ $this->level = Logger::toMonologLevel($level);
+ $this->skipClassesPartials = array_merge(array('Monolog\\'), $skipClassesPartials);
+ $this->skipStackFramesCount = $skipStackFramesCount;
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ // return if the level is not high enough
+ if ($record['level'] < $this->level) {
+ return $record;
+ }
+
+ $trace = debug_backtrace(DEBUG_BACKTRACE_IGNORE_ARGS);
+
+ // skip first since it's always the current method
+ array_shift($trace);
+ // the call_user_func call is also skipped
+ array_shift($trace);
+
+ $i = 0;
+
+ while ($this->isTraceClassOrSkippedFunction($trace, $i)) {
+ if (isset($trace[$i]['class'])) {
+ foreach ($this->skipClassesPartials as $part) {
+ if (strpos($trace[$i]['class'], $part) !== false) {
+ $i++;
+ continue 2;
+ }
+ }
+ } elseif (in_array($trace[$i]['function'], $this->skipFunctions)) {
+ $i++;
+ continue;
+ }
+
+ break;
+ }
+
+ $i += $this->skipStackFramesCount;
+
+ // we should have the call source now
+ $record['extra'] = array_merge(
+ $record['extra'],
+ array(
+ 'file' => isset($trace[$i - 1]['file']) ? $trace[$i - 1]['file'] : null,
+ 'line' => isset($trace[$i - 1]['line']) ? $trace[$i - 1]['line'] : null,
+ 'class' => isset($trace[$i]['class']) ? $trace[$i]['class'] : null,
+ 'function' => isset($trace[$i]['function']) ? $trace[$i]['function'] : null,
+ )
+ );
+
+ return $record;
+ }
+
+ private function isTraceClassOrSkippedFunction(array $trace, $index)
+ {
+ if (!isset($trace[$index])) {
+ return false;
+ }
+
+ return isset($trace[$index]['class']) || in_array($trace[$index]['function'], $this->skipFunctions);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php
new file mode 100644
index 0000000..0543e92
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php
@@ -0,0 +1,35 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_peak_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryPeakUsageProcessor extends MemoryProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ $bytes = memory_get_peak_usage($this->realUsage);
+ $formatted = $this->formatBytes($bytes);
+
+ $record['extra']['memory_peak_usage'] = $formatted;
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php
new file mode 100644
index 0000000..85f9dc5
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php
@@ -0,0 +1,63 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Some methods that are common for all memory processors
+ *
+ * @author Rob Jensen
+ */
+abstract class MemoryProcessor
+{
+ /**
+ * @var bool If true, get the real size of memory allocated from system. Else, only the memory used by emalloc() is reported.
+ */
+ protected $realUsage;
+
+ /**
+ * @var bool If true, then format memory size to human readable string (MB, KB, B depending on size)
+ */
+ protected $useFormatting;
+
+ /**
+ * @param bool $realUsage Set this to true to get the real size of memory allocated from system.
+ * @param bool $useFormatting If true, then format memory size to human readable string (MB, KB, B depending on size)
+ */
+ public function __construct($realUsage = true, $useFormatting = true)
+ {
+ $this->realUsage = (boolean) $realUsage;
+ $this->useFormatting = (boolean) $useFormatting;
+ }
+
+ /**
+ * Formats bytes into a human readable string if $this->useFormatting is true, otherwise return $bytes as is
+ *
+ * @param int $bytes
+ * @return string|int Formatted string if $this->useFormatting is true, otherwise return $bytes as is
+ */
+ protected function formatBytes($bytes)
+ {
+ $bytes = (int) $bytes;
+
+ if (!$this->useFormatting) {
+ return $bytes;
+ }
+
+ if ($bytes > 1024 * 1024) {
+ return round($bytes / 1024 / 1024, 2).' MB';
+ } elseif ($bytes > 1024) {
+ return round($bytes / 1024, 2).' KB';
+ }
+
+ return $bytes . ' B';
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php
new file mode 100644
index 0000000..2783d65
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php
@@ -0,0 +1,35 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryUsageProcessor extends MemoryProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ $bytes = memory_get_usage($this->realUsage);
+ $formatted = $this->formatBytes($bytes);
+
+ $record['extra']['memory_usage'] = $formatted;
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php
new file mode 100644
index 0000000..9d3f559
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php
@@ -0,0 +1,31 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds value of getmypid into records
+ *
+ * @author Andreas Hörnicke
+ */
+class ProcessIdProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ $record['extra']['process_id'] = getmypid();
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php
new file mode 100644
index 0000000..c2686ce
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php
@@ -0,0 +1,48 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Processes a record's message according to PSR-3 rules
+ *
+ * It replaces {foo} with the value from $context['foo']
+ *
+ * @author Jordi Boggiano
+ */
+class PsrLogMessageProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ if (false === strpos($record['message'], '{')) {
+ return $record;
+ }
+
+ $replacements = array();
+ foreach ($record['context'] as $key => $val) {
+ if (is_null($val) || is_scalar($val) || (is_object($val) && method_exists($val, "__toString"))) {
+ $replacements['{'.$key.'}'] = $val;
+ } elseif (is_object($val)) {
+ $replacements['{'.$key.'}'] = '[object '.get_class($val).']';
+ } else {
+ $replacements['{'.$key.'}'] = '['.gettype($val).']';
+ }
+ }
+
+ $record['message'] = strtr($record['message'], $replacements);
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php
new file mode 100644
index 0000000..7e2df2a
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php
@@ -0,0 +1,44 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds a tags array into record
+ *
+ * @author Martijn Riemers
+ */
+class TagProcessor
+{
+ private $tags;
+
+ public function __construct(array $tags = array())
+ {
+ $this->setTags($tags);
+ }
+
+ public function addTags(array $tags = array())
+ {
+ $this->tags = array_merge($this->tags, $tags);
+ }
+
+ public function setTags(array $tags = array())
+ {
+ $this->tags = $tags;
+ }
+
+ public function __invoke(array $record)
+ {
+ $record['extra']['tags'] = $this->tags;
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php
new file mode 100644
index 0000000..812707c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php
@@ -0,0 +1,46 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds a unique identifier into records
+ *
+ * @author Simon Mönch
+ */
+class UidProcessor
+{
+ private $uid;
+
+ public function __construct($length = 7)
+ {
+ if (!is_int($length) || $length > 32 || $length < 1) {
+ throw new \InvalidArgumentException('The uid length must be an integer between 1 and 32');
+ }
+
+ $this->uid = substr(hash('md5', uniqid('', true)), 0, $length);
+ }
+
+ public function __invoke(array $record)
+ {
+ $record['extra']['uid'] = $this->uid;
+
+ return $record;
+ }
+
+ /**
+ * @return string
+ */
+ public function getUid()
+ {
+ return $this->uid;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php
new file mode 100644
index 0000000..ea1d897
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php
@@ -0,0 +1,113 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects url/method and remote IP of the current web request in all records
+ *
+ * @author Jordi Boggiano
+ */
+class WebProcessor
+{
+ /**
+ * @var array|\ArrayAccess
+ */
+ protected $serverData;
+
+ /**
+ * Default fields
+ *
+ * Array is structured as [key in record.extra => key in $serverData]
+ *
+ * @var array
+ */
+ protected $extraFields = array(
+ 'url' => 'REQUEST_URI',
+ 'ip' => 'REMOTE_ADDR',
+ 'http_method' => 'REQUEST_METHOD',
+ 'server' => 'SERVER_NAME',
+ 'referrer' => 'HTTP_REFERER',
+ );
+
+ /**
+ * @param array|\ArrayAccess $serverData Array or object w/ ArrayAccess that provides access to the $_SERVER data
+ * @param array|null $extraFields Field names and the related key inside $serverData to be added. If not provided it defaults to: url, ip, http_method, server, referrer
+ */
+ public function __construct($serverData = null, array $extraFields = null)
+ {
+ if (null === $serverData) {
+ $this->serverData = &$_SERVER;
+ } elseif (is_array($serverData) || $serverData instanceof \ArrayAccess) {
+ $this->serverData = $serverData;
+ } else {
+ throw new \UnexpectedValueException('$serverData must be an array or object implementing ArrayAccess.');
+ }
+
+ if (null !== $extraFields) {
+ if (isset($extraFields[0])) {
+ foreach (array_keys($this->extraFields) as $fieldName) {
+ if (!in_array($fieldName, $extraFields)) {
+ unset($this->extraFields[$fieldName]);
+ }
+ }
+ } else {
+ $this->extraFields = $extraFields;
+ }
+ }
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ // skip processing if for some reason request data
+ // is not present (CLI or wonky SAPIs)
+ if (!isset($this->serverData['REQUEST_URI'])) {
+ return $record;
+ }
+
+ $record['extra'] = $this->appendExtraFields($record['extra']);
+
+ return $record;
+ }
+
+ /**
+ * @param string $extraName
+ * @param string $serverName
+ * @return $this
+ */
+ public function addExtraField($extraName, $serverName)
+ {
+ $this->extraFields[$extraName] = $serverName;
+
+ return $this;
+ }
+
+ /**
+ * @param array $extra
+ * @return array
+ */
+ private function appendExtraFields(array $extra)
+ {
+ foreach ($this->extraFields as $extraName => $serverName) {
+ $extra[$extraName] = isset($this->serverData[$serverName]) ? $this->serverData[$serverName] : null;
+ }
+
+ if (isset($this->serverData['UNIQUE_ID'])) {
+ $extra['unique_id'] = $this->serverData['UNIQUE_ID'];
+ }
+
+ return $extra;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Registry.php b/vendor/monolog/monolog/src/Monolog/Registry.php
new file mode 100644
index 0000000..159b751
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Registry.php
@@ -0,0 +1,134 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use InvalidArgumentException;
+
+/**
+ * Monolog log registry
+ *
+ * Allows to get `Logger` instances in the global scope
+ * via static method calls on this class.
+ *
+ *
+ * $application = new Monolog\Logger('application');
+ * $api = new Monolog\Logger('api');
+ *
+ * Monolog\Registry::addLogger($application);
+ * Monolog\Registry::addLogger($api);
+ *
+ * function testLogger()
+ * {
+ * Monolog\Registry::api()->addError('Sent to $api Logger instance');
+ * Monolog\Registry::application()->addError('Sent to $application Logger instance');
+ * }
+ *
+ *
+ * @author Tomas Tatarko
+ */
+class Registry
+{
+ /**
+ * List of all loggers in the registry (by named indexes)
+ *
+ * @var Logger[]
+ */
+ private static $loggers = array();
+
+ /**
+ * Adds new logging channel to the registry
+ *
+ * @param Logger $logger Instance of the logging channel
+ * @param string|null $name Name of the logging channel ($logger->getName() by default)
+ * @param bool $overwrite Overwrite instance in the registry if the given name already exists?
+ * @throws \InvalidArgumentException If $overwrite set to false and named Logger instance already exists
+ */
+ public static function addLogger(Logger $logger, $name = null, $overwrite = false)
+ {
+ $name = $name ?: $logger->getName();
+
+ if (isset(self::$loggers[$name]) && !$overwrite) {
+ throw new InvalidArgumentException('Logger with the given name already exists');
+ }
+
+ self::$loggers[$name] = $logger;
+ }
+
+ /**
+ * Checks if such logging channel exists by name or instance
+ *
+ * @param string|Logger $logger Name or logger instance
+ */
+ public static function hasLogger($logger)
+ {
+ if ($logger instanceof Logger) {
+ $index = array_search($logger, self::$loggers, true);
+
+ return false !== $index;
+ } else {
+ return isset(self::$loggers[$logger]);
+ }
+ }
+
+ /**
+ * Removes instance from registry by name or instance
+ *
+ * @param string|Logger $logger Name or logger instance
+ */
+ public static function removeLogger($logger)
+ {
+ if ($logger instanceof Logger) {
+ if (false !== ($idx = array_search($logger, self::$loggers, true))) {
+ unset(self::$loggers[$idx]);
+ }
+ } else {
+ unset(self::$loggers[$logger]);
+ }
+ }
+
+ /**
+ * Clears the registry
+ */
+ public static function clear()
+ {
+ self::$loggers = array();
+ }
+
+ /**
+ * Gets Logger instance from the registry
+ *
+ * @param string $name Name of the requested Logger instance
+ * @throws \InvalidArgumentException If named Logger instance is not in the registry
+ * @return Logger Requested instance of Logger
+ */
+ public static function getInstance($name)
+ {
+ if (!isset(self::$loggers[$name])) {
+ throw new InvalidArgumentException(sprintf('Requested "%s" logger instance is not in the registry', $name));
+ }
+
+ return self::$loggers[$name];
+ }
+
+ /**
+ * Gets Logger instance from the registry via static method call
+ *
+ * @param string $name Name of the requested Logger instance
+ * @param array $arguments Arguments passed to static method call
+ * @throws \InvalidArgumentException If named Logger instance is not in the registry
+ * @return Logger Requested instance of Logger
+ */
+ public static function __callStatic($name, $arguments)
+ {
+ return self::getInstance($name);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
new file mode 100644
index 0000000..a9a3f30
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
@@ -0,0 +1,31 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+
+class ErrorHandlerTest extends \PHPUnit_Framework_TestCase
+{
+ public function testHandleError()
+ {
+ $logger = new Logger('test', array($handler = new TestHandler));
+ $errHandler = new ErrorHandler($logger);
+
+ $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false);
+ trigger_error('Foo', E_USER_ERROR);
+ $this->assertCount(1, $handler->getRecords());
+ $this->assertTrue($handler->hasErrorRecords());
+ trigger_error('Foo', E_USER_NOTICE);
+ $this->assertCount(2, $handler->getRecords());
+ $this->assertTrue($handler->hasEmergencyRecords());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
new file mode 100644
index 0000000..71c4204
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
@@ -0,0 +1,158 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testDefaultFormat()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ array(
+ 'message' => 'log',
+ 'context' => array('from' => 'logger'),
+ 'extra' => array('ip' => '127.0.0.1'),
+ ),
+ 'unknown',
+ 'error',
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::CRITICAL,
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ array(
+ 'message' => 'log',
+ 'context' => array('from' => 'logger'),
+ 'extra' => array('ip' => '127.0.0.1'),
+ ),
+ 'test : 14',
+ 'error',
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testFormatWithoutContext()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::DEBUG,
+ 'level_name' => 'DEBUG',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ 'log',
+ 'unknown',
+ 'log',
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
+ */
+ public function testBatchFormatThrowException()
+ {
+ $formatter = new ChromePHPFormatter();
+ $records = array(
+ array(
+ 'level' => Logger::INFO,
+ 'level_name' => 'INFO',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ ),
+ array(
+ 'level' => Logger::WARNING,
+ 'level_name' => 'WARNING',
+ 'channel' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log2',
+ ),
+ );
+
+ $this->assertEquals(
+ array(
+ array(
+ 'meh',
+ 'log',
+ 'unknown',
+ 'info',
+ ),
+ array(
+ 'foo',
+ 'log2',
+ 'unknown',
+ 'warn',
+ ),
+ ),
+ $formatter->formatBatch($records)
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
new file mode 100644
index 0000000..90cc48d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
@@ -0,0 +1,79 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists("Elastica\Document")) {
+ $this->markTestSkipped("ruflin/elastica not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\ElasticaFormatter::__construct
+ * @covers Monolog\Formatter\ElasticaFormatter::format
+ * @covers Monolog\Formatter\ElasticaFormatter::getDocument
+ */
+ public function testFormat()
+ {
+ // test log message
+ $msg = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ // expected values
+ $expected = $msg;
+ $expected['datetime'] = '1970-01-01T00:00:00.000000+00:00';
+ $expected['context'] = array(
+ 'class' => '[object] (stdClass: {})',
+ 'foo' => 7,
+ 0 => 'bar',
+ );
+
+ // format log message
+ $formatter = new ElasticaFormatter('my_index', 'doc_type');
+ $doc = $formatter->format($msg);
+ $this->assertInstanceOf('Elastica\Document', $doc);
+
+ // Document parameters
+ $params = $doc->getParams();
+ $this->assertEquals('my_index', $params['_index']);
+ $this->assertEquals('doc_type', $params['_type']);
+
+ // Document data values
+ $data = $doc->getData();
+ foreach (array_keys($expected) as $key) {
+ $this->assertEquals($expected[$key], $data[$key]);
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\ElasticaFormatter::getIndex
+ * @covers Monolog\Formatter\ElasticaFormatter::getType
+ */
+ public function testGetters()
+ {
+ $formatter = new ElasticaFormatter('my_index', 'doc_type');
+ $this->assertEquals('my_index', $formatter->getIndex());
+ $this->assertEquals('doc_type', $formatter->getType());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
new file mode 100644
index 0000000..1b2fd97
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
@@ -0,0 +1,55 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FlowdockFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\FlowdockFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+ $record = $this->getRecord();
+
+ $expected = array(
+ 'source' => 'test_source',
+ 'from_address' => 'source@test.com',
+ 'subject' => 'in test_source: WARNING - test',
+ 'content' => 'test',
+ 'tags' => array('#logs', '#warning', '#test'),
+ 'project' => 'test_source',
+ );
+ $formatted = $formatter->format($record);
+
+ $this->assertEquals($expected, $formatted['flowdock']);
+ }
+
+ /**
+ * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch
+ */
+ public function testFormatBatch()
+ {
+ $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+ $records = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ $formatted = $formatter->formatBatch($records);
+
+ $this->assertArrayHasKey('flowdock', $formatted[0]);
+ $this->assertArrayHasKey('flowdock', $formatted[1]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php
new file mode 100644
index 0000000..622b2ba
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php
@@ -0,0 +1,62 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FluentdFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\FluentdFormatter::__construct
+ * @covers Monolog\Formatter\FluentdFormatter::isUsingLevelsInTag
+ */
+ public function testConstruct()
+ {
+ $formatter = new FluentdFormatter();
+ $this->assertEquals(false, $formatter->isUsingLevelsInTag());
+ $formatter = new FluentdFormatter(false);
+ $this->assertEquals(false, $formatter->isUsingLevelsInTag());
+ $formatter = new FluentdFormatter(true);
+ $this->assertEquals(true, $formatter->isUsingLevelsInTag());
+ }
+
+ /**
+ * @covers Monolog\Formatter\FluentdFormatter::format
+ */
+ public function testFormat()
+ {
+ $record = $this->getRecord(Logger::WARNING);
+ $record['datetime'] = new \DateTime("@0");
+
+ $formatter = new FluentdFormatter();
+ $this->assertEquals(
+ '["test",0,{"message":"test","extra":[],"level":300,"level_name":"WARNING"}]',
+ $formatter->format($record)
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\FluentdFormatter::format
+ */
+ public function testFormatWithTag()
+ {
+ $record = $this->getRecord(Logger::ERROR);
+ $record['datetime'] = new \DateTime("@0");
+
+ $formatter = new FluentdFormatter(true);
+ $this->assertEquals(
+ '["test.error",0,{"message":"test","extra":[]}]',
+ $formatter->format($record)
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
new file mode 100644
index 0000000..e6bd309
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
@@ -0,0 +1,234 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('\Gelf\Message')) {
+ $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testDefaultFormatter()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals(0, $message->getTimestamp());
+ $this->assertEquals('log', $message->getShortMessage());
+ $this->assertEquals('meh', $message->getFacility());
+ $this->assertEquals(null, $message->getLine());
+ $this->assertEquals(null, $message->getFile());
+ $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel());
+ $this->assertNotEmpty($message->getHost());
+
+ $formatter = new GelfMessageFormatter('mysystem');
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals('mysystem', $message->getHost());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals('test', $message->getFile());
+ $this->assertEquals(14, $message->getLine());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ * @expectedException InvalidArgumentException
+ */
+ public function testFormatInvalidFails()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ );
+
+ $formatter->format($record);
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithContext()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_ctxt_from', $message_array);
+ $this->assertEquals('logger', $message_array['_ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new GelfMessageFormatter(null, null, 'CTX');
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_CTXfrom', $message_array);
+ $this->assertEquals('logger', $message_array['_CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithContextContainingException()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger', 'exception' => array(
+ 'class' => '\Exception',
+ 'file' => '/some/file/in/dir.php:56',
+ 'trace' => array('/some/file/1.php:23', '/some/file/2.php:3'),
+ )),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $this->assertEquals("/some/file/in/dir.php", $message->getFile());
+ $this->assertEquals("56", $message->getLine());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithExtra()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_key', $message_array);
+ $this->assertEquals('pair', $message_array['_key']);
+
+ // Test with extraPrefix
+ $formatter = new GelfMessageFormatter(null, 'EXT');
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_EXTkey', $message_array);
+ $this->assertEquals('pair', $message_array['_EXTkey']);
+ }
+
+ public function testFormatWithLargeData()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('exception' => str_repeat(' ', 32767)),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => str_repeat(' ', 32767)),
+ 'message' => 'log'
+ );
+ $message = $formatter->format($record);
+ $messageArray = $message->toArray();
+
+ // 200 for padding + metadata
+ $length = 200;
+
+ foreach ($messageArray as $key => $value) {
+ if (!in_array($key, array('level', 'timestamp'))) {
+ $length += strlen($value);
+ }
+ }
+
+ // in graylog2/gelf-php before 1.4.1 empty strings are filtered and won't be included in the message
+ // though it should be sufficient to ensure that the entire message length does not exceed the maximum
+ // length being allowed
+ $this->assertLessThanOrEqual(32766, $length, 'The message length is no longer than the maximum allowed length');
+ }
+
+ private function isLegacy()
+ {
+ return interface_exists('\Gelf\IMessagePublisher');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
new file mode 100644
index 0000000..df7e35d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
@@ -0,0 +1,122 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class JsonFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::__construct
+ * @covers Monolog\Formatter\JsonFormatter::getBatchMode
+ * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines
+ */
+ public function testConstruct()
+ {
+ $formatter = new JsonFormatter();
+ $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+ $this->assertEquals(true, $formatter->isAppendingNewlines());
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false);
+ $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+ $this->assertEquals(false, $formatter->isAppendingNewlines());
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new JsonFormatter();
+ $record = $this->getRecord();
+ $this->assertEquals(json_encode($record)."\n", $formatter->format($record));
+
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+ $record = $this->getRecord();
+ $this->assertEquals(json_encode($record), $formatter->format($record));
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::formatBatch
+ * @covers Monolog\Formatter\JsonFormatter::formatBatchJson
+ */
+ public function testFormatBatch()
+ {
+ $formatter = new JsonFormatter();
+ $records = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ $this->assertEquals(json_encode($records), $formatter->formatBatch($records));
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::formatBatch
+ * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines
+ */
+ public function testFormatBatchNewlines()
+ {
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES);
+ $records = $expected = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ array_walk($expected, function (&$value, $key) {
+ $value = json_encode($value);
+ });
+ $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records));
+ }
+
+ public function testDefFormatWithException()
+ {
+ $formatter = new JsonFormatter();
+ $exception = new \RuntimeException('Foo');
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => $exception),
+ 'datetime' => new \DateTime(),
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ $path = substr(json_encode($exception->getFile(), JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE), 1, -1);
+ } else {
+ $path = substr(json_encode($exception->getFile()), 1, -1);
+ }
+ $this->assertEquals('{"level_name":"CRITICAL","channel":"core","context":{"exception":{"class":"RuntimeException","message":"'.$exception->getMessage().'","code":'.$exception->getCode().',"file":"'.$path.':'.$exception->getLine().'"}},"datetime":'.json_encode(new \DateTime()).',"extra":[],"message":"foobar"}'."\n", $message);
+ }
+
+ public function testDefFormatWithPreviousException()
+ {
+ $formatter = new JsonFormatter();
+ $exception = new \RuntimeException('Foo', 0, new \LogicException('Wut?'));
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => $exception),
+ 'datetime' => new \DateTime(),
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ $pathPrevious = substr(json_encode($exception->getPrevious()->getFile(), JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE), 1, -1);
+ $pathException = substr(json_encode($exception->getFile(), JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE), 1, -1);
+ } else {
+ $pathPrevious = substr(json_encode($exception->getPrevious()->getFile()), 1, -1);
+ $pathException = substr(json_encode($exception->getFile()), 1, -1);
+ }
+ $this->assertEquals('{"level_name":"CRITICAL","channel":"core","context":{"exception":{"class":"RuntimeException","message":"'.$exception->getMessage().'","code":'.$exception->getCode().',"file":"'.$pathException.':'.$exception->getLine().'","previous":{"class":"LogicException","message":"'.$exception->getPrevious()->getMessage().'","code":'.$exception->getPrevious()->getCode().',"file":"'.$pathPrevious.':'.$exception->getPrevious()->getLine().'"}}},"datetime":'.json_encode(new \DateTime()).',"extra":[],"message":"foobar"}'."\n", $message);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
new file mode 100644
index 0000000..310d93c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
@@ -0,0 +1,222 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\LineFormatter
+ */
+class LineFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function testDefFormatWithString()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'context' => array(),
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+ }
+
+ public function testDefFormatWithArrayContext()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ 'bool' => false,
+ 'null' => null,
+ ),
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message);
+ }
+
+ public function testDefFormatExtras()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message);
+ }
+
+ public function testFormatExtras()
+ {
+ $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message);
+ }
+
+ public function testContextAndExtraOptionallyNotShownIfEmpty()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d', false, true);
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message);
+ }
+
+ public function testContextAndExtraReplacement()
+ {
+ $formatter = new LineFormatter('%context.foo% => %extra.foo%');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 'bar'),
+ 'datetime' => new \DateTime,
+ 'extra' => array('foo' => 'xbar'),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('bar => xbar', $message);
+ }
+
+ public function testDefFormatWithObject()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+ 'message' => 'foobar',
+ ));
+
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: bar)","baz":[],"res":"[resource] (stream)"}'."\n", $message);
+ }
+
+ public function testDefFormatWithException()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => new \RuntimeException('Foo')),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+ $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).')"} []'."\n", $message);
+ }
+
+ public function testDefFormatWithPreviousException()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $previous = new \LogicException('Wut?');
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+ $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__ - 12).')"} []'."\n", $message);
+ }
+
+ public function testBatchFormat()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->formatBatch(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+ }
+
+ public function testFormatShouldStripInlineLineBreaks()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(
+ array(
+ 'message' => "foo\nbar",
+ 'context' => array(),
+ 'extra' => array(),
+ )
+ );
+
+ $this->assertRegExp('/foo bar/', $message);
+ }
+
+ public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d', true);
+ $message = $formatter->format(
+ array(
+ 'message' => "foo\nbar",
+ 'context' => array(),
+ 'extra' => array(),
+ )
+ );
+
+ $this->assertRegExp('/foo\nbar/', $message);
+ }
+}
+
+class TestFoo
+{
+ public $foo = 'foo';
+}
+
+class TestBar
+{
+ public function __toString()
+ {
+ return 'bar';
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
new file mode 100644
index 0000000..6d59b3f
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
@@ -0,0 +1,40 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\TestCase;
+
+class LogglyFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\LogglyFormatter::__construct
+ */
+ public function testConstruct()
+ {
+ $formatter = new LogglyFormatter();
+ $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+ $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON);
+ $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogglyFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new LogglyFormatter();
+ $record = $this->getRecord();
+ $formatted_decoded = json_decode($formatter->format($record), true);
+ $this->assertArrayHasKey("timestamp", $formatted_decoded);
+ $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
new file mode 100644
index 0000000..9f6b1cc
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
@@ -0,0 +1,333 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class LogstashFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function tearDown()
+ {
+ \PHPUnit_Framework_Error_Warning::$enabled = true;
+
+ return parent::tearDown();
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testDefaultFormatter()
+ {
+ $formatter = new LogstashFormatter('test', 'hostname');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+ $this->assertEquals('log', $message['@message']);
+ $this->assertEquals('meh', $message['@fields']['channel']);
+ $this->assertContains('meh', $message['@tags']);
+ $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+ $this->assertEquals('test', $message['@type']);
+ $this->assertEquals('hostname', $message['@source']);
+
+ $formatter = new LogstashFormatter('mysystem');
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('mysystem', $message['@type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('test', $message['@fields']['file']);
+ $this->assertEquals(14, $message['@fields']['line']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithContext()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('ctxt_from', $message_array);
+ $this->assertEquals('logger', $message_array['ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, null, 'CTX');
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('CTXfrom', $message_array);
+ $this->assertEquals('logger', $message_array['CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithExtra()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('key', $message_array);
+ $this->assertEquals('pair', $message_array['key']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, 'EXT');
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('EXTkey', $message_array);
+ $this->assertEquals('pair', $message_array['EXTkey']);
+ }
+
+ public function testFormatWithApplicationName()
+ {
+ $formatter = new LogstashFormatter('app', 'test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('@type', $message);
+ $this->assertEquals('app', $message['@type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testDefaultFormatterV1()
+ {
+ $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+ $this->assertEquals("1", $message['@version']);
+ $this->assertEquals('log', $message['message']);
+ $this->assertEquals('meh', $message['channel']);
+ $this->assertEquals('ERROR', $message['level']);
+ $this->assertEquals('test', $message['type']);
+ $this->assertEquals('hostname', $message['host']);
+
+ $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1);
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('mysystem', $message['type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithFileAndLineV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('test', $message['file']);
+ $this->assertEquals(14, $message['line']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithContextV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('ctxt_from', $message);
+ $this->assertEquals('logger', $message['ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1);
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('CTXfrom', $message);
+ $this->assertEquals('logger', $message['CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithExtraV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('key', $message);
+ $this->assertEquals('pair', $message['key']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1);
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('EXTkey', $message);
+ $this->assertEquals('pair', $message['EXTkey']);
+ }
+
+ public function testFormatWithApplicationNameV1()
+ {
+ $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('type', $message);
+ $this->assertEquals('app', $message['type']);
+ }
+
+ public function testFormatWithLatin9Data()
+ {
+ if (version_compare(PHP_VERSION, '5.5.0', '<')) {
+ // Ignore the warning that will be emitted by PHP <5.5.0
+ \PHPUnit_Framework_Error_Warning::$enabled = false;
+ }
+ $formatter = new LogstashFormatter('test', 'hostname');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => '¯\_(ツ)_/¯',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(
+ 'user_agent' => "\xD6WN; FBCR/OrangeEspa\xF1a; Vers\xE3o/4.0; F\xE4rist",
+ ),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+ $this->assertEquals('log', $message['@message']);
+ $this->assertEquals('¯\_(ツ)_/¯', $message['@fields']['channel']);
+ $this->assertContains('¯\_(ツ)_/¯', $message['@tags']);
+ $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+ $this->assertEquals('test', $message['@type']);
+ $this->assertEquals('hostname', $message['@source']);
+ if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+ $this->assertEquals('ÖWN; FBCR/OrangeEspaña; Versão/4.0; Färist', $message['@fields']['user_agent']);
+ } else {
+ // PHP <5.5 does not return false for an element encoding failure,
+ // instead it emits a warning (possibly) and nulls the value.
+ $this->assertEquals(null, $message['@fields']['user_agent']);
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
new file mode 100644
index 0000000..52e699e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
@@ -0,0 +1,262 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * @author Florian Plattner
+ */
+class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('MongoDate')) {
+ $this->markTestSkipped('mongo extension not installed');
+ }
+ }
+
+ public function constructArgumentProvider()
+ {
+ return array(
+ array(1, true, 1, true),
+ array(0, false, 0, false),
+ );
+ }
+
+ /**
+ * @param $traceDepth
+ * @param $traceAsString
+ * @param $expectedTraceDepth
+ * @param $expectedTraceAsString
+ *
+ * @dataProvider constructArgumentProvider
+ */
+ public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString)
+ {
+ $formatter = new MongoDBFormatter($traceDepth, $traceAsString);
+
+ $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString');
+ $reflTrace->setAccessible(true);
+ $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter));
+
+ $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel');
+ $reflDepth->setAccessible(true);
+ $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter));
+ }
+
+ public function testSimpleFormat()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter();
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertCount(7, $formattedRecord);
+ $this->assertEquals('some log message', $formattedRecord['message']);
+ $this->assertEquals(array(), $formattedRecord['context']);
+ $this->assertEquals(Logger::WARNING, $formattedRecord['level']);
+ $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']);
+ $this->assertEquals('test', $formattedRecord['channel']);
+ $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']);
+ $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString());
+ $this->assertEquals(array(), $formattedRecord['extra']);
+ }
+
+ public function testRecursiveFormat()
+ {
+ $someObject = new \stdClass();
+ $someObject->foo = 'something';
+ $someObject->bar = 'stuff';
+
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'stuff' => new \DateTime('2014-02-01 02:31:33'),
+ 'some_object' => $someObject,
+ 'context_string' => 'some string',
+ 'context_int' => 123456,
+ 'except' => new \Exception('exception message', 987),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter();
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertCount(5, $formattedRecord['context']);
+ $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']);
+ $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString());
+ $this->assertEquals(
+ array(
+ 'foo' => 'something',
+ 'bar' => 'stuff',
+ 'class' => 'stdClass',
+ ),
+ $formattedRecord['context']['some_object']
+ );
+ $this->assertEquals('some string', $formattedRecord['context']['context_string']);
+ $this->assertEquals(123456, $formattedRecord['context']['context_int']);
+
+ $this->assertCount(5, $formattedRecord['context']['except']);
+ $this->assertEquals('exception message', $formattedRecord['context']['except']['message']);
+ $this->assertEquals(987, $formattedRecord['context']['except']['code']);
+ $this->assertInternalType('string', $formattedRecord['context']['except']['file']);
+ $this->assertInternalType('integer', $formattedRecord['context']['except']['code']);
+ $this->assertInternalType('string', $formattedRecord['context']['except']['trace']);
+ $this->assertEquals('Exception', $formattedRecord['context']['except']['class']);
+ }
+
+ public function testFormatDepthArray()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => array(
+ 'nest4' => 'value',
+ 'property' => 'nothing',
+ ),
+ ),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => '[...]',
+ ),
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthArrayInfiniteNesting()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => array(
+ 'property' => 'something',
+ 'nest3' => array(
+ 'property' => 'anything',
+ 'nest4' => array(
+ 'property' => 'nothing',
+ ),
+ ),
+ ),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(0);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'something',
+ 'nest3' => array(
+ 'property' => 'anything',
+ 'nest4' => array(
+ 'property' => 'nothing',
+ ),
+ ),
+ ),
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthObjects()
+ {
+ $someObject = new \stdClass();
+ $someObject->property = 'anything';
+ $someObject->nest3 = new \stdClass();
+ $someObject->nest3->property = 'nothing';
+ $someObject->nest3->nest4 = 'invisible';
+
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => $someObject,
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2, true);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => '[...]',
+ 'class' => 'stdClass',
+ ),
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthException()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => new \Exception('exception message', 987),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2, false);
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']);
+ $this->assertEquals(987, $formattedRecord['context']['nest2']['code']);
+ $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
new file mode 100644
index 0000000..83adb7e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
@@ -0,0 +1,378 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\NormalizerFormatter
+ */
+class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function tearDown()
+ {
+ \PHPUnit_Framework_Error_Warning::$enabled = true;
+
+ return parent::tearDown();
+ }
+
+ public function testFormat()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $formatted = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ 'inf' => INF,
+ '-inf' => -INF,
+ 'nan' => acos(4),
+ ),
+ ));
+
+ $this->assertEquals(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(
+ 'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
+ 'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: bar)',
+ 'baz' => array(),
+ 'res' => '[resource] (stream)',
+ ),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ 'inf' => 'INF',
+ '-inf' => '-INF',
+ 'nan' => 'NaN',
+ ),
+ ), $formatted);
+ }
+
+ public function testFormatExceptions()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $e = new \LogicException('bar');
+ $e2 = new \RuntimeException('foo', 0, $e);
+ $formatted = $formatter->format(array(
+ 'exception' => $e2,
+ ));
+
+ $this->assertGreaterThan(5, count($formatted['exception']['trace']));
+ $this->assertTrue(isset($formatted['exception']['previous']));
+ unset($formatted['exception']['trace'], $formatted['exception']['previous']);
+
+ $this->assertEquals(array(
+ 'exception' => array(
+ 'class' => get_class($e2),
+ 'message' => $e2->getMessage(),
+ 'code' => $e2->getCode(),
+ 'file' => $e2->getFile().':'.$e2->getLine(),
+ ),
+ ), $formatted);
+ }
+
+ public function testFormatToStringExceptionHandle()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $this->setExpectedException('RuntimeException', 'Could not convert to string');
+ $formatter->format(array(
+ 'myObject' => new TestToStringError(),
+ ));
+ }
+
+ public function testBatchFormat()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $formatted = $formatter->formatBatch(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ ));
+ $this->assertEquals(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(),
+ ),
+ ), $formatted);
+ }
+
+ /**
+ * Test issue #137
+ */
+ public function testIgnoresRecursiveObjectReferences()
+ {
+ // set up the recursion
+ $foo = new \stdClass();
+ $bar = new \stdClass();
+
+ $foo->bar = $bar;
+ $bar->foo = $foo;
+
+ // set an error handler to assert that the error is not raised anymore
+ $that = $this;
+ set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+ if (error_reporting() & $level) {
+ restore_error_handler();
+ $that->fail("$message should not be raised");
+ }
+ });
+
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+ $res = $reflMethod->invoke($formatter, array($foo, $bar), true);
+
+ restore_error_handler();
+
+ $this->assertEquals(@json_encode(array($foo, $bar)), $res);
+ }
+
+ public function testIgnoresInvalidTypes()
+ {
+ // set up the recursion
+ $resource = fopen(__FILE__, 'r');
+
+ // set an error handler to assert that the error is not raised anymore
+ $that = $this;
+ set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+ if (error_reporting() & $level) {
+ restore_error_handler();
+ $that->fail("$message should not be raised");
+ }
+ });
+
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+ $res = $reflMethod->invoke($formatter, array($resource), true);
+
+ restore_error_handler();
+
+ $this->assertEquals(@json_encode(array($resource)), $res);
+ }
+
+ /**
+ * @expectedException RuntimeException
+ */
+ public function testThrowsOnInvalidEncoding()
+ {
+ if (version_compare(PHP_VERSION, '5.5.0', '<')) {
+ // Ignore the warning that will be emitted by PHP <5.5.0
+ \PHPUnit_Framework_Error_Warning::$enabled = false;
+ }
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+
+ // send an invalid unicode sequence as a object that can't be cleaned
+ $record = new \stdClass;
+ $record->message = "\xB1\x31";
+ $res = $reflMethod->invoke($formatter, $record);
+ if (PHP_VERSION_ID < 50500 && $res === '{"message":null}') {
+ throw new \RuntimeException('PHP 5.3/5.4 throw a warning and null the value instead of returning false entirely');
+ }
+ }
+
+ public function testConvertsInvalidEncodingAsLatin9()
+ {
+ if (version_compare(PHP_VERSION, '5.5.0', '<')) {
+ // Ignore the warning that will be emitted by PHP <5.5.0
+ \PHPUnit_Framework_Error_Warning::$enabled = false;
+ }
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+
+ $res = $reflMethod->invoke($formatter, array('message' => "\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE"));
+
+ if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+ $this->assertSame('{"message":"€ŠšŽžŒœŸ"}', $res);
+ } else {
+ // PHP <5.5 does not return false for an element encoding failure,
+ // instead it emits a warning (possibly) and nulls the value.
+ $this->assertSame('{"message":null}', $res);
+ }
+ }
+
+ /**
+ * @param mixed $in Input
+ * @param mixed $expect Expected output
+ * @covers Monolog\Formatter\NormalizerFormatter::detectAndCleanUtf8
+ * @dataProvider providesDetectAndCleanUtf8
+ */
+ public function testDetectAndCleanUtf8($in, $expect)
+ {
+ $formatter = new NormalizerFormatter();
+ $formatter->detectAndCleanUtf8($in);
+ $this->assertSame($expect, $in);
+ }
+
+ public function providesDetectAndCleanUtf8()
+ {
+ $obj = new \stdClass;
+
+ return array(
+ 'null' => array(null, null),
+ 'int' => array(123, 123),
+ 'float' => array(123.45, 123.45),
+ 'bool false' => array(false, false),
+ 'bool true' => array(true, true),
+ 'ascii string' => array('abcdef', 'abcdef'),
+ 'latin9 string' => array("\xB1\x31\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE\xFF", '±1€ŠšŽžŒœŸÿ'),
+ 'unicode string' => array('¤¦¨´¸¼½¾€ŠšŽžŒœŸ', '¤¦¨´¸¼½¾€ŠšŽžŒœŸ'),
+ 'empty array' => array(array(), array()),
+ 'array' => array(array('abcdef'), array('abcdef')),
+ 'object' => array($obj, $obj),
+ );
+ }
+
+ /**
+ * @param int $code
+ * @param string $msg
+ * @dataProvider providesHandleJsonErrorFailure
+ */
+ public function testHandleJsonErrorFailure($code, $msg)
+ {
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'handleJsonError');
+ $reflMethod->setAccessible(true);
+
+ $this->setExpectedException('RuntimeException', $msg);
+ $reflMethod->invoke($formatter, $code, 'faked');
+ }
+
+ public function providesHandleJsonErrorFailure()
+ {
+ return array(
+ 'depth' => array(JSON_ERROR_DEPTH, 'Maximum stack depth exceeded'),
+ 'state' => array(JSON_ERROR_STATE_MISMATCH, 'Underflow or the modes mismatch'),
+ 'ctrl' => array(JSON_ERROR_CTRL_CHAR, 'Unexpected control character found'),
+ 'default' => array(-1, 'Unknown error'),
+ );
+ }
+
+ public function testExceptionTraceWithArgs()
+ {
+ if (defined('HHVM_VERSION')) {
+ $this->markTestSkipped('Not supported in HHVM since it detects errors differently');
+ }
+
+ // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered
+ // and no file or line are included in the trace because it's treated as internal function
+ set_error_handler(function ($errno, $errstr, $errfile, $errline) {
+ throw new \ErrorException($errstr, 0, $errno, $errfile, $errline);
+ });
+
+ try {
+ // This will contain $resource and $wrappedResource as arguments in the trace item
+ $resource = fopen('php://memory', 'rw+');
+ fwrite($resource, 'test_resource');
+ $wrappedResource = new TestFooNorm;
+ $wrappedResource->foo = $resource;
+ // Just do something stupid with a resource/wrapped resource as argument
+ array_keys($wrappedResource);
+ } catch (\Exception $e) {
+ restore_error_handler();
+ }
+
+ $formatter = new NormalizerFormatter();
+ $record = array('context' => array('exception' => $e));
+ $result = $formatter->format($record);
+
+ $this->assertRegExp(
+ '%"resource":"\[resource\] \(stream\)"%',
+ $result['context']['exception']['trace'][0]
+ );
+
+ if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+ $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestFooNorm: \)"%';
+ } else {
+ $pattern = '%\\\\"foo\\\\":null%';
+ }
+
+ // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4
+ $this->assertRegExp(
+ $pattern,
+ $result['context']['exception']['trace'][0]
+ );
+ }
+}
+
+class TestFooNorm
+{
+ public $foo = 'foo';
+}
+
+class TestBarNorm
+{
+ public function __toString()
+ {
+ return 'bar';
+ }
+}
+
+class TestStreamFoo
+{
+ public $foo;
+ public $resource;
+
+ public function __construct($resource)
+ {
+ $this->resource = $resource;
+ $this->foo = 'BAR';
+ }
+
+ public function __toString()
+ {
+ fseek($this->resource, 0);
+
+ return $this->foo . ' - ' . (string) stream_get_contents($this->resource);
+ }
+}
+
+class TestToStringError
+{
+ public function __toString()
+ {
+ throw new \RuntimeException('Could not convert to string');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
new file mode 100644
index 0000000..b1c8fd4
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
@@ -0,0 +1,110 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+class ScalarFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ private $formatter;
+
+ public function setUp()
+ {
+ $this->formatter = new ScalarFormatter();
+ }
+
+ public function buildTrace(\Exception $e)
+ {
+ $data = array();
+ $trace = $e->getTrace();
+ foreach ($trace as $frame) {
+ if (isset($frame['file'])) {
+ $data[] = $frame['file'].':'.$frame['line'];
+ } else {
+ $data[] = json_encode($frame);
+ }
+ }
+
+ return $data;
+ }
+
+ public function encodeJson($data)
+ {
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return json_encode($data);
+ }
+
+ public function testFormat()
+ {
+ $exception = new \Exception('foo');
+ $formatted = $this->formatter->format(array(
+ 'foo' => 'string',
+ 'bar' => 1,
+ 'baz' => false,
+ 'bam' => array(1, 2, 3),
+ 'bat' => array('foo' => 'bar'),
+ 'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'),
+ 'ban' => $exception,
+ ));
+
+ $this->assertSame(array(
+ 'foo' => 'string',
+ 'bar' => 1,
+ 'baz' => false,
+ 'bam' => $this->encodeJson(array(1, 2, 3)),
+ 'bat' => $this->encodeJson(array('foo' => 'bar')),
+ 'bap' => '1970-01-01 00:00:00',
+ 'ban' => $this->encodeJson(array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ 'trace' => $this->buildTrace($exception),
+ )),
+ ), $formatted);
+ }
+
+ public function testFormatWithErrorContext()
+ {
+ $context = array('file' => 'foo', 'line' => 1);
+ $formatted = $this->formatter->format(array(
+ 'context' => $context,
+ ));
+
+ $this->assertSame(array(
+ 'context' => $this->encodeJson($context),
+ ), $formatted);
+ }
+
+ public function testFormatWithExceptionContext()
+ {
+ $exception = new \Exception('foo');
+ $formatted = $this->formatter->format(array(
+ 'context' => array(
+ 'exception' => $exception,
+ ),
+ ));
+
+ $this->assertSame(array(
+ 'context' => $this->encodeJson(array(
+ 'exception' => array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ 'trace' => $this->buildTrace($exception),
+ ),
+ )),
+ ), $formatted);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
new file mode 100644
index 0000000..52f15a3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
@@ -0,0 +1,142 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testDefaultFormat()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
+ .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
+ .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testFormatWithoutContext()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::formatBatch
+ * @expectedException BadMethodCallException
+ */
+ public function testBatchFormatThrowException()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $wildfire->formatBatch(array($record));
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testTableFormat()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'table-channel',
+ 'context' => array(
+ WildfireFormatter::TABLE => array(
+ array('col1', 'col2', 'col3'),
+ array('val1', 'val2', 'val3'),
+ array('foo1', 'foo2', 'foo3'),
+ array('bar1', 'bar2', 'bar3'),
+ ),
+ ),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'table-message',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|',
+ $message
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
new file mode 100644
index 0000000..568eb9d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
@@ -0,0 +1,115 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\WebProcessor;
+
+class AbstractHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\AbstractHandler::__construct
+ * @covers Monolog\Handler\AbstractHandler::getLevel
+ * @covers Monolog\Handler\AbstractHandler::setLevel
+ * @covers Monolog\Handler\AbstractHandler::getBubble
+ * @covers Monolog\Handler\AbstractHandler::setBubble
+ * @covers Monolog\Handler\AbstractHandler::getFormatter
+ * @covers Monolog\Handler\AbstractHandler::setFormatter
+ */
+ public function testConstructAndGetSet()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+ $this->assertEquals(Logger::WARNING, $handler->getLevel());
+ $this->assertEquals(false, $handler->getBubble());
+
+ $handler->setLevel(Logger::ERROR);
+ $handler->setBubble(true);
+ $handler->setFormatter($formatter = new LineFormatter);
+ $this->assertEquals(Logger::ERROR, $handler->getLevel());
+ $this->assertEquals(true, $handler->getBubble());
+ $this->assertSame($formatter, $handler->getFormatter());
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $handler->expects($this->exactly(2))
+ ->method('handle');
+ $handler->handleBatch(array($this->getRecord(), $this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+ $this->assertTrue($handler->isHandling($this->getRecord()));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::__construct
+ */
+ public function testHandlesPsrStyleLevels()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ $handler->setLevel('debug');
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::getFormatter
+ * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
+ */
+ public function testGetFormatterInitializesDefault()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::pushProcessor
+ * @covers Monolog\Handler\AbstractHandler::popProcessor
+ * @expectedException LogicException
+ */
+ public function testPushPopProcessor()
+ {
+ $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $processor1 = new WebProcessor;
+ $processor2 = new WebProcessor;
+
+ $logger->pushProcessor($processor1);
+ $logger->pushProcessor($processor2);
+
+ $this->assertEquals($processor2, $logger->popProcessor());
+ $this->assertEquals($processor1, $logger->popProcessor());
+ $logger->popProcessor();
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::pushProcessor
+ * @expectedException InvalidArgumentException
+ */
+ public function testPushProcessorWithNonCallable()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+
+ $handler->pushProcessor(new \stdClass());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
new file mode 100644
index 0000000..24d4f63
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
@@ -0,0 +1,80 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Processor\WebProcessor;
+
+class AbstractProcessingHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleLowerLevelMessage()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleBubbling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
+ $this->assertFalse($handler->handle($this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleNotBubbling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
+ $this->assertTrue($handler->handle($this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleIsFalseWhenNotHandled()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
+ $this->assertTrue($handler->handle($this->getRecord()));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::processRecord
+ */
+ public function testProcessRecord()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
+ $handler->pushProcessor(new WebProcessor(array(
+ 'REQUEST_URI' => '',
+ 'REQUEST_METHOD' => '',
+ 'REMOTE_ADDR' => '',
+ 'SERVER_NAME' => '',
+ 'UNIQUE_ID' => '',
+ )));
+ $handledRecord = null;
+ $handler->expects($this->once())
+ ->method('write')
+ ->will($this->returnCallback(function ($record) use (&$handledRecord) {
+ $handledRecord = $record;
+ }))
+ ;
+ $handler->handle($this->getRecord());
+ $this->assertEquals(6, count($handledRecord['extra']));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
new file mode 100644
index 0000000..8e0e723
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
@@ -0,0 +1,136 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Connection\AMQPConnection;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class AmqpHandlerTest extends TestCase
+{
+ public function testHandleAmqpExt()
+ {
+ if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
+ $this->markTestSkipped("amqp-php not installed");
+ }
+
+ if (!class_exists('AMQPChannel')) {
+ $this->markTestSkipped("Please update AMQP to version >= 1.0");
+ }
+
+ $messages = array();
+
+ $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false);
+ $exchange->expects($this->once())
+ ->method('setName')
+ ->with('log')
+ ;
+ $exchange->expects($this->any())
+ ->method('publish')
+ ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) {
+ $messages[] = array($message, $routing_key, $flags, $attributes);
+ }))
+ ;
+
+ $handler = new AmqpHandler($exchange, 'log');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ array(
+ 'message' => 'test',
+ 'context' => array(
+ 'data' => array(),
+ 'foo' => 34,
+ ),
+ 'level' => 300,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'extra' => array(),
+ ),
+ 'warn.test',
+ 0,
+ array(
+ 'delivery_mode' => 2,
+ 'content_type' => 'application/json',
+ ),
+ );
+
+ $handler->handle($record);
+
+ $this->assertCount(1, $messages);
+ $messages[0][0] = json_decode($messages[0][0], true);
+ unset($messages[0][0]['datetime']);
+ $this->assertEquals($expected, $messages[0]);
+ }
+
+ public function testHandlePhpAmqpLib()
+ {
+ if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) {
+ $this->markTestSkipped("php-amqplib not installed");
+ }
+
+ $messages = array();
+
+ $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false);
+
+ $exchange->expects($this->any())
+ ->method('basic_publish')
+ ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) {
+ $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket);
+ }))
+ ;
+
+ $handler = new AmqpHandler($exchange, 'log');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ array(
+ 'message' => 'test',
+ 'context' => array(
+ 'data' => array(),
+ 'foo' => 34,
+ ),
+ 'level' => 300,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'extra' => array(),
+ ),
+ 'log',
+ 'warn.test',
+ false,
+ false,
+ null,
+ array(
+ 'delivery_mode' => 2,
+ 'content_type' => 'application/json',
+ ),
+ );
+
+ $handler->handle($record);
+
+ $this->assertCount(1, $messages);
+
+ /* @var $msg AMQPMessage */
+ $msg = $messages[0][0];
+ $messages[0][0] = json_decode($msg->body, true);
+ $messages[0][] = $msg->get_properties();
+ unset($messages[0][0]['datetime']);
+
+ $this->assertEquals($expected, $messages[0]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
new file mode 100644
index 0000000..ffb1d74
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
@@ -0,0 +1,130 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\BrowserConsoleHandlerTest
+ */
+class BrowserConsoleHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ BrowserConsoleHandler::reset();
+ }
+
+ protected function generateScript()
+ {
+ $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript');
+ $reflMethod->setAccessible(true);
+
+ return $reflMethod->invoke(null);
+ }
+
+ public function testStyling()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}'));
+
+ $expected = <<assertEquals($expected, $this->generateScript());
+ }
+
+ public function testEscaping()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}"));
+
+ $expected = <<assertEquals($expected, $this->generateScript());
+ }
+
+ public function testAutolabel()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+ $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}'));
+ $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+
+ $expected = <<assertEquals($expected, $this->generateScript());
+ }
+
+ public function testContext()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar')));
+
+ $expected = <<assertEquals($expected, $this->generateScript());
+ }
+
+ public function testConcurrentHandlers()
+ {
+ $handler1 = new BrowserConsoleHandler();
+ $handler1->setFormatter($this->getIdentityFormatter());
+
+ $handler2 = new BrowserConsoleHandler();
+ $handler2->setFormatter($this->getIdentityFormatter());
+
+ $handler1->handle($this->getRecord(Logger::DEBUG, 'test1'));
+ $handler2->handle($this->getRecord(Logger::DEBUG, 'test2'));
+ $handler1->handle($this->getRecord(Logger::DEBUG, 'test3'));
+ $handler2->handle($this->getRecord(Logger::DEBUG, 'test4'));
+
+ $expected = <<assertEquals($expected, $this->generateScript());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php
new file mode 100644
index 0000000..da8b3c3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php
@@ -0,0 +1,158 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class BufferHandlerTest extends TestCase
+{
+ private $shutdownCheckHandler;
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::__construct
+ * @covers Monolog\Handler\BufferHandler::handle
+ * @covers Monolog\Handler\BufferHandler::close
+ */
+ public function testHandleBuffers()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ $handler->close();
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::close
+ * @covers Monolog\Handler\BufferHandler::flush
+ */
+ public function testPropagatesRecordsAtEndOfRequest()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test);
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->shutdownCheckHandler = $test;
+ register_shutdown_function(array($this, 'checkPropagation'));
+ }
+
+ public function checkPropagation()
+ {
+ if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) {
+ echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL;
+ exit(1);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleBufferLimit()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 2);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertFalse($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleBufferLimitWithFlushOnOverflow()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true);
+
+ // send two records
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertCount(0, $test->getRecords());
+
+ // overflow
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertCount(3, $test->getRecords());
+
+ // should buffer again
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertCount(3, $test->getRecords());
+
+ $handler->close();
+ $this->assertCount(5, $test->getRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleLevel()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 0, Logger::INFO);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertFalse($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::flush
+ */
+ public function testFlush()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 0);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->flush();
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertFalse($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test);
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->flush();
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php
new file mode 100644
index 0000000..ef3cd1c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php
@@ -0,0 +1,141 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\ChromePHPHandler
+ */
+class ChromePHPHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ TestChromePHPHandler::reset();
+ $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0';
+ }
+
+ public function testHeaders()
+ {
+ $handler = new TestChromePHPHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
+ 'version' => ChromePHPHandler::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(
+ 'test',
+ 'test',
+ ),
+ 'request_uri' => '',
+ )))),
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ }
+
+ public function testHeadersOverflow()
+ {
+ $handler = new TestChromePHPHandler();
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150 * 1024)));
+
+ // overflow chrome headers limit
+ $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100 * 1024)));
+
+ $expected = array(
+ 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
+ 'version' => ChromePHPHandler::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(
+ array(
+ 'test',
+ 'test',
+ 'unknown',
+ 'log',
+ ),
+ array(
+ 'test',
+ str_repeat('a', 150 * 1024),
+ 'unknown',
+ 'warn',
+ ),
+ array(
+ 'monolog',
+ 'Incomplete logs, chrome header size limit reached',
+ 'unknown',
+ 'warn',
+ ),
+ ),
+ 'request_uri' => '',
+ )))),
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ }
+
+ public function testConcurrentHandlers()
+ {
+ $handler = new TestChromePHPHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $handler2 = new TestChromePHPHandler();
+ $handler2->setFormatter($this->getIdentityFormatter());
+ $handler2->handle($this->getRecord(Logger::DEBUG));
+ $handler2->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
+ 'version' => ChromePHPHandler::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(
+ 'test',
+ 'test',
+ 'test',
+ 'test',
+ ),
+ 'request_uri' => '',
+ )))),
+ );
+
+ $this->assertEquals($expected, $handler2->getHeaders());
+ }
+}
+
+class TestChromePHPHandler extends ChromePHPHandler
+{
+ protected $headers = array();
+
+ public static function reset()
+ {
+ self::$initialized = false;
+ self::$overflowed = false;
+ self::$sendHeaders = true;
+ self::$json['rows'] = array();
+ }
+
+ protected function sendHeader($header, $content)
+ {
+ $this->headers[$header] = $content;
+ }
+
+ public function getHeaders()
+ {
+ return $this->headers;
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php
new file mode 100644
index 0000000..9fc4b38
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php
@@ -0,0 +1,31 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class CouchDBHandlerTest extends TestCase
+{
+ public function testHandle()
+ {
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new CouchDBHandler();
+
+ try {
+ $handler->handle($record);
+ } catch (\RuntimeException $e) {
+ $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984');
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php
new file mode 100644
index 0000000..e2aff86
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php
@@ -0,0 +1,165 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class DeduplicationHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\DeduplicationHandler::flush
+ */
+ public function testFlushPassthruIfAllRecordsUnderTrigger()
+ {
+ $test = new TestHandler();
+ @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+ $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+
+ $handler->flush();
+
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertFalse($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\DeduplicationHandler::flush
+ * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+ */
+ public function testFlushPassthruIfEmptyLog()
+ {
+ $test = new TestHandler();
+ @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+ $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+ $handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar'));
+ $handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar"));
+
+ $handler->flush();
+
+ $this->assertTrue($test->hasErrorRecords());
+ $this->assertTrue($test->hasCriticalRecords());
+ $this->assertFalse($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\DeduplicationHandler::flush
+ * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+ * @covers Monolog\Handler\DeduplicationHandler::isDuplicate
+ * @depends testFlushPassthruIfEmptyLog
+ */
+ public function testFlushSkipsIfLogExists()
+ {
+ $test = new TestHandler();
+ $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+ $handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar'));
+ $handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar"));
+
+ $handler->flush();
+
+ $this->assertFalse($test->hasErrorRecords());
+ $this->assertFalse($test->hasCriticalRecords());
+ $this->assertFalse($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\DeduplicationHandler::flush
+ * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+ * @covers Monolog\Handler\DeduplicationHandler::isDuplicate
+ * @depends testFlushPassthruIfEmptyLog
+ */
+ public function testFlushPassthruIfLogTooOld()
+ {
+ $test = new TestHandler();
+ $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+ $record = $this->getRecord(Logger::ERROR);
+ $record['datetime']->modify('+62seconds');
+ $handler->handle($record);
+ $record = $this->getRecord(Logger::CRITICAL);
+ $record['datetime']->modify('+62seconds');
+ $handler->handle($record);
+
+ $handler->flush();
+
+ $this->assertTrue($test->hasErrorRecords());
+ $this->assertTrue($test->hasCriticalRecords());
+ $this->assertFalse($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\DeduplicationHandler::flush
+ * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+ * @covers Monolog\Handler\DeduplicationHandler::isDuplicate
+ * @covers Monolog\Handler\DeduplicationHandler::collectLogs
+ */
+ public function testGcOldLogs()
+ {
+ $test = new TestHandler();
+ @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+ $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+ // handle two records from yesterday, and one recent
+ $record = $this->getRecord(Logger::ERROR);
+ $record['datetime']->modify('-1day -10seconds');
+ $handler->handle($record);
+ $record2 = $this->getRecord(Logger::CRITICAL);
+ $record2['datetime']->modify('-1day -10seconds');
+ $handler->handle($record2);
+ $record3 = $this->getRecord(Logger::CRITICAL);
+ $record3['datetime']->modify('-30seconds');
+ $handler->handle($record3);
+
+ // log is written as none of them are duplicate
+ $handler->flush();
+ $this->assertSame(
+ $record['datetime']->getTimestamp() . ":ERROR:test\n" .
+ $record2['datetime']->getTimestamp() . ":CRITICAL:test\n" .
+ $record3['datetime']->getTimestamp() . ":CRITICAL:test\n",
+ file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log')
+ );
+ $this->assertTrue($test->hasErrorRecords());
+ $this->assertTrue($test->hasCriticalRecords());
+ $this->assertFalse($test->hasWarningRecords());
+
+ // clear test handler
+ $test->clear();
+ $this->assertFalse($test->hasErrorRecords());
+ $this->assertFalse($test->hasCriticalRecords());
+
+ // log new records, duplicate log gets GC'd at the end of this flush call
+ $handler->handle($record = $this->getRecord(Logger::ERROR));
+ $handler->handle($record2 = $this->getRecord(Logger::CRITICAL));
+ $handler->flush();
+
+ // log should now contain the new errors and the previous one that was recent enough
+ $this->assertSame(
+ $record3['datetime']->getTimestamp() . ":CRITICAL:test\n" .
+ $record['datetime']->getTimestamp() . ":ERROR:test\n" .
+ $record2['datetime']->getTimestamp() . ":CRITICAL:test\n",
+ file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log')
+ );
+ $this->assertTrue($test->hasErrorRecords());
+ $this->assertTrue($test->hasCriticalRecords());
+ $this->assertFalse($test->hasWarningRecords());
+ }
+
+ public static function tearDownAfterClass()
+ {
+ @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php
new file mode 100644
index 0000000..d67da90
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php
@@ -0,0 +1,52 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class DoctrineCouchDBHandlerTest extends TestCase
+{
+ protected function setup()
+ {
+ if (!class_exists('Doctrine\CouchDB\CouchDBClient')) {
+ $this->markTestSkipped('The "doctrine/couchdb" package is not installed');
+ }
+ }
+
+ public function testHandle()
+ {
+ $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient')
+ ->setMethods(array('postDocument'))
+ ->disableOriginalConstructor()
+ ->getMock();
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ 'message' => 'test',
+ 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+ 'level' => Logger::WARNING,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+ 'extra' => array(),
+ );
+
+ $client->expects($this->once())
+ ->method('postDocument')
+ ->with($expected);
+
+ $handler = new DoctrineCouchDBHandler($client);
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php
new file mode 100644
index 0000000..f3a6968
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php
@@ -0,0 +1,75 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class DynamoDbHandlerTest extends TestCase
+{
+ private $client;
+
+ public function setUp()
+ {
+ if (!class_exists('Aws\DynamoDb\DynamoDbClient')) {
+ $this->markTestSkipped('aws/aws-sdk-php not installed');
+ }
+
+ $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient')
+ ->setMethods(array('formatAttributes', '__call'))
+ ->disableOriginalConstructor()->getMock();
+ }
+
+ public function testConstruct()
+ {
+ $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo'));
+ }
+
+ public function testInterface()
+ {
+ $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo'));
+ }
+
+ public function testGetFormatter()
+ {
+ $handler = new DynamoDbHandler($this->client, 'foo');
+ $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter());
+ }
+
+ public function testHandle()
+ {
+ $record = $this->getRecord();
+ $formatter = $this->getMock('Monolog\Formatter\FormatterInterface');
+ $formatted = array('foo' => 1, 'bar' => 2);
+ $handler = new DynamoDbHandler($this->client, 'foo');
+ $handler->setFormatter($formatter);
+
+ $formatter
+ ->expects($this->once())
+ ->method('format')
+ ->with($record)
+ ->will($this->returnValue($formatted));
+ $this->client
+ ->expects($this->once())
+ ->method('formatAttributes')
+ ->with($this->isType('array'))
+ ->will($this->returnValue($formatted));
+ $this->client
+ ->expects($this->once())
+ ->method('__call')
+ ->with('putItem', array(array(
+ 'TableName' => 'foo',
+ 'Item' => $formatted,
+ )));
+
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php
new file mode 100644
index 0000000..1687074
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php
@@ -0,0 +1,239 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ElasticaFormatter;
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Elastica\Client;
+use Elastica\Request;
+use Elastica\Response;
+
+class ElasticSearchHandlerTest extends TestCase
+{
+ /**
+ * @var Client mock
+ */
+ protected $client;
+
+ /**
+ * @var array Default handler options
+ */
+ protected $options = array(
+ 'index' => 'my_index',
+ 'type' => 'doc_type',
+ );
+
+ public function setUp()
+ {
+ // Elastica lib required
+ if (!class_exists("Elastica\Client")) {
+ $this->markTestSkipped("ruflin/elastica not installed");
+ }
+
+ // base mock Elastica Client object
+ $this->client = $this->getMockBuilder('Elastica\Client')
+ ->setMethods(array('addDocuments'))
+ ->disableOriginalConstructor()
+ ->getMock();
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::write
+ * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+ * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+ * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+ */
+ public function testHandle()
+ {
+ // log message
+ $msg = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ // format expected result
+ $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']);
+ $expected = array($formatter->format($msg));
+
+ // setup ES client mock
+ $this->client->expects($this->any())
+ ->method('addDocuments')
+ ->with($expected);
+
+ // perform tests
+ $handler = new ElasticSearchHandler($this->client, $this->options);
+ $handler->handle($msg);
+ $handler->handleBatch(array($msg));
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::setFormatter
+ */
+ public function testSetFormatter()
+ {
+ $handler = new ElasticSearchHandler($this->client);
+ $formatter = new ElasticaFormatter('index_new', 'type_new');
+ $handler->setFormatter($formatter);
+ $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter());
+ $this->assertEquals('index_new', $handler->getFormatter()->getIndex());
+ $this->assertEquals('type_new', $handler->getFormatter()->getType());
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::setFormatter
+ * @expectedException InvalidArgumentException
+ * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter
+ */
+ public function testSetFormatterInvalid()
+ {
+ $handler = new ElasticSearchHandler($this->client);
+ $formatter = new NormalizerFormatter();
+ $handler->setFormatter($formatter);
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::__construct
+ * @covers Monolog\Handler\ElasticSearchHandler::getOptions
+ */
+ public function testOptions()
+ {
+ $expected = array(
+ 'index' => $this->options['index'],
+ 'type' => $this->options['type'],
+ 'ignore_error' => false,
+ );
+ $handler = new ElasticSearchHandler($this->client, $this->options);
+ $this->assertEquals($expected, $handler->getOptions());
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+ * @dataProvider providerTestConnectionErrors
+ */
+ public function testConnectionErrors($ignore, $expectedError)
+ {
+ $clientOpts = array('host' => '127.0.0.1', 'port' => 1);
+ $client = new Client($clientOpts);
+ $handlerOpts = array('ignore_error' => $ignore);
+ $handler = new ElasticSearchHandler($client, $handlerOpts);
+
+ if ($expectedError) {
+ $this->setExpectedException($expectedError[0], $expectedError[1]);
+ $handler->handle($this->getRecord());
+ } else {
+ $this->assertFalse($handler->handle($this->getRecord()));
+ }
+ }
+
+ /**
+ * @return array
+ */
+ public function providerTestConnectionErrors()
+ {
+ return array(
+ array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')),
+ array(true, false),
+ );
+ }
+
+ /**
+ * Integration test using localhost Elastic Search server
+ *
+ * @covers Monolog\Handler\ElasticSearchHandler::__construct
+ * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+ * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+ * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+ */
+ public function testHandleIntegration()
+ {
+ $msg = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $expected = $msg;
+ $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601);
+ $expected['context'] = array(
+ 'class' => '[object] (stdClass: {})',
+ 'foo' => 7,
+ 0 => 'bar',
+ );
+
+ $client = new Client();
+ $handler = new ElasticSearchHandler($client, $this->options);
+ try {
+ $handler->handleBatch(array($msg));
+ } catch (\RuntimeException $e) {
+ $this->markTestSkipped("Cannot connect to Elastic Search server on localhost");
+ }
+
+ // check document id from ES server response
+ $documentId = $this->getCreatedDocId($client->getLastResponse());
+ $this->assertNotEmpty($documentId, 'No elastic document id received');
+
+ // retrieve document source from ES and validate
+ $document = $this->getDocSourceFromElastic(
+ $client,
+ $this->options['index'],
+ $this->options['type'],
+ $documentId
+ );
+ $this->assertEquals($expected, $document);
+
+ // remove test index from ES
+ $client->request("/{$this->options['index']}", Request::DELETE);
+ }
+
+ /**
+ * Return last created document id from ES response
+ * @param Response $response Elastica Response object
+ * @return string|null
+ */
+ protected function getCreatedDocId(Response $response)
+ {
+ $data = $response->getData();
+ if (!empty($data['items'][0]['create']['_id'])) {
+ return $data['items'][0]['create']['_id'];
+ }
+ }
+
+ /**
+ * Retrieve document by id from Elasticsearch
+ * @param Client $client Elastica client
+ * @param string $index
+ * @param string $type
+ * @param string $documentId
+ * @return array
+ */
+ protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId)
+ {
+ $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET);
+ $data = $resp->getData();
+ if (!empty($data['_source'])) {
+ return $data['_source'];
+ }
+
+ return array();
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php
new file mode 100644
index 0000000..99785cb
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php
@@ -0,0 +1,66 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+function error_log()
+{
+ $GLOBALS['error_log'][] = func_get_args();
+}
+
+class ErrorLogHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ $GLOBALS['error_log'] = array();
+ }
+
+ /**
+ * @covers Monolog\Handler\ErrorLogHandler::__construct
+ * @expectedException InvalidArgumentException
+ * @expectedExceptionMessage The given message type "42" is not supported
+ */
+ public function testShouldNotAcceptAnInvalidTypeOnContructor()
+ {
+ new ErrorLogHandler(42);
+ }
+
+ /**
+ * @covers Monolog\Handler\ErrorLogHandler::write
+ */
+ public function testShouldLogMessagesUsingErrorLogFuncion()
+ {
+ $type = ErrorLogHandler::OPERATING_SYSTEM;
+ $handler = new ErrorLogHandler($type);
+ $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true));
+ $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+ $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]);
+ $this->assertSame($GLOBALS['error_log'][0][1], $type);
+
+ $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true);
+ $handler->setFormatter(new LineFormatter(null, null, true));
+ $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+ $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]);
+ $this->assertSame($GLOBALS['error_log'][1][1], $type);
+
+ $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]);
+ $this->assertSame($GLOBALS['error_log'][2][1], $type);
+
+ $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]);
+ $this->assertSame($GLOBALS['error_log'][3][1], $type);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php
new file mode 100644
index 0000000..31b7686
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php
@@ -0,0 +1,170 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FilterHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\FilterHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY)));
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+ * @covers Monolog\Handler\FilterHandler::isHandling
+ */
+ public function testHandleProcessOnlyNeededLevels()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertTrue($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::NOTICE));
+ $this->assertTrue($test->hasNoticeRecords());
+
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertFalse($test->hasWarningRecords());
+ $handler->handle($this->getRecord(Logger::ERROR));
+ $this->assertFalse($test->hasErrorRecords());
+ $handler->handle($this->getRecord(Logger::CRITICAL));
+ $this->assertFalse($test->hasCriticalRecords());
+ $handler->handle($this->getRecord(Logger::ALERT));
+ $this->assertFalse($test->hasAlertRecords());
+ $handler->handle($this->getRecord(Logger::EMERGENCY));
+ $this->assertFalse($test->hasEmergencyRecords());
+
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR));
+
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertTrue($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::NOTICE));
+ $this->assertFalse($test->hasNoticeRecords());
+ $handler->handle($this->getRecord(Logger::ERROR));
+ $this->assertTrue($test->hasErrorRecords());
+ $handler->handle($this->getRecord(Logger::CRITICAL));
+ $this->assertFalse($test->hasCriticalRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+ * @covers Monolog\Handler\FilterHandler::getAcceptedLevels
+ */
+ public function testAcceptedLevelApi()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test);
+
+ $levels = array(Logger::INFO, Logger::ERROR);
+ $handler->setAcceptedLevels($levels);
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+
+ $handler->setAcceptedLevels(array('info', 'error'));
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+
+ $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY);
+ $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY);
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+
+ $handler->setAcceptedLevels('critical', 'emergency');
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY);
+ $handler->pushProcessor(
+ function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ }
+ );
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ */
+ public function testHandleRespectsBubble()
+ {
+ $test = new TestHandler();
+
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false);
+ $this->assertTrue($handler->handle($this->getRecord(Logger::INFO)));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true);
+ $this->assertFalse($handler->handle($this->getRecord(Logger::INFO)));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ */
+ public function testHandleWithCallback()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler(
+ function ($record, $handler) use ($test) {
+ return $test;
+ }, Logger::INFO, Logger::NOTICE, false
+ );
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ * @expectedException \RuntimeException
+ */
+ public function testHandleWithBadCallbackThrowsException()
+ {
+ $handler = new FilterHandler(
+ function ($record, $handler) {
+ return 'foo';
+ }
+ );
+ $handler->handle($this->getRecord(Logger::WARNING));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php
new file mode 100644
index 0000000..8e31e9b
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php
@@ -0,0 +1,255 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy;
+use Psr\Log\LogLevel;
+
+class FingersCrossedHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::__construct
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleBuffers()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->close();
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 3);
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleStopsBufferingAfterTrigger()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test);
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ * @covers Monolog\Handler\FingersCrossedHandler::reset
+ */
+ public function testHandleRestartBufferingAfterReset()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test);
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->reset();
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleBufferLimit()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::WARNING, 2);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertFalse($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleWithCallback()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) {
+ return $test;
+ });
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 3);
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ * @expectedException RuntimeException
+ */
+ public function testHandleWithBadCallbackThrowsException()
+ {
+ $handler = new FingersCrossedHandler(function ($record, $handler) {
+ return 'foo';
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::isHandling
+ */
+ public function testIsHandlingAlways()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::ERROR);
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+ */
+ public function testErrorLevelActivationStrategy()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+ */
+ public function testErrorLevelActivationStrategyWithPsrLevel()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning'));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+ */
+ public function testChannelLevelActivationStrategy()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG)));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertFalse($test->hasWarningRecords());
+ $record = $this->getRecord(Logger::DEBUG);
+ $record['channel'] = 'othertest';
+ $handler->handle($record);
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+ */
+ public function testChannelLevelActivationStrategyWithPsrLevels()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug')));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertFalse($test->hasWarningRecords());
+ $record = $this->getRecord(Logger::DEBUG);
+ $record['channel'] = 'othertest';
+ $handler->handle($record);
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::INFO);
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::close
+ */
+ public function testPassthruOnClose()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::close
+ */
+ public function testPsrLevelPassthruOnClose()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, LogLevel::INFO);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php
new file mode 100644
index 0000000..0eb10a6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php
@@ -0,0 +1,96 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\FirePHPHandler
+ */
+class FirePHPHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ TestFirePHPHandler::reset();
+ $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0';
+ }
+
+ public function testHeaders()
+ {
+ $handler = new TestFirePHPHandler;
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+ 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+ 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+ 'X-Wf-1-1-1-1' => 'test',
+ 'X-Wf-1-1-1-2' => 'test',
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ }
+
+ public function testConcurrentHandlers()
+ {
+ $handler = new TestFirePHPHandler;
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $handler2 = new TestFirePHPHandler;
+ $handler2->setFormatter($this->getIdentityFormatter());
+ $handler2->handle($this->getRecord(Logger::DEBUG));
+ $handler2->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+ 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+ 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+ 'X-Wf-1-1-1-1' => 'test',
+ 'X-Wf-1-1-1-2' => 'test',
+ );
+
+ $expected2 = array(
+ 'X-Wf-1-1-1-3' => 'test',
+ 'X-Wf-1-1-1-4' => 'test',
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ $this->assertEquals($expected2, $handler2->getHeaders());
+ }
+}
+
+class TestFirePHPHandler extends FirePHPHandler
+{
+ protected $headers = array();
+
+ public static function reset()
+ {
+ self::$initialized = false;
+ self::$sendHeaders = true;
+ self::$messageIndex = 1;
+ }
+
+ protected function sendHeader($header, $content)
+ {
+ $this->headers[$header] = $content;
+ }
+
+ public function getHeaders()
+ {
+ return $this->headers;
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/Fixtures/.gitkeep b/vendor/monolog/monolog/tests/Monolog/Handler/Fixtures/.gitkeep
new file mode 100644
index 0000000..e69de29
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php
new file mode 100644
index 0000000..91cdd31
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php
@@ -0,0 +1,85 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+use Monolog\TestCase;
+
+/**
+ * @coversDefaultClass \Monolog\Handler\FleepHookHandler
+ */
+class FleepHookHandlerTest extends TestCase
+{
+ /**
+ * Default token to use in tests
+ */
+ const TOKEN = '123abc';
+
+ /**
+ * @var FleepHookHandler
+ */
+ private $handler;
+
+ public function setUp()
+ {
+ parent::setUp();
+
+ if (!extension_loaded('openssl')) {
+ $this->markTestSkipped('This test requires openssl extension to run');
+ }
+
+ // Create instances of the handler and logger for convenience
+ $this->handler = new FleepHookHandler(self::TOKEN);
+ }
+
+ /**
+ * @covers ::__construct
+ */
+ public function testConstructorSetsExpectedDefaults()
+ {
+ $this->assertEquals(Logger::DEBUG, $this->handler->getLevel());
+ $this->assertEquals(true, $this->handler->getBubble());
+ }
+
+ /**
+ * @covers ::getDefaultFormatter
+ */
+ public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays()
+ {
+ $record = array(
+ 'message' => 'msg',
+ 'context' => array(),
+ 'level' => Logger::DEBUG,
+ 'level_name' => Logger::getLevelName(Logger::DEBUG),
+ 'channel' => 'channel',
+ 'datetime' => new \DateTime(),
+ 'extra' => array(),
+ );
+
+ $expectedFormatter = new LineFormatter(null, null, true, true);
+ $expected = $expectedFormatter->format($record);
+
+ $handlerFormatter = $this->handler->getFormatter();
+ $actual = $handlerFormatter->format($record);
+
+ $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered');
+ }
+
+ /**
+ * @covers ::__construct
+ */
+ public function testConnectionStringisConstructedCorrectly()
+ {
+ $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php
new file mode 100644
index 0000000..4b120d5
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php
@@ -0,0 +1,88 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FlowdockFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Dominik Liebler
+ * @see https://www.hipchat.com/docs/api
+ */
+class FlowdockHandlerTest extends TestCase
+{
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @var FlowdockHandler
+ */
+ private $handler;
+
+ public function setUp()
+ {
+ if (!extension_loaded('openssl')) {
+ $this->markTestSkipped('This test requires openssl to run');
+ }
+ }
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ /**
+ * @depends testWriteHeader
+ */
+ public function testWriteContent($content)
+ {
+ $this->assertRegexp('/"source":"test_source"/', $content);
+ $this->assertRegexp('/"from_address":"source@test\.com"/', $content);
+ }
+
+ private function createHandler($token = 'myToken')
+ {
+ $constructorArgs = array($token, Logger::DEBUG);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\FlowdockHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com'));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php
new file mode 100644
index 0000000..9d007b1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php
@@ -0,0 +1,95 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerLegacyTest extends TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) {
+ $this->markTestSkipped("mlehner/gelf-php not installed");
+ }
+
+ require_once __DIR__ . '/GelfMockMessagePublisher.php';
+ }
+
+ /**
+ * @covers Monolog\Handler\GelfHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new GelfHandler($this->getMessagePublisher());
+ $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+ }
+
+ protected function getHandler($messagePublisher)
+ {
+ $handler = new GelfHandler($messagePublisher);
+
+ return $handler;
+ }
+
+ protected function getMessagePublisher()
+ {
+ return new GelfMockMessagePublisher('localhost');
+ }
+
+ public function testDebug()
+ {
+ $messagePublisher = $this->getMessagePublisher();
+ $handler = $this->getHandler($messagePublisher);
+
+ $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+ $handler->handle($record);
+
+ $this->assertEquals(7, $messagePublisher->lastMessage->getLevel());
+ $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+ $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+ $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+ }
+
+ public function testWarning()
+ {
+ $messagePublisher = $this->getMessagePublisher();
+ $handler = $this->getHandler($messagePublisher);
+
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $handler->handle($record);
+
+ $this->assertEquals(4, $messagePublisher->lastMessage->getLevel());
+ $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+ $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+ $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+ }
+
+ public function testInjectedGelfMessageFormatter()
+ {
+ $messagePublisher = $this->getMessagePublisher();
+ $handler = $this->getHandler($messagePublisher);
+
+ $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $record['extra']['blarg'] = 'yep';
+ $record['context']['from'] = 'logger';
+ $handler->handle($record);
+
+ $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost());
+ $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray());
+ $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php
new file mode 100644
index 0000000..8cdd64f
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php
@@ -0,0 +1,117 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) {
+ $this->markTestSkipped("graylog2/gelf-php not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\GelfHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new GelfHandler($this->getMessagePublisher());
+ $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+ }
+
+ protected function getHandler($messagePublisher)
+ {
+ $handler = new GelfHandler($messagePublisher);
+
+ return $handler;
+ }
+
+ protected function getMessagePublisher()
+ {
+ return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false);
+ }
+
+ public function testDebug()
+ {
+ $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+ $expectedMessage = new Message();
+ $expectedMessage
+ ->setLevel(7)
+ ->setFacility("test")
+ ->setShortMessage($record['message'])
+ ->setTimestamp($record['datetime'])
+ ;
+
+ $messagePublisher = $this->getMessagePublisher();
+ $messagePublisher->expects($this->once())
+ ->method('publish')
+ ->with($expectedMessage);
+
+ $handler = $this->getHandler($messagePublisher);
+
+ $handler->handle($record);
+ }
+
+ public function testWarning()
+ {
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $expectedMessage = new Message();
+ $expectedMessage
+ ->setLevel(4)
+ ->setFacility("test")
+ ->setShortMessage($record['message'])
+ ->setTimestamp($record['datetime'])
+ ;
+
+ $messagePublisher = $this->getMessagePublisher();
+ $messagePublisher->expects($this->once())
+ ->method('publish')
+ ->with($expectedMessage);
+
+ $handler = $this->getHandler($messagePublisher);
+
+ $handler->handle($record);
+ }
+
+ public function testInjectedGelfMessageFormatter()
+ {
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $record['extra']['blarg'] = 'yep';
+ $record['context']['from'] = 'logger';
+
+ $expectedMessage = new Message();
+ $expectedMessage
+ ->setLevel(4)
+ ->setFacility("test")
+ ->setHost("mysystem")
+ ->setShortMessage($record['message'])
+ ->setTimestamp($record['datetime'])
+ ->setAdditional("EXTblarg", 'yep')
+ ->setAdditional("CTXfrom", 'logger')
+ ;
+
+ $messagePublisher = $this->getMessagePublisher();
+ $messagePublisher->expects($this->once())
+ ->method('publish')
+ ->with($expectedMessage);
+
+ $handler = $this->getHandler($messagePublisher);
+ $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php
new file mode 100644
index 0000000..873d92f
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php
@@ -0,0 +1,25 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\MessagePublisher;
+use Gelf\Message;
+
+class GelfMockMessagePublisher extends MessagePublisher
+{
+ public function publish(Message $message)
+ {
+ $this->lastMessage = $message;
+ }
+
+ public $lastMessage = null;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php
new file mode 100644
index 0000000..c6298a6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php
@@ -0,0 +1,89 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class GroupHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\GroupHandler::__construct
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorOnlyTakesHandler()
+ {
+ new GroupHandler(array(new TestHandler(), "foo"));
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::__construct
+ * @covers Monolog\Handler\GroupHandler::handle
+ */
+ public function testHandle()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new GroupHandler($testHandlers);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new GroupHandler($testHandlers);
+ $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+ $handler = new GroupHandler($testHandlers);
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new GroupHandler(array($test));
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php
new file mode 100644
index 0000000..d8d0452
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php
@@ -0,0 +1,130 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @author Alexey Karapetov
+ */
+class HandlerWrapperTest extends TestCase
+{
+ /**
+ * @var HandlerWrapper
+ */
+ private $wrapper;
+
+ private $handler;
+
+ public function setUp()
+ {
+ parent::setUp();
+ $this->handler = $this->getMock('Monolog\\Handler\\HandlerInterface');
+ $this->wrapper = new HandlerWrapper($this->handler);
+ }
+
+ /**
+ * @return array
+ */
+ public function trueFalseDataProvider()
+ {
+ return array(
+ array(true),
+ array(false),
+ );
+ }
+
+ /**
+ * @param $result
+ * @dataProvider trueFalseDataProvider
+ */
+ public function testIsHandling($result)
+ {
+ $record = $this->getRecord();
+ $this->handler->expects($this->once())
+ ->method('isHandling')
+ ->with($record)
+ ->willReturn($result);
+
+ $this->assertEquals($result, $this->wrapper->isHandling($record));
+ }
+
+ /**
+ * @param $result
+ * @dataProvider trueFalseDataProvider
+ */
+ public function testHandle($result)
+ {
+ $record = $this->getRecord();
+ $this->handler->expects($this->once())
+ ->method('handle')
+ ->with($record)
+ ->willReturn($result);
+
+ $this->assertEquals($result, $this->wrapper->handle($record));
+ }
+
+ /**
+ * @param $result
+ * @dataProvider trueFalseDataProvider
+ */
+ public function testHandleBatch($result)
+ {
+ $records = $this->getMultipleRecords();
+ $this->handler->expects($this->once())
+ ->method('handleBatch')
+ ->with($records)
+ ->willReturn($result);
+
+ $this->assertEquals($result, $this->wrapper->handleBatch($records));
+ }
+
+ public function testPushProcessor()
+ {
+ $processor = function () {};
+ $this->handler->expects($this->once())
+ ->method('pushProcessor')
+ ->with($processor);
+
+ $this->assertEquals($this->wrapper, $this->wrapper->pushProcessor($processor));
+ }
+
+ public function testPopProcessor()
+ {
+ $processor = function () {};
+ $this->handler->expects($this->once())
+ ->method('popProcessor')
+ ->willReturn($processor);
+
+ $this->assertEquals($processor, $this->wrapper->popProcessor());
+ }
+
+ public function testSetFormatter()
+ {
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $this->handler->expects($this->once())
+ ->method('setFormatter')
+ ->with($formatter);
+
+ $this->assertEquals($this->wrapper, $this->wrapper->setFormatter($formatter));
+ }
+
+ public function testGetFormatter()
+ {
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $this->handler->expects($this->once())
+ ->method('getFormatter')
+ ->willReturn($formatter);
+
+ $this->assertEquals($formatter, $this->wrapper->getFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php
new file mode 100644
index 0000000..52dc9da
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php
@@ -0,0 +1,279 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Rafael Dohms
+ * @see https://www.hipchat.com/docs/api
+ */
+class HipChatHandlerTest extends TestCase
+{
+ private $res;
+ /** @var HipChatHandler */
+ private $handler;
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testWriteCustomHostHeader()
+ {
+ $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testWriteV2()
+ {
+ $this->createHandler('myToken', 'room1', 'Monolog', false, 'hipchat.foo.bar', 'v2');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testWriteV2Notify()
+ {
+ $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar', 'v2');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testRoomSpaces()
+ {
+ $this->createHandler('myToken', 'room name', 'Monolog', false, 'hipchat.foo.bar', 'v2');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v2\/room\/room%20name\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ /**
+ * @depends testWriteHeader
+ */
+ public function testWriteContent($content)
+ {
+ $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
+ }
+
+ public function testWriteContentV1WithoutName()
+ {
+ $this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v1');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=$/', $content);
+
+ return $content;
+ }
+
+ /**
+ * @depends testWriteCustomHostHeader
+ */
+ public function testWriteContentNotify($content)
+ {
+ $this->assertRegexp('/notify=1&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
+ }
+
+ /**
+ * @depends testWriteV2
+ */
+ public function testWriteContentV2($content)
+ {
+ $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red&from=Monolog$/', $content);
+ }
+
+ /**
+ * @depends testWriteV2Notify
+ */
+ public function testWriteContentV2Notify($content)
+ {
+ $this->assertRegexp('/notify=true&message=test1&message_format=text&color=red&from=Monolog$/', $content);
+ }
+
+ public function testWriteContentV2WithoutName()
+ {
+ $this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v2');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red$/', $content);
+
+ return $content;
+ }
+
+ public function testWriteWithComplexMessage()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+ }
+
+ public function testWriteTruncatesLongMessage()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, str_repeat('abcde', 2000)));
+ fseek($this->res, 0);
+ $content = fread($this->res, 12000);
+
+ $this->assertRegexp('/message='.str_repeat('abcde', 1900).'\+%5Btruncated%5D/', $content);
+ }
+
+ /**
+ * @dataProvider provideLevelColors
+ */
+ public function testWriteWithErrorLevelsAndColors($level, $expectedColor)
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/color='.$expectedColor.'/', $content);
+ }
+
+ public function provideLevelColors()
+ {
+ return array(
+ array(Logger::DEBUG, 'gray'),
+ array(Logger::INFO, 'green'),
+ array(Logger::WARNING, 'yellow'),
+ array(Logger::ERROR, 'red'),
+ array(Logger::CRITICAL, 'red'),
+ array(Logger::ALERT, 'red'),
+ array(Logger::EMERGENCY,'red'),
+ array(Logger::NOTICE, 'green'),
+ );
+ }
+
+ /**
+ * @dataProvider provideBatchRecords
+ */
+ public function testHandleBatch($records, $expectedColor)
+ {
+ $this->createHandler();
+
+ $this->handler->handleBatch($records);
+
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/color='.$expectedColor.'/', $content);
+ }
+
+ public function provideBatchRecords()
+ {
+ return array(
+ array(
+ array(
+ array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+ array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+ array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime()),
+ ),
+ 'red',
+ ),
+ array(
+ array(
+ array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+ array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+ ),
+ 'yellow',
+ ),
+ array(
+ array(
+ array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+ array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+ ),
+ 'green',
+ ),
+ array(
+ array(
+ array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+ ),
+ 'gray',
+ ),
+ );
+ }
+
+ private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false, $host = 'api.hipchat.com', $version = 'v1')
+ {
+ $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG, true, true, 'text', $host, $version);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\HipChatHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testCreateWithTooLongName()
+ {
+ $hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere');
+ }
+
+ public function testCreateWithTooLongNameV2()
+ {
+ // creating a handler with too long of a name but using the v2 api doesn't matter.
+ $hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere', false, Logger::CRITICAL, true, true, 'test', 'api.hipchat.com', 'v2');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php
new file mode 100644
index 0000000..b2deb40
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php
@@ -0,0 +1,84 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III
+ */
+class LogEntriesHandlerTest extends TestCase
+{
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @var LogEntriesHandler
+ */
+ private $handler;
+
+ public function testWriteContent()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test'));
+
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content);
+ }
+
+ public function testWriteBatchContent()
+ {
+ $records = array(
+ $this->getRecord(),
+ $this->getRecord(),
+ $this->getRecord(),
+ );
+ $this->createHandler();
+ $this->handler->handleBatch($records);
+
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content);
+ }
+
+ private function createHandler()
+ {
+ $useSSL = extension_loaded('openssl');
+ $args = array('testToken', $useSSL, Logger::DEBUG, true);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\LogEntriesHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $args
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php
new file mode 100644
index 0000000..6754f3d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php
@@ -0,0 +1,75 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class MailHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\MailHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $formatter->expects($this->once())
+ ->method('formatBatch'); // Each record is formatted
+
+ $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+ $handler->expects($this->once())
+ ->method('send');
+ $handler->expects($this->never())
+ ->method('write'); // write is for individual records
+
+ $handler->setFormatter($formatter);
+
+ $handler->handleBatch($this->getMultipleRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\MailHandler::handleBatch
+ */
+ public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel()
+ {
+ $records = array(
+ $this->getRecord(Logger::DEBUG, 'debug message 1'),
+ $this->getRecord(Logger::DEBUG, 'debug message 2'),
+ $this->getRecord(Logger::INFO, 'information'),
+ );
+
+ $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+ $handler->expects($this->never())
+ ->method('send');
+ $handler->setLevel(Logger::ERROR);
+
+ $handler->handleBatch($records);
+ }
+
+ /**
+ * @covers Monolog\Handler\MailHandler::write
+ */
+ public function testHandle()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+
+ $record = $this->getRecord();
+ $records = array($record);
+ $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n";
+
+ $handler->expects($this->once())
+ ->method('send')
+ ->with($records[0]['formatted'], $records);
+
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php
new file mode 100644
index 0000000..a083322
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php
@@ -0,0 +1,27 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Raven_Client;
+
+class MockRavenClient extends Raven_Client
+{
+ public function capture($data, $stack, $vars = null)
+ {
+ $data = array_merge($this->get_user_data(), $data);
+ $this->lastData = $data;
+ $this->lastStack = $stack;
+ }
+
+ public $lastData;
+ public $lastStack;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php
new file mode 100644
index 0000000..0fdef63
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php
@@ -0,0 +1,65 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class MongoDBHandlerTest extends TestCase
+{
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorShouldThrowExceptionForInvalidMongo()
+ {
+ new MongoDBHandler(new \stdClass(), 'DB', 'Collection');
+ }
+
+ public function testHandle()
+ {
+ $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false);
+ $collection = $this->getMock('stdClass', array('save'));
+
+ $mongo->expects($this->once())
+ ->method('selectCollection')
+ ->with('DB', 'Collection')
+ ->will($this->returnValue($collection));
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ 'message' => 'test',
+ 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+ 'level' => Logger::WARNING,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+ 'extra' => array(),
+ );
+
+ $collection->expects($this->once())
+ ->method('save')
+ ->with($expected);
+
+ $handler = new MongoDBHandler($mongo, 'DB', 'Collection');
+ $handler->handle($record);
+ }
+}
+
+if (!class_exists('Mongo')) {
+ class Mongo
+ {
+ public function selectCollection()
+ {
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php
new file mode 100644
index 0000000..ddf545d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php
@@ -0,0 +1,111 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use InvalidArgumentException;
+
+function mail($to, $subject, $message, $additional_headers = null, $additional_parameters = null)
+{
+ $GLOBALS['mail'][] = func_get_args();
+}
+
+class NativeMailerHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ $GLOBALS['mail'] = array();
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorHeaderInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org");
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterHeaderInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org");
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterArrayHeaderInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org"));
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterContentTypeInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->setContentType("text/html\r\nFrom: faked@attacker.org");
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterEncodingInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org");
+ }
+
+ public function testSend()
+ {
+ $to = 'spammer@example.org';
+ $subject = 'dear victim';
+ $from = 'receiver@example.org';
+
+ $mailer = new NativeMailerHandler($to, $subject, $from);
+ $mailer->handleBatch(array());
+
+ // batch is empty, nothing sent
+ $this->assertEmpty($GLOBALS['mail']);
+
+ // non-empty batch
+ $mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+ $this->assertNotEmpty($GLOBALS['mail']);
+ $this->assertInternalType('array', $GLOBALS['mail']);
+ $this->assertArrayHasKey('0', $GLOBALS['mail']);
+ $params = $GLOBALS['mail'][0];
+ $this->assertCount(5, $params);
+ $this->assertSame($to, $params[0]);
+ $this->assertSame($subject, $params[1]);
+ $this->assertStringEndsWith(" test.ERROR: Foo Bar Baz [] []\n", $params[2]);
+ $this->assertSame("From: $from\r\nContent-type: text/plain; charset=utf-8\r\n", $params[3]);
+ $this->assertSame('', $params[4]);
+ }
+
+ public function testMessageSubjectFormatting()
+ {
+ $mailer = new NativeMailerHandler('to@example.org', 'Alert: %level_name% %message%', 'from@example.org');
+ $mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+ $this->assertNotEmpty($GLOBALS['mail']);
+ $this->assertInternalType('array', $GLOBALS['mail']);
+ $this->assertArrayHasKey('0', $GLOBALS['mail']);
+ $params = $GLOBALS['mail'][0];
+ $this->assertCount(5, $params);
+ $this->assertSame('Alert: ERROR Foo Bar Baz', $params[1]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php
new file mode 100644
index 0000000..4eda615
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php
@@ -0,0 +1,192 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class NewRelicHandlerTest extends TestCase
+{
+ public static $appname;
+ public static $customParameters;
+ public static $transactionName;
+
+ public function setUp()
+ {
+ self::$appname = null;
+ self::$customParameters = array();
+ self::$transactionName = null;
+ }
+
+ /**
+ * @expectedException Monolog\Handler\MissingExtensionException
+ */
+ public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded()
+ {
+ $handler = new StubNewRelicHandlerWithoutExtension();
+ $handler->handle($this->getRecord(Logger::ERROR));
+ }
+
+ public function testThehandlerCanHandleTheRecord()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR));
+ }
+
+ public function testThehandlerCanAddContextParamsToTheNewRelicTrace()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')));
+ $this->assertEquals(array('context_a' => 'b'), self::$customParameters);
+ }
+
+ public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace()
+ {
+ $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+ $handler->handle($this->getRecord(
+ Logger::ERROR,
+ 'log message',
+ array('a' => array('key1' => 'value1', 'key2' => 'value2'))
+ ));
+ $this->assertEquals(
+ array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'),
+ self::$customParameters
+ );
+ }
+
+ public function testThehandlerCanAddExtraParamsToTheNewRelicTrace()
+ {
+ $record = $this->getRecord(Logger::ERROR, 'log message');
+ $record['extra'] = array('c' => 'd');
+
+ $handler = new StubNewRelicHandler();
+ $handler->handle($record);
+
+ $this->assertEquals(array('extra_c' => 'd'), self::$customParameters);
+ }
+
+ public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace()
+ {
+ $record = $this->getRecord(Logger::ERROR, 'log message');
+ $record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2'));
+
+ $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+ $handler->handle($record);
+
+ $this->assertEquals(
+ array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'),
+ self::$customParameters
+ );
+ }
+
+ public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace()
+ {
+ $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'));
+ $record['extra'] = array('c' => 'd');
+
+ $handler = new StubNewRelicHandler();
+ $handler->handle($record);
+
+ $expected = array(
+ 'context_a' => 'b',
+ 'extra_c' => 'd',
+ );
+
+ $this->assertEquals($expected, self::$customParameters);
+ }
+
+ public function testTheAppNameIsNullByDefault()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals(null, self::$appname);
+ }
+
+ public function testTheAppNameCanBeInjectedFromtheConstructor()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals('myAppName', self::$appname);
+ }
+
+ public function testTheAppNameCanBeOverriddenFromEachLog()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName')));
+
+ $this->assertEquals('logAppName', self::$appname);
+ }
+
+ public function testTheTransactionNameIsNullByDefault()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals(null, self::$transactionName);
+ }
+
+ public function testTheTransactionNameCanBeInjectedFromTheConstructor()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals('myTransaction', self::$transactionName);
+ }
+
+ public function testTheTransactionNameCanBeOverriddenFromEachLog()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName')));
+
+ $this->assertEquals('logTransactName', self::$transactionName);
+ }
+}
+
+class StubNewRelicHandlerWithoutExtension extends NewRelicHandler
+{
+ protected function isNewRelicEnabled()
+ {
+ return false;
+ }
+}
+
+class StubNewRelicHandler extends NewRelicHandler
+{
+ protected function isNewRelicEnabled()
+ {
+ return true;
+ }
+}
+
+function newrelic_notice_error()
+{
+ return true;
+}
+
+function newrelic_set_appname($appname)
+{
+ return NewRelicHandlerTest::$appname = $appname;
+}
+
+function newrelic_name_transaction($transactionName)
+{
+ return NewRelicHandlerTest::$transactionName = $transactionName;
+}
+
+function newrelic_add_custom_parameter($key, $value)
+{
+ NewRelicHandlerTest::$customParameters[$key] = $value;
+
+ return true;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php
new file mode 100644
index 0000000..292df78
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php
@@ -0,0 +1,33 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\NullHandler::handle
+ */
+class NullHandlerTest extends TestCase
+{
+ public function testHandle()
+ {
+ $handler = new NullHandler();
+ $this->assertTrue($handler->handle($this->getRecord()));
+ }
+
+ public function testHandleLowerLevelRecord()
+ {
+ $handler = new NullHandler(Logger::WARNING);
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php
new file mode 100644
index 0000000..152573e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php
@@ -0,0 +1,273 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Exception;
+use Monolog\ErrorHandler;
+use Monolog\Logger;
+use Monolog\TestCase;
+use PhpConsole\Connector;
+use PhpConsole\Dispatcher\Debug as DebugDispatcher;
+use PhpConsole\Dispatcher\Errors as ErrorDispatcher;
+use PhpConsole\Handler;
+use PHPUnit_Framework_MockObject_MockObject;
+
+/**
+ * @covers Monolog\Handler\PHPConsoleHandler
+ * @author Sergey Barbushin https://www.linkedin.com/in/barbushin
+ */
+class PHPConsoleHandlerTest extends TestCase
+{
+ /** @var Connector|PHPUnit_Framework_MockObject_MockObject */
+ protected $connector;
+ /** @var DebugDispatcher|PHPUnit_Framework_MockObject_MockObject */
+ protected $debugDispatcher;
+ /** @var ErrorDispatcher|PHPUnit_Framework_MockObject_MockObject */
+ protected $errorDispatcher;
+
+ protected function setUp()
+ {
+ if (!class_exists('PhpConsole\Connector')) {
+ $this->markTestSkipped('PHP Console library not found. See https://github.com/barbushin/php-console#installation');
+ }
+ $this->connector = $this->initConnectorMock();
+
+ $this->debugDispatcher = $this->initDebugDispatcherMock($this->connector);
+ $this->connector->setDebugDispatcher($this->debugDispatcher);
+
+ $this->errorDispatcher = $this->initErrorDispatcherMock($this->connector);
+ $this->connector->setErrorsDispatcher($this->errorDispatcher);
+ }
+
+ protected function initDebugDispatcherMock(Connector $connector)
+ {
+ return $this->getMockBuilder('PhpConsole\Dispatcher\Debug')
+ ->disableOriginalConstructor()
+ ->setMethods(array('dispatchDebug'))
+ ->setConstructorArgs(array($connector, $connector->getDumper()))
+ ->getMock();
+ }
+
+ protected function initErrorDispatcherMock(Connector $connector)
+ {
+ return $this->getMockBuilder('PhpConsole\Dispatcher\Errors')
+ ->disableOriginalConstructor()
+ ->setMethods(array('dispatchError', 'dispatchException'))
+ ->setConstructorArgs(array($connector, $connector->getDumper()))
+ ->getMock();
+ }
+
+ protected function initConnectorMock()
+ {
+ $connector = $this->getMockBuilder('PhpConsole\Connector')
+ ->disableOriginalConstructor()
+ ->setMethods(array(
+ 'sendMessage',
+ 'onShutDown',
+ 'isActiveClient',
+ 'setSourcesBasePath',
+ 'setServerEncoding',
+ 'setPassword',
+ 'enableSslOnlyMode',
+ 'setAllowedIpMasks',
+ 'setHeadersLimit',
+ 'startEvalRequestsListener',
+ ))
+ ->getMock();
+
+ $connector->expects($this->any())
+ ->method('isActiveClient')
+ ->will($this->returnValue(true));
+
+ return $connector;
+ }
+
+ protected function getHandlerDefaultOption($name)
+ {
+ $handler = new PHPConsoleHandler(array(), $this->connector);
+ $options = $handler->getOptions();
+
+ return $options[$name];
+ }
+
+ protected function initLogger($handlerOptions = array(), $level = Logger::DEBUG)
+ {
+ return new Logger('test', array(
+ new PHPConsoleHandler($handlerOptions, $this->connector, $level),
+ ));
+ }
+
+ public function testInitWithDefaultConnector()
+ {
+ $handler = new PHPConsoleHandler();
+ $this->assertEquals(spl_object_hash(Connector::getInstance()), spl_object_hash($handler->getConnector()));
+ }
+
+ public function testInitWithCustomConnector()
+ {
+ $handler = new PHPConsoleHandler(array(), $this->connector);
+ $this->assertEquals(spl_object_hash($this->connector), spl_object_hash($handler->getConnector()));
+ }
+
+ public function testDebug()
+ {
+ $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with($this->equalTo('test'));
+ $this->initLogger()->addDebug('test');
+ }
+
+ public function testDebugContextInMessage()
+ {
+ $message = 'test';
+ $tag = 'tag';
+ $context = array($tag, 'custom' => mt_rand());
+ $expectedMessage = $message . ' ' . json_encode(array_slice($context, 1));
+ $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
+ $this->equalTo($expectedMessage),
+ $this->equalTo($tag)
+ );
+ $this->initLogger()->addDebug($message, $context);
+ }
+
+ public function testDebugTags($tagsContextKeys = null)
+ {
+ $expectedTags = mt_rand();
+ $logger = $this->initLogger($tagsContextKeys ? array('debugTagsKeysInContext' => $tagsContextKeys) : array());
+ if (!$tagsContextKeys) {
+ $tagsContextKeys = $this->getHandlerDefaultOption('debugTagsKeysInContext');
+ }
+ foreach ($tagsContextKeys as $key) {
+ $debugDispatcher = $this->initDebugDispatcherMock($this->connector);
+ $debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
+ $this->anything(),
+ $this->equalTo($expectedTags)
+ );
+ $this->connector->setDebugDispatcher($debugDispatcher);
+ $logger->addDebug('test', array($key => $expectedTags));
+ }
+ }
+
+ public function testError($classesPartialsTraceIgnore = null)
+ {
+ $code = E_USER_NOTICE;
+ $message = 'message';
+ $file = __FILE__;
+ $line = __LINE__;
+ $this->errorDispatcher->expects($this->once())->method('dispatchError')->with(
+ $this->equalTo($code),
+ $this->equalTo($message),
+ $this->equalTo($file),
+ $this->equalTo($line),
+ $classesPartialsTraceIgnore ?: $this->equalTo($this->getHandlerDefaultOption('classesPartialsTraceIgnore'))
+ );
+ $errorHandler = ErrorHandler::register($this->initLogger($classesPartialsTraceIgnore ? array('classesPartialsTraceIgnore' => $classesPartialsTraceIgnore) : array()), false);
+ $errorHandler->registerErrorHandler(array(), false, E_USER_WARNING);
+ $errorHandler->handleError($code, $message, $file, $line);
+ }
+
+ public function testException()
+ {
+ $e = new Exception();
+ $this->errorDispatcher->expects($this->once())->method('dispatchException')->with(
+ $this->equalTo($e)
+ );
+ $handler = $this->initLogger();
+ $handler->log(
+ \Psr\Log\LogLevel::ERROR,
+ sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()),
+ array('exception' => $e)
+ );
+ }
+
+ /**
+ * @expectedException Exception
+ */
+ public function testWrongOptionsThrowsException()
+ {
+ new PHPConsoleHandler(array('xxx' => 1));
+ }
+
+ public function testOptionEnabled()
+ {
+ $this->debugDispatcher->expects($this->never())->method('dispatchDebug');
+ $this->initLogger(array('enabled' => false))->addDebug('test');
+ }
+
+ public function testOptionClassesPartialsTraceIgnore()
+ {
+ $this->testError(array('Class', 'Namespace\\'));
+ }
+
+ public function testOptionDebugTagsKeysInContext()
+ {
+ $this->testDebugTags(array('key1', 'key2'));
+ }
+
+ public function testOptionUseOwnErrorsAndExceptionsHandler()
+ {
+ $this->initLogger(array('useOwnErrorsHandler' => true, 'useOwnExceptionsHandler' => true));
+ $this->assertEquals(array(Handler::getInstance(), 'handleError'), set_error_handler(function () {
+ }));
+ $this->assertEquals(array(Handler::getInstance(), 'handleException'), set_exception_handler(function () {
+ }));
+ }
+
+ public static function provideConnectorMethodsOptionsSets()
+ {
+ return array(
+ array('sourcesBasePath', 'setSourcesBasePath', __DIR__),
+ array('serverEncoding', 'setServerEncoding', 'cp1251'),
+ array('password', 'setPassword', '******'),
+ array('enableSslOnlyMode', 'enableSslOnlyMode', true, false),
+ array('ipMasks', 'setAllowedIpMasks', array('127.0.0.*')),
+ array('headersLimit', 'setHeadersLimit', 2500),
+ array('enableEvalListener', 'startEvalRequestsListener', true, false),
+ );
+ }
+
+ /**
+ * @dataProvider provideConnectorMethodsOptionsSets
+ */
+ public function testOptionCallsConnectorMethod($option, $method, $value, $isArgument = true)
+ {
+ $expectCall = $this->connector->expects($this->once())->method($method);
+ if ($isArgument) {
+ $expectCall->with($value);
+ }
+ new PHPConsoleHandler(array($option => $value), $this->connector);
+ }
+
+ public function testOptionDetectDumpTraceAndSource()
+ {
+ new PHPConsoleHandler(array('detectDumpTraceAndSource' => true), $this->connector);
+ $this->assertTrue($this->connector->getDebugDispatcher()->detectTraceAndSource);
+ }
+
+ public static function provideDumperOptionsValues()
+ {
+ return array(
+ array('dumperLevelLimit', 'levelLimit', 1001),
+ array('dumperItemsCountLimit', 'itemsCountLimit', 1002),
+ array('dumperItemSizeLimit', 'itemSizeLimit', 1003),
+ array('dumperDumpSizeLimit', 'dumpSizeLimit', 1004),
+ array('dumperDetectCallbacks', 'detectCallbacks', true),
+ );
+ }
+
+ /**
+ * @dataProvider provideDumperOptionsValues
+ */
+ public function testDumperOptions($option, $dumperProperty, $value)
+ {
+ new PHPConsoleHandler(array($option => $value), $this->connector);
+ $this->assertEquals($value, $this->connector->getDumper()->$dumperProperty);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php
new file mode 100644
index 0000000..64eaab1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php
@@ -0,0 +1,50 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\PsrHandler::handle
+ */
+class PsrHandlerTest extends TestCase
+{
+ public function logLevelProvider()
+ {
+ $levels = array();
+ $monologLogger = new Logger('');
+
+ foreach ($monologLogger->getLevels() as $levelName => $level) {
+ $levels[] = array($levelName, $level);
+ }
+
+ return $levels;
+ }
+
+ /**
+ * @dataProvider logLevelProvider
+ */
+ public function testHandlesAllLevels($levelName, $level)
+ {
+ $message = 'Hello, world! ' . $level;
+ $context = array('foo' => 'bar', 'level' => $level);
+
+ $psrLogger = $this->getMock('Psr\Log\NullLogger');
+ $psrLogger->expects($this->once())
+ ->method('log')
+ ->with(strtolower($levelName), $message, $context);
+
+ $handler = new PsrHandler($psrLogger);
+ $handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php
new file mode 100644
index 0000000..56df474
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php
@@ -0,0 +1,141 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * Almost all examples (expected header, titles, messages) taken from
+ * https://www.pushover.net/api
+ * @author Sebastian Göttschkes
+ * @see https://www.pushover.net/api
+ */
+class PushoverHandlerTest extends TestCase
+{
+ private $res;
+ private $handler;
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ /**
+ * @depends testWriteHeader
+ */
+ public function testWriteContent($content)
+ {
+ $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}$/', $content);
+ }
+
+ public function testWriteWithComplexTitle()
+ {
+ $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content);
+ }
+
+ public function testWriteWithComplexMessage()
+ {
+ $this->createHandler();
+ $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+ }
+
+ public function testWriteWithTooLongMessage()
+ {
+ $message = str_pad('test', 520, 'a');
+ $this->createHandler();
+ $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, $message));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $expectedMessage = substr($message, 0, 505);
+
+ $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content);
+ }
+
+ public function testWriteWithHighPriority()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=1$/', $content);
+ }
+
+ public function testWriteWithEmergencyPriority()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+ }
+
+ public function testWriteToMultipleUsers()
+ {
+ $this->createHandler('myToken', array('userA', 'userB'));
+ $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content);
+ $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+ }
+
+ private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog')
+ {
+ $constructorArgs = array($token, $user, $title);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\PushoverHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php
new file mode 100644
index 0000000..a7c4845
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php
@@ -0,0 +1,227 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RavenHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('Raven_Client')) {
+ $this->markTestSkipped('raven/raven not installed');
+ }
+
+ require_once __DIR__ . '/MockRavenClient.php';
+ }
+
+ /**
+ * @covers Monolog\Handler\RavenHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new RavenHandler($this->getRavenClient());
+ $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler);
+ }
+
+ protected function getHandler($ravenClient)
+ {
+ $handler = new RavenHandler($ravenClient);
+
+ return $handler;
+ }
+
+ protected function getRavenClient()
+ {
+ $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1';
+
+ return new MockRavenClient($dsn);
+ }
+
+ public function testDebug()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $record = $this->getRecord(Logger::DEBUG, 'A test debug message');
+ $handler->handle($record);
+
+ $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']);
+ $this->assertContains($record['message'], $ravenClient->lastData['message']);
+ }
+
+ public function testWarning()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $record = $this->getRecord(Logger::WARNING, 'A test warning message');
+ $handler->handle($record);
+
+ $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']);
+ $this->assertContains($record['message'], $ravenClient->lastData['message']);
+ }
+
+ public function testTag()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $tags = array(1, 2, 'foo');
+ $record = $this->getRecord(Logger::INFO, 'test', array('tags' => $tags));
+ $handler->handle($record);
+
+ $this->assertEquals($tags, $ravenClient->lastData['tags']);
+ }
+
+ public function testExtraParameters()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $checksum = '098f6bcd4621d373cade4e832627b4f6';
+ $release = '05a671c66aefea124cc08b76ea6d30bb';
+ $record = $this->getRecord(Logger::INFO, 'test', array('checksum' => $checksum, 'release' => $release));
+ $handler->handle($record);
+
+ $this->assertEquals($checksum, $ravenClient->lastData['checksum']);
+ $this->assertEquals($release, $ravenClient->lastData['release']);
+ }
+
+ public function testFingerprint()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $fingerprint = array('{{ default }}', 'other value');
+ $record = $this->getRecord(Logger::INFO, 'test', array('fingerprint' => $fingerprint));
+ $handler->handle($record);
+
+ $this->assertEquals($fingerprint, $ravenClient->lastData['fingerprint']);
+ }
+
+ public function testUserContext()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $recordWithNoContext = $this->getRecord(Logger::INFO, 'test with default user context');
+ // set user context 'externally'
+
+ $user = array(
+ 'id' => '123',
+ 'email' => 'test@test.com',
+ );
+
+ $recordWithContext = $this->getRecord(Logger::INFO, 'test', array('user' => $user));
+
+ $ravenClient->user_context(array('id' => 'test_user_id'));
+ // handle context
+ $handler->handle($recordWithContext);
+ $this->assertEquals($user, $ravenClient->lastData['user']);
+
+ // check to see if its reset
+ $handler->handle($recordWithNoContext);
+ $this->assertInternalType('array', $ravenClient->context->user);
+ $this->assertSame('test_user_id', $ravenClient->context->user['id']);
+
+ // handle with null context
+ $ravenClient->user_context(null);
+ $handler->handle($recordWithContext);
+ $this->assertEquals($user, $ravenClient->lastData['user']);
+
+ // check to see if its reset
+ $handler->handle($recordWithNoContext);
+ $this->assertNull($ravenClient->context->user);
+ }
+
+ public function testException()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ try {
+ $this->methodThatThrowsAnException();
+ } catch (\Exception $e) {
+ $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e));
+ $handler->handle($record);
+ }
+
+ $this->assertEquals($record['message'], $ravenClient->lastData['message']);
+ }
+
+ public function testHandleBatch()
+ {
+ $records = $this->getMultipleRecords();
+ $records[] = $this->getRecord(Logger::WARNING, 'warning');
+ $records[] = $this->getRecord(Logger::WARNING, 'warning');
+
+ $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $logFormatter->expects($this->once())->method('formatBatch');
+
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) {
+ return $record['level'] == 400;
+ }));
+
+ $handler = $this->getHandler($this->getRavenClient());
+ $handler->setBatchFormatter($logFormatter);
+ $handler->setFormatter($formatter);
+ $handler->handleBatch($records);
+ }
+
+ public function testHandleBatchDoNothingIfRecordsAreBelowLevel()
+ {
+ $records = array(
+ $this->getRecord(Logger::DEBUG, 'debug message 1'),
+ $this->getRecord(Logger::DEBUG, 'debug message 2'),
+ $this->getRecord(Logger::INFO, 'information'),
+ );
+
+ $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient()));
+ $handler->expects($this->never())->method('handle');
+ $handler->setLevel(Logger::ERROR);
+ $handler->handleBatch($records);
+ }
+
+ public function testGetSetBatchFormatter()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $handler->setBatchFormatter($formatter = new LineFormatter());
+ $this->assertSame($formatter, $handler->getBatchFormatter());
+ }
+
+ public function testRelease()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+ $release = 'v42.42.42';
+ $handler->setRelease($release);
+ $record = $this->getRecord(Logger::INFO, 'test');
+ $handler->handle($record);
+ $this->assertEquals($release, $ravenClient->lastData['release']);
+
+ $localRelease = 'v41.41.41';
+ $record = $this->getRecord(Logger::INFO, 'test', array('release' => $localRelease));
+ $handler->handle($record);
+ $this->assertEquals($localRelease, $ravenClient->lastData['release']);
+ }
+
+ private function methodThatThrowsAnException()
+ {
+ throw new \Exception('This is an exception');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php
new file mode 100644
index 0000000..689d527
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php
@@ -0,0 +1,127 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RedisHandlerTest extends TestCase
+{
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorShouldThrowExceptionForInvalidRedis()
+ {
+ new RedisHandler(new \stdClass(), 'key');
+ }
+
+ public function testConstructorShouldWorkWithPredis()
+ {
+ $redis = $this->getMock('Predis\Client');
+ $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+ }
+
+ public function testConstructorShouldWorkWithRedis()
+ {
+ $redis = $this->getMock('Redis');
+ $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+ }
+
+ public function testPredisHandle()
+ {
+ $redis = $this->getMock('Predis\Client', array('rpush'));
+
+ // Predis\Client uses rpush
+ $redis->expects($this->once())
+ ->method('rpush')
+ ->with('key', 'test');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new RedisHandler($redis, 'key');
+ $handler->setFormatter(new LineFormatter("%message%"));
+ $handler->handle($record);
+ }
+
+ public function testRedisHandle()
+ {
+ $redis = $this->getMock('Redis', array('rpush'));
+
+ // Redis uses rPush
+ $redis->expects($this->once())
+ ->method('rPush')
+ ->with('key', 'test');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new RedisHandler($redis, 'key');
+ $handler->setFormatter(new LineFormatter("%message%"));
+ $handler->handle($record);
+ }
+
+ public function testRedisHandleCapped()
+ {
+ $redis = $this->getMock('Redis', array('multi', 'rpush', 'ltrim', 'exec'));
+
+ // Redis uses multi
+ $redis->expects($this->once())
+ ->method('multi')
+ ->will($this->returnSelf());
+
+ $redis->expects($this->once())
+ ->method('rpush')
+ ->will($this->returnSelf());
+
+ $redis->expects($this->once())
+ ->method('ltrim')
+ ->will($this->returnSelf());
+
+ $redis->expects($this->once())
+ ->method('exec')
+ ->will($this->returnSelf());
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10);
+ $handler->setFormatter(new LineFormatter("%message%"));
+ $handler->handle($record);
+ }
+
+ public function testPredisHandleCapped()
+ {
+ $redis = $this->getMock('Predis\Client', array('transaction'));
+
+ $redisTransaction = $this->getMock('Predis\Client', array('rpush', 'ltrim'));
+
+ $redisTransaction->expects($this->once())
+ ->method('rpush')
+ ->will($this->returnSelf());
+
+ $redisTransaction->expects($this->once())
+ ->method('ltrim')
+ ->will($this->returnSelf());
+
+ // Redis uses multi
+ $redis->expects($this->once())
+ ->method('transaction')
+ ->will($this->returnCallback(function ($cb) use ($redisTransaction) {
+ $cb($redisTransaction);
+ }));
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10);
+ $handler->setFormatter(new LineFormatter("%message%"));
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php
new file mode 100644
index 0000000..f4cefda
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php
@@ -0,0 +1,99 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class RotatingFileHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ $dir = __DIR__.'/Fixtures';
+ chmod($dir, 0777);
+ if (!is_writable($dir)) {
+ $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.');
+ }
+ }
+
+ public function testRotationCreatesNewFile()
+ {
+ touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+
+ $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord());
+
+ $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+ $this->assertTrue(file_exists($log));
+ $this->assertEquals('test', file_get_contents($log));
+ }
+
+ /**
+ * @dataProvider rotationTests
+ */
+ public function testRotation($createFile)
+ {
+ touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+ touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot');
+ touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot');
+ touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot');
+
+ $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+
+ if ($createFile) {
+ touch($log);
+ }
+
+ $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord());
+
+ $handler->close();
+
+ $this->assertTrue(file_exists($log));
+ $this->assertTrue(file_exists($old1));
+ $this->assertEquals($createFile, file_exists($old2));
+ $this->assertEquals($createFile, file_exists($old3));
+ $this->assertEquals($createFile, file_exists($old4));
+ $this->assertEquals('test', file_get_contents($log));
+ }
+
+ public function rotationTests()
+ {
+ return array(
+ 'Rotation is triggered when the file of the current day is not present'
+ => array(true),
+ 'Rotation is not triggered when the file is already present'
+ => array(false),
+ );
+ }
+
+ public function testReuseCurrentFile()
+ {
+ $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+ file_put_contents($log, "foo");
+ $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord());
+ $this->assertEquals('footest', file_get_contents($log));
+ }
+
+ public function tearDown()
+ {
+ foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) {
+ unlink($file);
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php
new file mode 100644
index 0000000..b354cee
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php
@@ -0,0 +1,33 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\SamplingHandler::handle
+ */
+class SamplingHandlerTest extends TestCase
+{
+ public function testHandle()
+ {
+ $testHandler = new TestHandler();
+ $handler = new SamplingHandler($testHandler, 2);
+ for ($i = 0; $i < 10000; $i++) {
+ $handler->handle($this->getRecord());
+ }
+ $count = count($testHandler->getRecords());
+ // $count should be half of 10k, so between 4k and 6k
+ $this->assertLessThan(6000, $count);
+ $this->assertGreaterThan(4000, $count);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php
new file mode 100644
index 0000000..d657fae
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php
@@ -0,0 +1,133 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Greg Kedzierski
+ * @see https://api.slack.com/
+ */
+class SlackHandlerTest extends TestCase
+{
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @var SlackHandler
+ */
+ private $handler;
+
+ public function setUp()
+ {
+ if (!extension_loaded('openssl')) {
+ $this->markTestSkipped('This test requires openssl to run');
+ }
+ }
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+ }
+
+ public function testWriteContent()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=&attachments=.*$/', $content);
+ }
+
+ public function testWriteContentWithEmoji()
+ {
+ $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/icon_emoji=%3Aalien%3A$/', $content);
+ }
+
+ /**
+ * @dataProvider provideLevelColors
+ */
+ public function testWriteContentWithColors($level, $expectedColor)
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord($level, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/color%22%3A%22'.$expectedColor.'/', $content);
+ }
+
+ public function testWriteContentWithPlainTextMessage()
+ {
+ $this->createHandler('myToken', 'channel1', 'Monolog', false);
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/text=test1/', $content);
+ }
+
+ public function provideLevelColors()
+ {
+ return array(
+ array(Logger::DEBUG, '%23e3e4e6'), // escaped #e3e4e6
+ array(Logger::INFO, 'good'),
+ array(Logger::NOTICE, 'good'),
+ array(Logger::WARNING, 'warning'),
+ array(Logger::ERROR, 'danger'),
+ array(Logger::CRITICAL, 'danger'),
+ array(Logger::ALERT, 'danger'),
+ array(Logger::EMERGENCY,'danger'),
+ );
+ }
+
+ private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false)
+ {
+ $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\SlackHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php
new file mode 100644
index 0000000..1f9c1f2
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php
@@ -0,0 +1,309 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Pablo de Leon Belloc
+ */
+class SocketHandlerTest extends TestCase
+{
+ /**
+ * @var Monolog\Handler\SocketHandler
+ */
+ private $handler;
+
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testInvalidHostname()
+ {
+ $this->createHandler('garbage://here');
+ $this->writeRecord('data');
+ }
+
+ /**
+ * @expectedException \InvalidArgumentException
+ */
+ public function testBadConnectionTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setConnectionTimeout(-1);
+ }
+
+ public function testSetConnectionTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setConnectionTimeout(10.1);
+ $this->assertEquals(10.1, $this->handler->getConnectionTimeout());
+ }
+
+ /**
+ * @expectedException \InvalidArgumentException
+ */
+ public function testBadTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setTimeout(-1);
+ }
+
+ public function testSetTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setTimeout(10.25);
+ $this->assertEquals(10.25, $this->handler->getTimeout());
+ }
+
+ public function testSetWritingTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setWritingTimeout(10.25);
+ $this->assertEquals(10.25, $this->handler->getWritingTimeout());
+ }
+
+ public function testSetConnectionString()
+ {
+ $this->createHandler('tcp://localhost:9090');
+ $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString());
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testExceptionIsThrownOnFsockopenError()
+ {
+ $this->setMockHandler(array('fsockopen'));
+ $this->handler->expects($this->once())
+ ->method('fsockopen')
+ ->will($this->returnValue(false));
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testExceptionIsThrownOnPfsockopenError()
+ {
+ $this->setMockHandler(array('pfsockopen'));
+ $this->handler->expects($this->once())
+ ->method('pfsockopen')
+ ->will($this->returnValue(false));
+ $this->handler->setPersistent(true);
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testExceptionIsThrownIfCannotSetTimeout()
+ {
+ $this->setMockHandler(array('streamSetTimeout'));
+ $this->handler->expects($this->once())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(false));
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException RuntimeException
+ */
+ public function testWriteFailsOnIfFwriteReturnsFalse()
+ {
+ $this->setMockHandler(array('fwrite'));
+
+ $callback = function ($arg) {
+ $map = array(
+ 'Hello world' => 6,
+ 'world' => false,
+ );
+
+ return $map[$arg];
+ };
+
+ $this->handler->expects($this->exactly(2))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException RuntimeException
+ */
+ public function testWriteFailsIfStreamTimesOut()
+ {
+ $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+ $callback = function ($arg) {
+ $map = array(
+ 'Hello world' => 6,
+ 'world' => 5,
+ );
+
+ return $map[$arg];
+ };
+
+ $this->handler->expects($this->exactly(1))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+ $this->handler->expects($this->exactly(1))
+ ->method('streamGetMetadata')
+ ->will($this->returnValue(array('timed_out' => true)));
+
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException RuntimeException
+ */
+ public function testWriteFailsOnIncompleteWrite()
+ {
+ $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+ $res = $this->res;
+ $callback = function ($string) use ($res) {
+ fclose($res);
+
+ return strlen('Hello');
+ };
+
+ $this->handler->expects($this->exactly(1))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+ $this->handler->expects($this->exactly(1))
+ ->method('streamGetMetadata')
+ ->will($this->returnValue(array('timed_out' => false)));
+
+ $this->writeRecord('Hello world');
+ }
+
+ public function testWriteWithMemoryFile()
+ {
+ $this->setMockHandler();
+ $this->writeRecord('test1');
+ $this->writeRecord('test2');
+ $this->writeRecord('test3');
+ fseek($this->res, 0);
+ $this->assertEquals('test1test2test3', fread($this->res, 1024));
+ }
+
+ public function testWriteWithMock()
+ {
+ $this->setMockHandler(array('fwrite'));
+
+ $callback = function ($arg) {
+ $map = array(
+ 'Hello world' => 6,
+ 'world' => 5,
+ );
+
+ return $map[$arg];
+ };
+
+ $this->handler->expects($this->exactly(2))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+
+ $this->writeRecord('Hello world');
+ }
+
+ public function testClose()
+ {
+ $this->setMockHandler();
+ $this->writeRecord('Hello world');
+ $this->assertInternalType('resource', $this->res);
+ $this->handler->close();
+ $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler");
+ }
+
+ public function testCloseDoesNotClosePersistentSocket()
+ {
+ $this->setMockHandler();
+ $this->handler->setPersistent(true);
+ $this->writeRecord('Hello world');
+ $this->assertTrue(is_resource($this->res));
+ $this->handler->close();
+ $this->assertTrue(is_resource($this->res));
+ }
+
+ /**
+ * @expectedException \RuntimeException
+ */
+ public function testAvoidInfiniteLoopWhenNoDataIsWrittenForAWritingTimeoutSeconds()
+ {
+ $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+ $this->handler->expects($this->any())
+ ->method('fwrite')
+ ->will($this->returnValue(0));
+
+ $this->handler->expects($this->any())
+ ->method('streamGetMetadata')
+ ->will($this->returnValue(array('timed_out' => false)));
+
+ $this->handler->setWritingTimeout(1);
+
+ $this->writeRecord('Hello world');
+ }
+
+ private function createHandler($connectionString)
+ {
+ $this->handler = new SocketHandler($connectionString);
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+
+ private function writeRecord($string)
+ {
+ $this->handler->handle($this->getRecord(Logger::WARNING, $string));
+ }
+
+ private function setMockHandler(array $methods = array())
+ {
+ $this->res = fopen('php://memory', 'a');
+
+ $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout');
+ $newMethods = array_diff($methods, $defaultMethods);
+
+ $finalMethods = array_merge($defaultMethods, $newMethods);
+
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234')
+ );
+
+ if (!in_array('fsockopen', $methods)) {
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ }
+
+ if (!in_array('pfsockopen', $methods)) {
+ $this->handler->expects($this->any())
+ ->method('pfsockopen')
+ ->will($this->returnValue($this->res));
+ }
+
+ if (!in_array('streamSetTimeout', $methods)) {
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ }
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php
new file mode 100644
index 0000000..487030f
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php
@@ -0,0 +1,184 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class StreamHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWrite()
+ {
+ $handle = fopen('php://memory', 'a+');
+ $handler = new StreamHandler($handle);
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+ $handler->handle($this->getRecord(Logger::WARNING, 'test2'));
+ $handler->handle($this->getRecord(Logger::WARNING, 'test3'));
+ fseek($handle, 0);
+ $this->assertEquals('testtest2test3', fread($handle, 100));
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::close
+ */
+ public function testCloseKeepsExternalHandlersOpen()
+ {
+ $handle = fopen('php://memory', 'a+');
+ $handler = new StreamHandler($handle);
+ $this->assertTrue(is_resource($handle));
+ $handler->close();
+ $this->assertTrue(is_resource($handle));
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::close
+ */
+ public function testClose()
+ {
+ $handler = new StreamHandler('php://memory');
+ $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+ $streamProp = new \ReflectionProperty('Monolog\Handler\StreamHandler', 'stream');
+ $streamProp->setAccessible(true);
+ $handle = $streamProp->getValue($handler);
+
+ $this->assertTrue(is_resource($handle));
+ $handler->close();
+ $this->assertFalse(is_resource($handle));
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteCreatesTheStreamResource()
+ {
+ $handler = new StreamHandler('php://memory');
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteLocking()
+ {
+ $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log';
+ $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true);
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @expectedException LogicException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteMissingResource()
+ {
+ $handler = new StreamHandler(null);
+ $handler->handle($this->getRecord());
+ }
+
+ public function invalidArgumentProvider()
+ {
+ return array(
+ array(1),
+ array(array()),
+ array(array('bogus://url')),
+ );
+ }
+
+ /**
+ * @dataProvider invalidArgumentProvider
+ * @expectedException InvalidArgumentException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ */
+ public function testWriteInvalidArgument($invalidArgument)
+ {
+ $handler = new StreamHandler($invalidArgument);
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteInvalidResource()
+ {
+ $handler = new StreamHandler('bogus://url');
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteNonExistingResource()
+ {
+ $handler = new StreamHandler('ftp://foo/bar/baz/'.rand(0, 10000));
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteNonExistingPath()
+ {
+ $handler = new StreamHandler(sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteNonExistingFileResource()
+ {
+ $handler = new StreamHandler('file://'.sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @expectedException Exception
+ * @expectedExceptionMessageRegExp /There is no existing directory at/
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteNonExistingAndNotCreatablePath()
+ {
+ if (defined('PHP_WINDOWS_VERSION_BUILD')) {
+ $this->markTestSkipped('Permissions checks can not run on windows');
+ }
+ $handler = new StreamHandler('/foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @expectedException Exception
+ * @expectedExceptionMessageRegExp /There is no existing directory at/
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteNonExistingAndNotCreatableFileResource()
+ {
+ if (defined('PHP_WINDOWS_VERSION_BUILD')) {
+ $this->markTestSkipped('Permissions checks can not run on windows');
+ }
+ $handler = new StreamHandler('file:///foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+ $handler->handle($this->getRecord());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php
new file mode 100644
index 0000000..8588691
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php
@@ -0,0 +1,113 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class SwiftMailerHandlerTest extends TestCase
+{
+ /** @var \Swift_Mailer|\PHPUnit_Framework_MockObject_MockObject */
+ private $mailer;
+
+ public function setUp()
+ {
+ $this->mailer = $this
+ ->getMockBuilder('Swift_Mailer')
+ ->disableOriginalConstructor()
+ ->getMock();
+ }
+
+ public function testMessageCreationIsLazyWhenUsingCallback()
+ {
+ $this->mailer->expects($this->never())
+ ->method('send');
+
+ $callback = function () {
+ throw new \RuntimeException('Swift_Message creation callback should not have been called in this test');
+ };
+ $handler = new SwiftMailerHandler($this->mailer, $callback);
+
+ $records = array(
+ $this->getRecord(Logger::DEBUG),
+ $this->getRecord(Logger::INFO),
+ );
+ $handler->handleBatch($records);
+ }
+
+ public function testMessageCanBeCustomizedGivenLoggedData()
+ {
+ // Wire Mailer to expect a specific Swift_Message with a customized Subject
+ $expectedMessage = new \Swift_Message();
+ $this->mailer->expects($this->once())
+ ->method('send')
+ ->with($this->callback(function ($value) use ($expectedMessage) {
+ return $value instanceof \Swift_Message
+ && $value->getSubject() === 'Emergency'
+ && $value === $expectedMessage;
+ }));
+
+ // Callback dynamically changes subject based on number of logged records
+ $callback = function ($content, array $records) use ($expectedMessage) {
+ $subject = count($records) > 0 ? 'Emergency' : 'Normal';
+ $expectedMessage->setSubject($subject);
+
+ return $expectedMessage;
+ };
+ $handler = new SwiftMailerHandler($this->mailer, $callback);
+
+ // Logging 1 record makes this an Emergency
+ $records = array(
+ $this->getRecord(Logger::EMERGENCY),
+ );
+ $handler->handleBatch($records);
+ }
+
+ public function testMessageSubjectFormatting()
+ {
+ // Wire Mailer to expect a specific Swift_Message with a customized Subject
+ $messageTemplate = new \Swift_Message();
+ $messageTemplate->setSubject('Alert: %level_name% %message%');
+ $receivedMessage = null;
+
+ $this->mailer->expects($this->once())
+ ->method('send')
+ ->with($this->callback(function ($value) use (&$receivedMessage) {
+ $receivedMessage = $value;
+ return true;
+ }));
+
+ $handler = new SwiftMailerHandler($this->mailer, $messageTemplate);
+
+ $records = array(
+ $this->getRecord(Logger::EMERGENCY),
+ );
+ $handler->handleBatch($records);
+
+ $this->assertEquals('Alert: EMERGENCY test', $receivedMessage->getSubject());
+ }
+
+ public function testMessageHaveUniqueId()
+ {
+ $messageTemplate = \Swift_Message::newInstance();
+ $handler = new SwiftMailerHandler($this->mailer, $messageTemplate);
+
+ $method = new \ReflectionMethod('Monolog\Handler\SwiftMailerHandler', 'buildMessage');
+ $method->setAccessible(true);
+ $method->invokeArgs($handler, array($messageTemplate, array()));
+
+ $builtMessage1 = $method->invoke($handler, $messageTemplate, array());
+ $builtMessage2 = $method->invoke($handler, $messageTemplate, array());
+
+ $this->assertFalse($builtMessage1->getId() === $builtMessage2->getId(), 'Two different messages have the same id');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php
new file mode 100644
index 0000000..8f9e46b
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php
@@ -0,0 +1,44 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+class SyslogHandlerTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Handler\SyslogHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new SyslogHandler('test');
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+ $handler = new SyslogHandler('test', LOG_USER);
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+ $handler = new SyslogHandler('test', 'user');
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+ $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR);
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+ }
+
+ /**
+ * @covers Monolog\Handler\SyslogHandler::__construct
+ */
+ public function testConstructInvalidFacility()
+ {
+ $this->setExpectedException('UnexpectedValueException');
+ $handler = new SyslogHandler('test', 'unknown');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php
new file mode 100644
index 0000000..497812b
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php
@@ -0,0 +1,49 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * @requires extension sockets
+ */
+class SyslogUdpHandlerTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testWeValidateFacilities()
+ {
+ $handler = new SyslogUdpHandler("ip", null, "invalidFacility");
+ }
+
+ public function testWeSplitIntoLines()
+ {
+ $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv");
+ $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter());
+
+ $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol'));
+ $socket->expects($this->at(0))
+ ->method('write')
+ ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
+ $socket->expects($this->at(1))
+ ->method('write')
+ ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
+
+ $handler->setSocket($socket);
+
+ $handler->handle($this->getRecordWithMessage("hej\nlol"));
+ }
+
+ protected function getRecordWithMessage($msg)
+ {
+ return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php
new file mode 100644
index 0000000..75cc4a8
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php
@@ -0,0 +1,66 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\TestHandler
+ */
+class TestHandlerTest extends TestCase
+{
+ /**
+ * @dataProvider methodProvider
+ */
+ public function testHandler($method, $level)
+ {
+ $handler = new TestHandler;
+ $record = $this->getRecord($level, 'test'.$method);
+ $this->assertFalse($handler->{'has'.$method}($record), 'has'.$method);
+ $this->assertFalse($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains');
+ $this->assertFalse($handler->{'has'.$method.'ThatPasses'}(function ($rec) {
+ return true;
+ }), 'has'.$method.'ThatPasses');
+ $this->assertFalse($handler->{'has'.$method.'ThatMatches'}('/test\w+/'));
+ $this->assertFalse($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records');
+ $handler->handle($record);
+
+ $this->assertFalse($handler->{'has'.$method}('bar'), 'has'.$method);
+ $this->assertTrue($handler->{'has'.$method}($record), 'has'.$method);
+ $this->assertTrue($handler->{'has'.$method}('test'.$method), 'has'.$method);
+ $this->assertTrue($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains');
+ $this->assertTrue($handler->{'has'.$method.'ThatPasses'}(function ($rec) {
+ return true;
+ }), 'has'.$method.'ThatPasses');
+ $this->assertTrue($handler->{'has'.$method.'ThatMatches'}('/test\w+/'));
+ $this->assertTrue($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records');
+
+ $records = $handler->getRecords();
+ unset($records[0]['formatted']);
+ $this->assertEquals(array($record), $records);
+ }
+
+ public function methodProvider()
+ {
+ return array(
+ array('Emergency', Logger::EMERGENCY),
+ array('Alert' , Logger::ALERT),
+ array('Critical' , Logger::CRITICAL),
+ array('Error' , Logger::ERROR),
+ array('Warning' , Logger::WARNING),
+ array('Info' , Logger::INFO),
+ array('Notice' , Logger::NOTICE),
+ array('Debug' , Logger::DEBUG),
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php
new file mode 100644
index 0000000..fa524d0
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php
@@ -0,0 +1,64 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Handler\SyslogUdp\UdpSocket;
+
+/**
+ * @requires extension sockets
+ */
+class UdpSocketTest extends TestCase
+{
+ public function testWeDoNotTruncateShortMessages()
+ {
+ $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+ $socket->expects($this->at(0))
+ ->method('send')
+ ->with("HEADER: The quick brown fox jumps over the lazy dog");
+
+ $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: ");
+ }
+
+ public function testLongMessagesAreTruncated()
+ {
+ $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+ $truncatedString = str_repeat("derp", 16254).'d';
+
+ $socket->expects($this->exactly(1))
+ ->method('send')
+ ->with("HEADER" . $truncatedString);
+
+ $longString = str_repeat("derp", 20000);
+
+ $socket->write($longString, "HEADER");
+ }
+
+ public function testDoubleCloseDoesNotError()
+ {
+ $socket = new UdpSocket('127.0.0.1', 514);
+ $socket->close();
+ $socket->close();
+ }
+
+ /**
+ * @expectedException LogicException
+ */
+ public function testWriteAfterCloseErrors()
+ {
+ $socket = new UdpSocket('127.0.0.1', 514);
+ $socket->close();
+ $socket->write('foo', "HEADER");
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php
new file mode 100644
index 0000000..8d37a1f
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php
@@ -0,0 +1,121 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class WhatFailureGroupHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorOnlyTakesHandler()
+ {
+ new WhatFailureGroupHandler(array(new TestHandler(), "foo"));
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+ */
+ public function testHandle()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new WhatFailureGroupHandler($testHandlers);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new WhatFailureGroupHandler($testHandlers);
+ $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+ $handler = new WhatFailureGroupHandler($testHandlers);
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new WhatFailureGroupHandler(array($test));
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+ */
+ public function testHandleException()
+ {
+ $test = new TestHandler();
+ $exception = new ExceptionTestHandler();
+ $handler = new WhatFailureGroupHandler(array($exception, $test, $exception));
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+}
+
+class ExceptionTestHandler extends TestHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ parent::handle($record);
+
+ throw new \Exception("ExceptionTestHandler::handle");
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php
new file mode 100644
index 0000000..69b001e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php
@@ -0,0 +1,69 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class ZendMonitorHandlerTest extends TestCase
+{
+ protected $zendMonitorHandler;
+
+ public function setUp()
+ {
+ if (!function_exists('zend_monitor_custom_event')) {
+ $this->markTestSkipped('ZendServer is not installed');
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\ZendMonitorHandler::write
+ */
+ public function testWrite()
+ {
+ $record = $this->getRecord();
+ $formatterResult = array(
+ 'message' => $record['message'],
+ );
+
+ $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler')
+ ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter'))
+ ->getMock();
+
+ $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter')
+ ->disableOriginalConstructor()
+ ->getMock();
+
+ $formatterMock->expects($this->once())
+ ->method('format')
+ ->will($this->returnValue($formatterResult));
+
+ $zendMonitor->expects($this->once())
+ ->method('getDefaultFormatter')
+ ->will($this->returnValue($formatterMock));
+
+ $levelMap = $zendMonitor->getLevelMap();
+
+ $zendMonitor->expects($this->once())
+ ->method('writeZendMonitorCustomEvent')
+ ->with($levelMap[$record['level']], $record['message'], $formatterResult);
+
+ $zendMonitor->handle($record);
+ }
+
+ /**
+ * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter
+ */
+ public function testGetDefaultFormatterReturnsNormalizerFormatter()
+ {
+ $zendMonitor = new ZendMonitorHandler();
+ $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/LoggerTest.php b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php
new file mode 100644
index 0000000..c0bd1da
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php
@@ -0,0 +1,548 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Processor\WebProcessor;
+use Monolog\Handler\TestHandler;
+
+class LoggerTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Logger::getName
+ */
+ public function testGetName()
+ {
+ $logger = new Logger('foo');
+ $this->assertEquals('foo', $logger->getName());
+ }
+
+ /**
+ * @covers Monolog\Logger::getLevelName
+ */
+ public function testGetLevelName()
+ {
+ $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR));
+ }
+
+ /**
+ * @covers Monolog\Logger::withName
+ */
+ public function testWithName()
+ {
+ $first = new Logger('first', array($handler = new TestHandler()));
+ $second = $first->withName('second');
+
+ $this->assertSame('first', $first->getName());
+ $this->assertSame('second', $second->getName());
+ $this->assertSame($handler, $second->popHandler());
+ }
+
+ /**
+ * @covers Monolog\Logger::toMonologLevel
+ */
+ public function testConvertPSR3ToMonologLevel()
+ {
+ $this->assertEquals(Logger::toMonologLevel('debug'), 100);
+ $this->assertEquals(Logger::toMonologLevel('info'), 200);
+ $this->assertEquals(Logger::toMonologLevel('notice'), 250);
+ $this->assertEquals(Logger::toMonologLevel('warning'), 300);
+ $this->assertEquals(Logger::toMonologLevel('error'), 400);
+ $this->assertEquals(Logger::toMonologLevel('critical'), 500);
+ $this->assertEquals(Logger::toMonologLevel('alert'), 550);
+ $this->assertEquals(Logger::toMonologLevel('emergency'), 600);
+ }
+
+ /**
+ * @covers Monolog\Logger::getLevelName
+ * @expectedException InvalidArgumentException
+ */
+ public function testGetLevelNameThrows()
+ {
+ Logger::getLevelName(5);
+ }
+
+ /**
+ * @covers Monolog\Logger::__construct
+ */
+ public function testChannel()
+ {
+ $logger = new Logger('foo');
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->addWarning('test');
+ list($record) = $handler->getRecords();
+ $this->assertEquals('foo', $record['channel']);
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testLog()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'));
+ $handler->expects($this->once())
+ ->method('handle');
+ $logger->pushHandler($handler);
+
+ $this->assertTrue($logger->addWarning('test'));
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testLogNotHandled()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR));
+ $handler->expects($this->never())
+ ->method('handle');
+ $logger->pushHandler($handler);
+
+ $this->assertFalse($logger->addWarning('test'));
+ }
+
+ public function testHandlersInCtor()
+ {
+ $handler1 = new TestHandler;
+ $handler2 = new TestHandler;
+ $logger = new Logger(__METHOD__, array($handler1, $handler2));
+
+ $this->assertEquals($handler1, $logger->popHandler());
+ $this->assertEquals($handler2, $logger->popHandler());
+ }
+
+ public function testProcessorsInCtor()
+ {
+ $processor1 = new WebProcessor;
+ $processor2 = new WebProcessor;
+ $logger = new Logger(__METHOD__, array(), array($processor1, $processor2));
+
+ $this->assertEquals($processor1, $logger->popProcessor());
+ $this->assertEquals($processor2, $logger->popProcessor());
+ }
+
+ /**
+ * @covers Monolog\Logger::pushHandler
+ * @covers Monolog\Logger::popHandler
+ * @expectedException LogicException
+ */
+ public function testPushPopHandler()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler1 = new TestHandler;
+ $handler2 = new TestHandler;
+
+ $logger->pushHandler($handler1);
+ $logger->pushHandler($handler2);
+
+ $this->assertEquals($handler2, $logger->popHandler());
+ $this->assertEquals($handler1, $logger->popHandler());
+ $logger->popHandler();
+ }
+
+ /**
+ * @covers Monolog\Logger::setHandlers
+ */
+ public function testSetHandlers()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler1 = new TestHandler;
+ $handler2 = new TestHandler;
+
+ $logger->pushHandler($handler1);
+ $logger->setHandlers(array($handler2));
+
+ // handler1 has been removed
+ $this->assertEquals(array($handler2), $logger->getHandlers());
+
+ $logger->setHandlers(array(
+ "AMapKey" => $handler1,
+ "Woop" => $handler2,
+ ));
+
+ // Keys have been scrubbed
+ $this->assertEquals(array($handler1, $handler2), $logger->getHandlers());
+ }
+
+ /**
+ * @covers Monolog\Logger::pushProcessor
+ * @covers Monolog\Logger::popProcessor
+ * @expectedException LogicException
+ */
+ public function testPushPopProcessor()
+ {
+ $logger = new Logger(__METHOD__);
+ $processor1 = new WebProcessor;
+ $processor2 = new WebProcessor;
+
+ $logger->pushProcessor($processor1);
+ $logger->pushProcessor($processor2);
+
+ $this->assertEquals($processor2, $logger->popProcessor());
+ $this->assertEquals($processor1, $logger->popProcessor());
+ $logger->popProcessor();
+ }
+
+ /**
+ * @covers Monolog\Logger::pushProcessor
+ * @expectedException InvalidArgumentException
+ */
+ public function testPushProcessorWithNonCallable()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $logger->pushProcessor(new \stdClass());
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testProcessorsAreExecuted()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->pushProcessor(function ($record) {
+ $record['extra']['win'] = true;
+
+ return $record;
+ });
+ $logger->addError('test');
+ list($record) = $handler->getRecords();
+ $this->assertTrue($record['extra']['win']);
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testProcessorsAreCalledOnlyOnce()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler->expects($this->any())
+ ->method('handle')
+ ->will($this->returnValue(true))
+ ;
+ $logger->pushHandler($handler);
+
+ $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor')
+ ->disableOriginalConstructor()
+ ->setMethods(array('__invoke'))
+ ->getMock()
+ ;
+ $processor->expects($this->once())
+ ->method('__invoke')
+ ->will($this->returnArgument(0))
+ ;
+ $logger->pushProcessor($processor);
+
+ $logger->addError('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testProcessorsNotCalledWhenNotHandled()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler);
+ $that = $this;
+ $logger->pushProcessor(function ($record) use ($that) {
+ $that->fail('The processor should not be called');
+ });
+ $logger->addAlert('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testHandlersNotCalledBeforeFirstHandling()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->never())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $handler1->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler1);
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler2->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler2);
+
+ $handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler3->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $handler3->expects($this->never())
+ ->method('handle')
+ ;
+ $logger->pushHandler($handler3);
+
+ $logger->debug('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testHandlersNotCalledBeforeFirstHandlingWithAssocArray()
+ {
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->never())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $handler1->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler2->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+
+ $handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler3->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $handler3->expects($this->never())
+ ->method('handle')
+ ;
+
+ $logger = new Logger(__METHOD__, array('last' => $handler3, 'second' => $handler2, 'first' => $handler1));
+
+ $logger->debug('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testBubblingWhenTheHandlerReturnsFalse()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler1->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler1);
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler2->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler2);
+
+ $logger->debug('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testNotBubblingWhenTheHandlerReturnsTrue()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler1->expects($this->never())
+ ->method('handle')
+ ;
+ $logger->pushHandler($handler1);
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler2->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(true))
+ ;
+ $logger->pushHandler($handler2);
+
+ $logger->debug('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::isHandling
+ */
+ public function testIsHandling()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+
+ $logger->pushHandler($handler1);
+ $this->assertFalse($logger->isHandling(Logger::DEBUG));
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+
+ $logger->pushHandler($handler2);
+ $this->assertTrue($logger->isHandling(Logger::DEBUG));
+ }
+
+ /**
+ * @dataProvider logMethodProvider
+ * @covers Monolog\Logger::addDebug
+ * @covers Monolog\Logger::addInfo
+ * @covers Monolog\Logger::addNotice
+ * @covers Monolog\Logger::addWarning
+ * @covers Monolog\Logger::addError
+ * @covers Monolog\Logger::addCritical
+ * @covers Monolog\Logger::addAlert
+ * @covers Monolog\Logger::addEmergency
+ * @covers Monolog\Logger::debug
+ * @covers Monolog\Logger::info
+ * @covers Monolog\Logger::notice
+ * @covers Monolog\Logger::warn
+ * @covers Monolog\Logger::err
+ * @covers Monolog\Logger::crit
+ * @covers Monolog\Logger::alert
+ * @covers Monolog\Logger::emerg
+ */
+ public function testLogMethods($method, $expectedLevel)
+ {
+ $logger = new Logger('foo');
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->{$method}('test');
+ list($record) = $handler->getRecords();
+ $this->assertEquals($expectedLevel, $record['level']);
+ }
+
+ public function logMethodProvider()
+ {
+ return array(
+ // monolog methods
+ array('addDebug', Logger::DEBUG),
+ array('addInfo', Logger::INFO),
+ array('addNotice', Logger::NOTICE),
+ array('addWarning', Logger::WARNING),
+ array('addError', Logger::ERROR),
+ array('addCritical', Logger::CRITICAL),
+ array('addAlert', Logger::ALERT),
+ array('addEmergency', Logger::EMERGENCY),
+
+ // ZF/Sf2 compat methods
+ array('debug', Logger::DEBUG),
+ array('info', Logger::INFO),
+ array('notice', Logger::NOTICE),
+ array('warn', Logger::WARNING),
+ array('err', Logger::ERROR),
+ array('crit', Logger::CRITICAL),
+ array('alert', Logger::ALERT),
+ array('emerg', Logger::EMERGENCY),
+ );
+ }
+
+ /**
+ * @dataProvider setTimezoneProvider
+ * @covers Monolog\Logger::setTimezone
+ */
+ public function testSetTimezone($tz)
+ {
+ Logger::setTimezone($tz);
+ $logger = new Logger('foo');
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->info('test');
+ list($record) = $handler->getRecords();
+ $this->assertEquals($tz, $record['datetime']->getTimezone());
+ }
+
+ public function setTimezoneProvider()
+ {
+ return array_map(
+ function ($tz) { return array(new \DateTimeZone($tz)); },
+ \DateTimeZone::listIdentifiers()
+ );
+ }
+
+ /**
+ * @dataProvider useMicrosecondTimestampsProvider
+ * @covers Monolog\Logger::useMicrosecondTimestamps
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testUseMicrosecondTimestamps($micro, $assert)
+ {
+ $logger = new Logger('foo');
+ $logger->useMicrosecondTimestamps($micro);
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->info('test');
+ list($record) = $handler->getRecords();
+ $this->{$assert}('000000', $record['datetime']->format('u'));
+ }
+
+ public function useMicrosecondTimestampsProvider()
+ {
+ return array(
+ // this has a very small chance of a false negative (1/10^6)
+ 'with microseconds' => array(true, 'assertNotSame'),
+ 'without microseconds' => array(false, 'assertSame'),
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php
new file mode 100644
index 0000000..5adb505
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php
@@ -0,0 +1,29 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class GitProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\GitProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $processor = new GitProcessor();
+ $record = $processor($this->getRecord());
+
+ $this->assertArrayHasKey('git', $record['extra']);
+ $this->assertTrue(!is_array($record['extra']['git']['branch']));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php
new file mode 100644
index 0000000..0dd411d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php
@@ -0,0 +1,123 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Acme;
+
+class Tester
+{
+ public function test($handler, $record)
+ {
+ $handler->handle($record);
+ }
+}
+
+function tester($handler, $record)
+{
+ $handler->handle($record);
+}
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+use Monolog\Handler\TestHandler;
+
+class IntrospectionProcessorTest extends TestCase
+{
+ public function getHandler()
+ {
+ $processor = new IntrospectionProcessor();
+ $handler = new TestHandler();
+ $handler->pushProcessor($processor);
+
+ return $handler;
+ }
+
+ public function testProcessorFromClass()
+ {
+ $handler = $this->getHandler();
+ $tester = new \Acme\Tester;
+ $tester->test($handler, $this->getRecord());
+ list($record) = $handler->getRecords();
+ $this->assertEquals(__FILE__, $record['extra']['file']);
+ $this->assertEquals(18, $record['extra']['line']);
+ $this->assertEquals('Acme\Tester', $record['extra']['class']);
+ $this->assertEquals('test', $record['extra']['function']);
+ }
+
+ public function testProcessorFromFunc()
+ {
+ $handler = $this->getHandler();
+ \Acme\tester($handler, $this->getRecord());
+ list($record) = $handler->getRecords();
+ $this->assertEquals(__FILE__, $record['extra']['file']);
+ $this->assertEquals(24, $record['extra']['line']);
+ $this->assertEquals(null, $record['extra']['class']);
+ $this->assertEquals('Acme\tester', $record['extra']['function']);
+ }
+
+ public function testLevelTooLow()
+ {
+ $input = array(
+ 'level' => Logger::DEBUG,
+ 'extra' => array(),
+ );
+
+ $expected = $input;
+
+ $processor = new IntrospectionProcessor(Logger::CRITICAL);
+ $actual = $processor($input);
+
+ $this->assertEquals($expected, $actual);
+ }
+
+ public function testLevelEqual()
+ {
+ $input = array(
+ 'level' => Logger::CRITICAL,
+ 'extra' => array(),
+ );
+
+ $expected = $input;
+ $expected['extra'] = array(
+ 'file' => null,
+ 'line' => null,
+ 'class' => 'ReflectionMethod',
+ 'function' => 'invokeArgs',
+ );
+
+ $processor = new IntrospectionProcessor(Logger::CRITICAL);
+ $actual = $processor($input);
+
+ $this->assertEquals($expected, $actual);
+ }
+
+ public function testLevelHigher()
+ {
+ $input = array(
+ 'level' => Logger::EMERGENCY,
+ 'extra' => array(),
+ );
+
+ $expected = $input;
+ $expected['extra'] = array(
+ 'file' => null,
+ 'line' => null,
+ 'class' => 'ReflectionMethod',
+ 'function' => 'invokeArgs',
+ );
+
+ $processor = new IntrospectionProcessor(Logger::CRITICAL);
+ $actual = $processor($input);
+
+ $this->assertEquals($expected, $actual);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php
new file mode 100644
index 0000000..eb66614
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php
@@ -0,0 +1,42 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryPeakUsageProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessor()
+ {
+ $processor = new MemoryPeakUsageProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+ $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']);
+ }
+
+ /**
+ * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessorWithoutFormatting()
+ {
+ $processor = new MemoryPeakUsageProcessor(true, false);
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+ $this->assertInternalType('int', $record['extra']['memory_peak_usage']);
+ $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php
new file mode 100644
index 0000000..4692dbf
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php
@@ -0,0 +1,42 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryUsageProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessor()
+ {
+ $processor = new MemoryUsageProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_usage', $record['extra']);
+ $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']);
+ }
+
+ /**
+ * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessorWithoutFormatting()
+ {
+ $processor = new MemoryUsageProcessor(true, false);
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_usage', $record['extra']);
+ $this->assertInternalType('int', $record['extra']['memory_usage']);
+ $this->assertGreaterThan(0, $record['extra']['memory_usage']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php
new file mode 100644
index 0000000..458d2a3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php
@@ -0,0 +1,30 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class ProcessIdProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\ProcessIdProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $processor = new ProcessIdProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('process_id', $record['extra']);
+ $this->assertInternalType('int', $record['extra']['process_id']);
+ $this->assertGreaterThan(0, $record['extra']['process_id']);
+ $this->assertEquals(getmypid(), $record['extra']['process_id']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php
new file mode 100644
index 0000000..029a0c0
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php
@@ -0,0 +1,43 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @dataProvider getPairs
+ */
+ public function testReplacement($val, $expected)
+ {
+ $proc = new PsrLogMessageProcessor;
+
+ $message = $proc(array(
+ 'message' => '{foo}',
+ 'context' => array('foo' => $val),
+ ));
+ $this->assertEquals($expected, $message['message']);
+ }
+
+ public function getPairs()
+ {
+ return array(
+ array('foo', 'foo'),
+ array('3', '3'),
+ array(3, '3'),
+ array(null, ''),
+ array(true, '1'),
+ array(false, ''),
+ array(new \stdClass, '[object stdClass]'),
+ array(array(), '[array]'),
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php
new file mode 100644
index 0000000..0d860c6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php
@@ -0,0 +1,49 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class TagProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\TagProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $tags = array(1, 2, 3);
+ $processor = new TagProcessor($tags);
+ $record = $processor($this->getRecord());
+
+ $this->assertEquals($tags, $record['extra']['tags']);
+ }
+
+ /**
+ * @covers Monolog\Processor\TagProcessor::__invoke
+ */
+ public function testProcessorTagModification()
+ {
+ $tags = array(1, 2, 3);
+ $processor = new TagProcessor($tags);
+
+ $record = $processor($this->getRecord());
+ $this->assertEquals($tags, $record['extra']['tags']);
+
+ $processor->setTags(array('a', 'b'));
+ $record = $processor($this->getRecord());
+ $this->assertEquals(array('a', 'b'), $record['extra']['tags']);
+
+ $processor->addTags(array('a', 'c', 'foo' => 'bar'));
+ $record = $processor($this->getRecord());
+ $this->assertEquals(array('a', 'b', 'a', 'c', 'foo' => 'bar'), $record['extra']['tags']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php
new file mode 100644
index 0000000..5d13058
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php
@@ -0,0 +1,33 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class UidProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\UidProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $processor = new UidProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('uid', $record['extra']);
+ }
+
+ public function testGetUid()
+ {
+ $processor = new UidProcessor(10);
+ $this->assertEquals(10, strlen($processor->getUid()));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php
new file mode 100644
index 0000000..4105baf
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php
@@ -0,0 +1,113 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class WebProcessorTest extends TestCase
+{
+ public function testProcessor()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'HTTP_REFERER' => 'D',
+ 'SERVER_NAME' => 'F',
+ 'UNIQUE_ID' => 'G',
+ );
+
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']);
+ $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']);
+ $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']);
+ $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']);
+ $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']);
+ $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']);
+ }
+
+ public function testProcessorDoNothingIfNoRequestUri()
+ {
+ $server = array(
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ );
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertEmpty($record['extra']);
+ }
+
+ public function testProcessorReturnNullIfNoHttpReferer()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'SERVER_NAME' => 'F',
+ );
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertNull($record['extra']['referrer']);
+ }
+
+ public function testProcessorDoesNotAddUniqueIdIfNotPresent()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'SERVER_NAME' => 'F',
+ );
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertFalse(isset($record['extra']['unique_id']));
+ }
+
+ public function testProcessorAddsOnlyRequestedExtraFields()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'SERVER_NAME' => 'F',
+ );
+
+ $processor = new WebProcessor($server, array('url', 'http_method'));
+ $record = $processor($this->getRecord());
+
+ $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']);
+ }
+
+ public function testProcessorConfiguringOfExtraFields()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'SERVER_NAME' => 'F',
+ );
+
+ $processor = new WebProcessor($server, array('url' => 'REMOTE_ADDR'));
+ $record = $processor($this->getRecord());
+
+ $this->assertSame(array('url' => 'B'), $record['extra']);
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testInvalidData()
+ {
+ new WebProcessor(new \stdClass);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php
new file mode 100644
index 0000000..ab89944
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php
@@ -0,0 +1,47 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\PsrLogMessageProcessor;
+use Psr\Log\Test\LoggerInterfaceTest;
+
+class PsrLogCompatTest extends LoggerInterfaceTest
+{
+ private $handler;
+
+ public function getLogger()
+ {
+ $logger = new Logger('foo');
+ $logger->pushHandler($handler = new TestHandler);
+ $logger->pushProcessor(new PsrLogMessageProcessor);
+ $handler->setFormatter(new LineFormatter('%level_name% %message%'));
+
+ $this->handler = $handler;
+
+ return $logger;
+ }
+
+ public function getLogs()
+ {
+ $convert = function ($record) {
+ $lower = function ($match) {
+ return strtolower($match[0]);
+ };
+
+ return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']);
+ };
+
+ return array_map($convert, $this->handler->getRecords());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/RegistryTest.php b/vendor/monolog/monolog/tests/Monolog/RegistryTest.php
new file mode 100644
index 0000000..15fdfbd
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/RegistryTest.php
@@ -0,0 +1,153 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+class RegistryTest extends \PHPUnit_Framework_TestCase
+{
+ protected function setUp()
+ {
+ Registry::clear();
+ }
+
+ /**
+ * @dataProvider hasLoggerProvider
+ * @covers Monolog\Registry::hasLogger
+ */
+ public function testHasLogger(array $loggersToAdd, array $loggersToCheck, array $expectedResult)
+ {
+ foreach ($loggersToAdd as $loggerToAdd) {
+ Registry::addLogger($loggerToAdd);
+ }
+ foreach ($loggersToCheck as $index => $loggerToCheck) {
+ $this->assertSame($expectedResult[$index], Registry::hasLogger($loggerToCheck));
+ }
+ }
+
+ public function hasLoggerProvider()
+ {
+ $logger1 = new Logger('test1');
+ $logger2 = new Logger('test2');
+ $logger3 = new Logger('test3');
+
+ return array(
+ // only instances
+ array(
+ array($logger1),
+ array($logger1, $logger2),
+ array(true, false),
+ ),
+ // only names
+ array(
+ array($logger1),
+ array('test1', 'test2'),
+ array(true, false),
+ ),
+ // mixed case
+ array(
+ array($logger1, $logger2),
+ array('test1', $logger2, 'test3', $logger3),
+ array(true, true, false, false),
+ ),
+ );
+ }
+
+ /**
+ * @covers Monolog\Registry::clear
+ */
+ public function testClearClears()
+ {
+ Registry::addLogger(new Logger('test1'), 'log');
+ Registry::clear();
+
+ $this->setExpectedException('\InvalidArgumentException');
+ Registry::getInstance('log');
+ }
+
+ /**
+ * @dataProvider removedLoggerProvider
+ * @covers Monolog\Registry::addLogger
+ * @covers Monolog\Registry::removeLogger
+ */
+ public function testRemovesLogger($loggerToAdd, $remove)
+ {
+ Registry::addLogger($loggerToAdd);
+ Registry::removeLogger($remove);
+
+ $this->setExpectedException('\InvalidArgumentException');
+ Registry::getInstance($loggerToAdd->getName());
+ }
+
+ public function removedLoggerProvider()
+ {
+ $logger1 = new Logger('test1');
+
+ return array(
+ array($logger1, $logger1),
+ array($logger1, 'test1'),
+ );
+ }
+
+ /**
+ * @covers Monolog\Registry::addLogger
+ * @covers Monolog\Registry::getInstance
+ * @covers Monolog\Registry::__callStatic
+ */
+ public function testGetsSameLogger()
+ {
+ $logger1 = new Logger('test1');
+ $logger2 = new Logger('test2');
+
+ Registry::addLogger($logger1, 'test1');
+ Registry::addLogger($logger2);
+
+ $this->assertSame($logger1, Registry::getInstance('test1'));
+ $this->assertSame($logger2, Registry::test2());
+ }
+
+ /**
+ * @expectedException \InvalidArgumentException
+ * @covers Monolog\Registry::getInstance
+ */
+ public function testFailsOnNonExistantLogger()
+ {
+ Registry::getInstance('test1');
+ }
+
+ /**
+ * @covers Monolog\Registry::addLogger
+ */
+ public function testReplacesLogger()
+ {
+ $log1 = new Logger('test1');
+ $log2 = new Logger('test2');
+
+ Registry::addLogger($log1, 'log');
+
+ Registry::addLogger($log2, 'log', true);
+
+ $this->assertSame($log2, Registry::getInstance('log'));
+ }
+
+ /**
+ * @expectedException \InvalidArgumentException
+ * @covers Monolog\Registry::addLogger
+ */
+ public function testFailsOnUnspecifiedReplacement()
+ {
+ $log1 = new Logger('test1');
+ $log2 = new Logger('test2');
+
+ Registry::addLogger($log1, 'log');
+
+ Registry::addLogger($log2, 'log');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/TestCase.php b/vendor/monolog/monolog/tests/Monolog/TestCase.php
new file mode 100644
index 0000000..4eb7b4c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/TestCase.php
@@ -0,0 +1,58 @@
+
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+class TestCase extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @return array Record
+ */
+ protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array())
+ {
+ return array(
+ 'message' => $message,
+ 'context' => $context,
+ 'level' => $level,
+ 'level_name' => Logger::getLevelName($level),
+ 'channel' => 'test',
+ 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))),
+ 'extra' => array(),
+ );
+ }
+
+ /**
+ * @return array
+ */
+ protected function getMultipleRecords()
+ {
+ return array(
+ $this->getRecord(Logger::DEBUG, 'debug message 1'),
+ $this->getRecord(Logger::DEBUG, 'debug message 2'),
+ $this->getRecord(Logger::INFO, 'information'),
+ $this->getRecord(Logger::WARNING, 'warning'),
+ $this->getRecord(Logger::ERROR, 'error'),
+ );
+ }
+
+ /**
+ * @return Monolog\Formatter\FormatterInterface
+ */
+ protected function getIdentityFormatter()
+ {
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $formatter->expects($this->any())
+ ->method('format')
+ ->will($this->returnCallback(function ($record) { return $record['message']; }));
+
+ return $formatter;
+ }
+}
diff --git a/vendor/psr/log/.gitignore b/vendor/psr/log/.gitignore
new file mode 100644
index 0000000..22d0d82
--- /dev/null
+++ b/vendor/psr/log/.gitignore
@@ -0,0 +1 @@
+vendor
diff --git a/vendor/psr/log/LICENSE b/vendor/psr/log/LICENSE
new file mode 100644
index 0000000..474c952
--- /dev/null
+++ b/vendor/psr/log/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2012 PHP Framework Interoperability Group
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/vendor/psr/log/Psr/Log/AbstractLogger.php b/vendor/psr/log/Psr/Log/AbstractLogger.php
new file mode 100644
index 0000000..00f9034
--- /dev/null
+++ b/vendor/psr/log/Psr/Log/AbstractLogger.php
@@ -0,0 +1,120 @@
+log(LogLevel::EMERGENCY, $message, $context);
+ }
+
+ /**
+ * Action must be taken immediately.
+ *
+ * Example: Entire website down, database unavailable, etc. This should
+ * trigger the SMS alerts and wake you up.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function alert($message, array $context = array())
+ {
+ $this->log(LogLevel::ALERT, $message, $context);
+ }
+
+ /**
+ * Critical conditions.
+ *
+ * Example: Application component unavailable, unexpected exception.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function critical($message, array $context = array())
+ {
+ $this->log(LogLevel::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Runtime errors that do not require immediate action but should typically
+ * be logged and monitored.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function error($message, array $context = array())
+ {
+ $this->log(LogLevel::ERROR, $message, $context);
+ }
+
+ /**
+ * Exceptional occurrences that are not errors.
+ *
+ * Example: Use of deprecated APIs, poor use of an API, undesirable things
+ * that are not necessarily wrong.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function warning($message, array $context = array())
+ {
+ $this->log(LogLevel::WARNING, $message, $context);
+ }
+
+ /**
+ * Normal but significant events.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function notice($message, array $context = array())
+ {
+ $this->log(LogLevel::NOTICE, $message, $context);
+ }
+
+ /**
+ * Interesting events.
+ *
+ * Example: User logs in, SQL logs.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function info($message, array $context = array())
+ {
+ $this->log(LogLevel::INFO, $message, $context);
+ }
+
+ /**
+ * Detailed debug information.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function debug($message, array $context = array())
+ {
+ $this->log(LogLevel::DEBUG, $message, $context);
+ }
+}
diff --git a/vendor/psr/log/Psr/Log/InvalidArgumentException.php b/vendor/psr/log/Psr/Log/InvalidArgumentException.php
new file mode 100644
index 0000000..67f852d
--- /dev/null
+++ b/vendor/psr/log/Psr/Log/InvalidArgumentException.php
@@ -0,0 +1,7 @@
+logger = $logger;
+ }
+}
diff --git a/vendor/psr/log/Psr/Log/LoggerInterface.php b/vendor/psr/log/Psr/Log/LoggerInterface.php
new file mode 100644
index 0000000..476bb96
--- /dev/null
+++ b/vendor/psr/log/Psr/Log/LoggerInterface.php
@@ -0,0 +1,114 @@
+log(LogLevel::EMERGENCY, $message, $context);
+ }
+
+ /**
+ * Action must be taken immediately.
+ *
+ * Example: Entire website down, database unavailable, etc. This should
+ * trigger the SMS alerts and wake you up.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function alert($message, array $context = array())
+ {
+ $this->log(LogLevel::ALERT, $message, $context);
+ }
+
+ /**
+ * Critical conditions.
+ *
+ * Example: Application component unavailable, unexpected exception.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function critical($message, array $context = array())
+ {
+ $this->log(LogLevel::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Runtime errors that do not require immediate action but should typically
+ * be logged and monitored.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function error($message, array $context = array())
+ {
+ $this->log(LogLevel::ERROR, $message, $context);
+ }
+
+ /**
+ * Exceptional occurrences that are not errors.
+ *
+ * Example: Use of deprecated APIs, poor use of an API, undesirable things
+ * that are not necessarily wrong.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function warning($message, array $context = array())
+ {
+ $this->log(LogLevel::WARNING, $message, $context);
+ }
+
+ /**
+ * Normal but significant events.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function notice($message, array $context = array())
+ {
+ $this->log(LogLevel::NOTICE, $message, $context);
+ }
+
+ /**
+ * Interesting events.
+ *
+ * Example: User logs in, SQL logs.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function info($message, array $context = array())
+ {
+ $this->log(LogLevel::INFO, $message, $context);
+ }
+
+ /**
+ * Detailed debug information.
+ *
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function debug($message, array $context = array())
+ {
+ $this->log(LogLevel::DEBUG, $message, $context);
+ }
+
+ /**
+ * Logs with an arbitrary level.
+ *
+ * @param mixed $level
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ abstract public function log($level, $message, array $context = array());
+}
diff --git a/vendor/psr/log/Psr/Log/NullLogger.php b/vendor/psr/log/Psr/Log/NullLogger.php
new file mode 100644
index 0000000..553a3c5
--- /dev/null
+++ b/vendor/psr/log/Psr/Log/NullLogger.php
@@ -0,0 +1,27 @@
+logger) { }`
+ * blocks.
+ */
+class NullLogger extends AbstractLogger
+{
+ /**
+ * Logs with an arbitrary level.
+ *
+ * @param mixed $level
+ * @param string $message
+ * @param array $context
+ * @return null
+ */
+ public function log($level, $message, array $context = array())
+ {
+ // noop
+ }
+}
diff --git a/vendor/psr/log/Psr/Log/Test/LoggerInterfaceTest.php b/vendor/psr/log/Psr/Log/Test/LoggerInterfaceTest.php
new file mode 100644
index 0000000..a932815
--- /dev/null
+++ b/vendor/psr/log/Psr/Log/Test/LoggerInterfaceTest.php
@@ -0,0 +1,116 @@
+ "
+ *
+ * Example ->error('Foo') would yield "error Foo"
+ *
+ * @return string[]
+ */
+ abstract function getLogs();
+
+ public function testImplements()
+ {
+ $this->assertInstanceOf('Psr\Log\LoggerInterface', $this->getLogger());
+ }
+
+ /**
+ * @dataProvider provideLevelsAndMessages
+ */
+ public function testLogsAtAllLevels($level, $message)
+ {
+ $logger = $this->getLogger();
+ $logger->{$level}($message, array('user' => 'Bob'));
+ $logger->log($level, $message, array('user' => 'Bob'));
+
+ $expected = array(
+ $level.' message of level '.$level.' with context: Bob',
+ $level.' message of level '.$level.' with context: Bob',
+ );
+ $this->assertEquals($expected, $this->getLogs());
+ }
+
+ public function provideLevelsAndMessages()
+ {
+ return array(
+ LogLevel::EMERGENCY => array(LogLevel::EMERGENCY, 'message of level emergency with context: {user}'),
+ LogLevel::ALERT => array(LogLevel::ALERT, 'message of level alert with context: {user}'),
+ LogLevel::CRITICAL => array(LogLevel::CRITICAL, 'message of level critical with context: {user}'),
+ LogLevel::ERROR => array(LogLevel::ERROR, 'message of level error with context: {user}'),
+ LogLevel::WARNING => array(LogLevel::WARNING, 'message of level warning with context: {user}'),
+ LogLevel::NOTICE => array(LogLevel::NOTICE, 'message of level notice with context: {user}'),
+ LogLevel::INFO => array(LogLevel::INFO, 'message of level info with context: {user}'),
+ LogLevel::DEBUG => array(LogLevel::DEBUG, 'message of level debug with context: {user}'),
+ );
+ }
+
+ /**
+ * @expectedException Psr\Log\InvalidArgumentException
+ */
+ public function testThrowsOnInvalidLevel()
+ {
+ $logger = $this->getLogger();
+ $logger->log('invalid level', 'Foo');
+ }
+
+ public function testContextReplacement()
+ {
+ $logger = $this->getLogger();
+ $logger->info('{Message {nothing} {user} {foo.bar} a}', array('user' => 'Bob', 'foo.bar' => 'Bar'));
+
+ $expected = array('info {Message {nothing} Bob Bar a}');
+ $this->assertEquals($expected, $this->getLogs());
+ }
+
+ public function testObjectCastToString()
+ {
+ $dummy = $this->getMock('Psr\Log\Test\DummyTest', array('__toString'));
+ $dummy->expects($this->once())
+ ->method('__toString')
+ ->will($this->returnValue('DUMMY'));
+
+ $this->getLogger()->warning($dummy);
+ }
+
+ public function testContextCanContainAnything()
+ {
+ $context = array(
+ 'bool' => true,
+ 'null' => null,
+ 'string' => 'Foo',
+ 'int' => 0,
+ 'float' => 0.5,
+ 'nested' => array('with object' => new DummyTest),
+ 'object' => new \DateTime,
+ 'resource' => fopen('php://memory', 'r'),
+ );
+
+ $this->getLogger()->warning('Crazy context data', $context);
+ }
+
+ public function testContextExceptionKeyCanBeExceptionOrOtherValues()
+ {
+ $this->getLogger()->warning('Random message', array('exception' => 'oops'));
+ $this->getLogger()->critical('Uncaught Exception!', array('exception' => new \LogicException('Fail')));
+ }
+}
+
+class DummyTest
+{
+}
\ No newline at end of file
diff --git a/vendor/psr/log/README.md b/vendor/psr/log/README.md
new file mode 100644
index 0000000..574bc1c
--- /dev/null
+++ b/vendor/psr/log/README.md
@@ -0,0 +1,45 @@
+PSR Log
+=======
+
+This repository holds all interfaces/classes/traits related to
+[PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md).
+
+Note that this is not a logger of its own. It is merely an interface that
+describes a logger. See the specification for more details.
+
+Usage
+-----
+
+If you need a logger, you can use the interface like this:
+
+```php
+logger = $logger;
+ }
+
+ public function doSomething()
+ {
+ if ($this->logger) {
+ $this->logger->info('Doing work');
+ }
+
+ // do something useful
+ }
+}
+```
+
+You can then pick one of the implementations of the interface to get a logger.
+
+If you want to implement the interface, you can require this package and
+implement `Psr\Log\LoggerInterface` in your code. Please read the
+[specification text](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md)
+for details.
diff --git a/vendor/psr/log/composer.json b/vendor/psr/log/composer.json
new file mode 100644
index 0000000..6bdcc21
--- /dev/null
+++ b/vendor/psr/log/composer.json
@@ -0,0 +1,17 @@
+{
+ "name": "psr/log",
+ "description": "Common interface for logging libraries",
+ "keywords": ["psr", "psr-3", "log"],
+ "license": "MIT",
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "autoload": {
+ "psr-0": {
+ "Psr\\Log\\": ""
+ }
+ }
+}